☺Stock list--70167

EOS med chem is the only manufacturer that provides excellent quality chemistry products and services at affordable rates. The experts working here are highly trained to handle these chemicals used in the creation of medicines used for treating various life-threatening diseases. We are into the manufacturing of chemical products after doing a deep research for the same.

EOS team of experts holds the work experience of more than ten years, and therefore we can assure you about the quality and superiority of the products and services we offer to all our valued clients around the globe. At present, this organization is listed among the most leading pharmaceutical suppliers around the world. We always supply products keeping the affordability in mind.

2018 CHINA CPHI, W4E82

EOS Med Chem, Medchem is Big
執大象，天下往，往而無害，安平泰
WEB: www.eosmedchem.com
EMAIL: info@eosmedchem.com; eosmedchem@gmail.com; eosmedchem@qq.com  
TEL: 0086-531-69905422
GMP PLANT: No. 37, Yulong Road, Qufu City, Shandong Province.

1,3-diethyl 2-(2-oxo-2-phenylethyl)-2,3-dihydro-1H-1,3-benzodiazole-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(2-oxo-2-phenylethyl)-2,3-dihydro-1H-imidazole-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-(2-oxo-2-phenylethylidene)propanedioate, CAS# 89201-08-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-(2-oxocyclohexyl)-2,3-dihydro-1H-1,3-benzodiazole-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-(2-oxopropyl)-2,3-dihydro-1H-1,3-benzodiazole-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-(2-phenylprop-2-en-1-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-{[(tert-butoxy)carbonyl]amino}propyl)propanedioate, CAS# 116861-30-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-cyanophenyl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-cyanoprop-2-en-1-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-fluorophenyl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-methoxy-4-nitrophenyl)-2-methylpropanedioate, CAS# 58810-00-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-methoxybenzoyl)propanedioate, CAS# 412019-72-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-methylbut-3-en-1-yl)-2-(prop-2-en-1-yl)propanedioate, CAS# 176376-85-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-methylbutan-2-yl)propanedioate, CAS# 759-29-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-methylpent-4-en-2-yl)propanedioate, CAS# 98096-25-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-methylpentan-2-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-methylphenyl)propanedioate, CAS# 94112-78-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-nitrophenyl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-oxo-1,3-diphenylpropyl)propanedioate, CAS# 77670-30-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-oxo-1-phenylpropyl)propanedioate, CAS# 69537-74-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-oxo-2,3-dihydro-1H-isoindol-1-yl)propanedioate, CAS# 1380329-03-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-oxobutan-2-yl)malonate, CAS# 77320-51-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-oxobutyl)-2-(prop-2-en-1-yl)propanedioate, CAS# 92746-99-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-oxocycloheptyl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-oxohexan-2-yl)propanedioate, CAS# 77596-88-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-phenylprop-2-yn-1-yl)propanedioate, CAS# 93006-71-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-phenylpropyl)propanedioate, CAS# 26395-09-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-(3-phenylpropylidene)propanedioate, CAS# 103766-22-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-(4,5-dimethyl-2-methylidenehex-4-en-1-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(4-acetyl-2-nitrophenyl)propanedioate, CAS# 777062-24-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-(4-acetylphenyl)propanedioate, CAS# 78024-76-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-(4-benzoyl-2-nitrophenyl)propanedioate, CAS# 91713-64-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-(4-bromophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate, CAS# 4759-57-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate, CAS# 294194-13-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(4-hydroxyphenyl)propanedioate, CAS# 80887-79-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(4-methoxybenzoyl)propanedioate, CAS# 75907-18-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-(4-methoxyphenyl)-2-methylpropanedioate, CAS# 74610-81-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-(4-methylbenzenesulfonamido)propanedioate, CAS# 1022820-87-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-(4-oxopent-2-en-1-ylidene)propanedioate, CAS# 66085-96-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-(4-phenoxyphenyl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-(4-tert-butylphenyl)propanedioate, CAS# 94959-58-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-(acetyloxy)-2-(5-benzoyl-1H-pyrrol-2-yl)propanedioate, CAS# 144710-34-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-(bromomethyl)-2-phenylpropanedioate, CAS# 214214-66-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-(but-2-yn-1-yl)-2-methylpropanedioate, CAS# 182809-41-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-(but-3-en-1-yl)-2-(2-methylprop-2-en-1-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-(butylamino)propanedioate, CAS# 140429-74-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-(cyanomethyl)-2-propylpropanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(cyclopropylformamido)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(dec-2-en-1-yl)-2-hydroxypropanedioate, CAS# 90107-12-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-(diethoxymethyl)propanedioate, CAS# 7251-32-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-(difluoromethyl)-2-methylpropanedioate, CAS# 49574-76-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-(difluoromethyl)-2-phenylpropanedioate, CAS# 791-25-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-(diiodomethyl)-2-methylpropanedioate, CAS# 311807-55-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-(disulfanylmethylidene)propanedioate, CAS# 53598-85-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-(ethylsulfanyl)propanedioate, CAS# 39133-64-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-(furan-2-yl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate, CAS# 161265-84-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-(furan-2-yl)propanedioate, CAS# 40572-09-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-(hex-5-en-1-yl)propanedioate, CAS# 69298-59-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-(hydroxymethyl)-2-{[tris(4-methoxyphenyl)methoxy]methyl}propanedioate, CAS# 363625-51-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-(hydroxymethyl)-2-methylpropanedioate, CAS# 72999-08-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(naphthalen-2-yl)propanedioate, CAS# 53171-45-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-(pent-2-yn-1-yl)propanedioate, CAS# 98442-18-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-(propylamino)propanedioate, CAS# 132875-25-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-(pyridin-3-yl)propanedioate, CAS# 27828-72-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-diethyl 2-(tert-butylimino)propanedioate, CAS# 103218-06-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-(tert-butylperoxy)-2-(prop-2-en-1-yl)propanedioate, CAS# 1237543-18-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-diethyl 2,2-bis(3-methylbut-2-en-1-yl)propanedioate, CAS# 97037-74-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diethyl 2,2-bis(8-iodooctyl)propanedioate, CAS# 74964-54-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-diethyl 2,2-bis[(nitrooxy)methyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diethyl 2,2-dipentylpropanedioate, CAS# 220776-75-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diethyl 2,4-dimethyl-5-{[tris(propan-2-yl)silyl]methylidene}cyclopenta-1,3-diene-1,3-dicarboxylate, CAS# 1352744-98-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-[({methyl[(prop-2-en-1-ylsulfanyl)methanethioyl]amino}imino)methyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-1-(2-methoxyphenyl)-3-oxopropyl]propanedioate, CAS# 1126906-43-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-1-(2-nitrophenyl)-3-oxopropyl]propanedioate, CAS# 1126906-39-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-1-(3-chlorophenyl)-3-oxopropyl]propanedioate, CAS# 1126906-51-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-1-(4-chlorophenyl)-3-oxo-3-phenylpropyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-1-(4-chlorophenyl)-3-oxopropyl]propanedioate, CAS# 1126906-37-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-1-(4-fluorophenyl)-3-oxopropyl]propanedioate, CAS# 1126906-49-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-1-(4-methoxyphenyl)-3-oxopropyl]propanedioate, CAS# 1220981-19-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-1-(4-methylphenyl)-2-nitroethyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-1-(4-methylphenyl)-3-oxopropyl]propanedioate, CAS# 1126906-47-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-1-(4-nitrophenyl)-3-oxopropyl]propanedioate, CAS# 1126906-41-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-2,2-dimethyl-5-oxocyclohexyl]propanedioate, CAS# 1101846-78-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-2-nitro-1-phenylethyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-3-oxo-1,3-diphenylpropyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-3-oxo-1-phenylbutyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-3-oxo-1-phenylpropyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-3-oxocycloheptyl]propanedioate, CAS# 1056017-53-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-3-oxocyclohexyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R)-3-oxocyclopentyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R,2S)-1-(4-bromophenyl)-3-oxo-2-[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]propyl]propanedioate, CAS# 1381851-46-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R,2S)-1-(4-chlorophenyl)-3-oxo-2-[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]propyl]propanedioate, CAS# 1381851-44-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R,2S)-1-(4-methoxyphenyl)-3-oxo-2-[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]propyl]propanedioate, CAS# 1381851-37-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R,2S)-1-(4-methylphenyl)-3-oxo-2-[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]propyl]propanedioate, CAS# 1381851-38-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R,2S)-1-(4-nitrophenyl)-3-oxo-2-[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]propyl]propanedioate, CAS# 1381851-42-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1R,2S)-3-oxo-1-phenyl-2-[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]propyl]propanedioate, CAS# 1381851-35-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1S)-1-(4-chlorophenyl)-2-nitroethyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1S)-1-(4-nitrophenyl)-3-oxobutyl]propanedioate, CAS# 1101846-81-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1S)-2-nitro-1-phenylethyl]propanedioate, CAS# 252338-27-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1S)-3-oxo-1,3-diphenylpropyl]propanedioate, CAS# 182511-39-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1S)-3-oxo-1-phenylbutyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1S)-3-oxocyclopentyl]propanedioate, CAS# 193530-87-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(1S,2S)-1-hydroxy-1,2-dihydronaphthalen-2-yl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]propanedioate, CAS# 756488-06-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(2,2-dichlorocyclopropyl)methyl]propanedioate, CAS# 71161-85-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(2,4-dimethoxyphenyl)methylidene]propanedioate, CAS# 7324-86-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(2,5-dichlorophenyl)methylidene]propanedioate, CAS# 321602-06-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(2-chlorophenyl)methyl]propanedioate, CAS# 77738-21-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(2-cyanoeth-1-en-1-yl)amino]propanedioate, CAS# 1021175-71-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(2E)-3-(4-methoxyphenyl)prop-2-en-1-ylidene]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(2E)-but-2-en-1-ylidene]propanedioate, CAS# 92173-10-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(2H-indazol-3-ylamino)methylidene]propanedioate, CAS# 59591-74-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(2-hydroxyphenyl)methyl]propanedioate, CAS# 4895-96-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(2-iodophenyl)methyl]propanedioate, CAS# 111373-31-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(2R)-1-oxo-3-phenylpropan-2-yl]propanedioate, CAS# 1085512-00-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(2R)-1-oxooctan-2-yl]propanedioate, CAS# 1085511-96-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(3,4,5-trihydroxyphenyl)methylidene]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(3,4-dimethoxyphenyl)methylidene]propanedioate, CAS# 15818-13-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(3,5-dimethoxyphenyl)methyl]-2-(prop-2-en-1-yl)propanedioate, CAS# 123297-77-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(3-chlorophenyl)methyl]propanedioate, CAS# 70146-77-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(3-cyanophenyl)methyl]-2-acetamidopropanedioate, CAS# 52117-00-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(3-hydroxyphenyl)methylidene]propanedioate, CAS# 34708-67-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(3-methylbutoxy)methylidene]propanedioate, CAS# 188760-99-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(3R)-3,7-dimethyloct-6-en-1-ylidene]propanedioate, CAS# 106431-77-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(4-bromo-1H-indol-3-yl)methyl]-2-formamidopropanedioate, CAS# 64258-89-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(4-bromophenyl)[(4-bromophenyl)amino]methyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(4-bromophenyl)[(4-chlorophenyl)amino]methyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(4-cyanophenyl)methyl]propanedioate, CAS# 57180-99-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(4-cyanophenyl)methylidene]propanedioate, CAS# 126989-04-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(4-fluorophenyl)formamido]propanedioate, CAS# 787563-73-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(4-methoxy-2-nitrophenyl)methylidene]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(4-methoxyphenyl)amino]propanedioate, CAS# 24043-40-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(4-methoxyphenyl)formamido]propanedioate, CAS# 887248-41-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(4-methylphenyl)formamido]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(4-methylphenyl)methyl]propanedioate, CAS# 6619-58-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(4-nitrophenyl)formamido]propanedioate, CAS# 129221-15-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(5-methylpyridin-2-yl)formamido]propanedioate, CAS# 787564-35-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(6-bromo-2H-1,3-benzodioxol-5-yl)methylidene]propanedioate, CAS# 107377-28-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(benzyloxy)methyl]-2-methylpropanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(cyclopropylamino)methylidene]propanedioate, CAS# 131775-91-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(naphthalen-2-yl)methyl]-2-(prop-2-yn-1-yl)propanedioate, CAS# 288632-82-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(naphthalen-2-yl)methyl]propanedioate, CAS# 93903-75-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(phenylcarbamoyl)amino]propanedioate, CAS# 54001-50-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(phenylsulfanyl)methylidene]propanedioate, CAS# 72798-17-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(propan-2-yl)imino]propanedioate, CAS# 103218-05-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-diethyl 2-[(S)-(4-nitrophenyl)[(1S)-2-oxocyclohexyl]methyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-[1-(4-methoxyphenyl)ethenyl]-2-methylpropanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[1-(4-methoxyphenyl)prop-2-en-1-yl]propanedioate, CAS# 1127889-64-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[1-(4-methylbenzenesulfonamido)ethyl]propanedioate, CAS# 1373511-56-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-[1-(4-propanoyl-2,5-dihydrofuran-3-yl)propylidene]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-diethyl 2-[1-(adamantan-1-yl)ethyl]propanedioate, CAS# 1620757-68-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-[1-(oxolan-2-yl)ethyl]propanedioate, CAS# 1070251-02-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[1-(trimethylsilyl)ethyl]propanedioate, CAS# 18141-46-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[2-(4-carbamoyl-1H-imidazol-5-yl)diazen-1-yl]-2-nitropropanedioate, CAS# 287964-47-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-[2-(acetyloxy)propyl]-2-methylpropanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-[2-(benzyloxy)ethyl]-2-(propan-2-yl)propanedioate, CAS# 1123787-27-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[2-(ethoxycarbonyl)-1,2-dihydroisoquinolin-1-yl]propanedioate, CAS# 817556-13-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-[2-(phenylselanyl)ethyl]propanedioate, CAS# 90475-36-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-[2-nitro-1-(2-nitrophenyl)ethyl]propanedioate, CAS# 1448173-62-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-[3-(benzyloxy)-5-fluorophenyl]propanedioate, CAS# 179420-64-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-diethyl 2-[3-(methoxycarbonyl)phenyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[4-(1,3-diethoxy-1,3-dioxopropan-2-ylidene)cyclohexylidene]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-[4-(acetyloxy)butyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[4-(dimethylamino)phenyl]propanedioate, CAS# 83026-39-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-[4-(ethoxycarbonyl)phenyl]-2-methylpropanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-[4-(methoxycarbonyl)phenyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-[4-(trifluoromethyl)phenyl]propanedioate, CAS# 146533-53-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-[bis(3-methylbutoxy)methyl]propanedioate, CAS# 188761-04-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-[bis(chloromethyl)phosphoryl]propanedioate, CAS# 742101-84-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-[phenyl(trimethylsilyl)methyl]propanedioate, CAS# 54056-54-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(1H-indazol-5-yl)amino]methylidene}propanedioate, CAS# 68535-06-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(1-methyl-1H-pyrazol-5-yl)amino]methylidene}propanedioate, CAS# 37799-77-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(1R)-1-phenylethyl]amino}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(1R,5S)-6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl]methyl}-2-hydroxypropanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(2,5-difluorophenyl)amino]methylidene}propanedioate, CAS# 185010-73-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(2-aminophenyl)amino]methylidene}propanedioate, CAS# 14525-98-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(2-chloro-5-methoxyphenyl)amino]methylidene}propanedioate, CAS# 26832-88-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(2-ethoxy-2-oxoethyl)(phenyl)amino]methylidene}propanedioate, CAS# 65217-23-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(2-fluoro-4-iodophenyl)amino]methylidene}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(2-methylphenyl)amino]methylidene}propanedioate, CAS# 19146-73-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(2-nitrophenyl)amino]methylidene}propanedioate, CAS# 7255-58-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(3-{[3-ethoxy-2-(ethoxycarbonyl)-3-oxoprop-1-en-1-yl]amino}propyl)amino]methylidene}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(3-bromophenyl)amino]methylidene}propanedioate, CAS# 351893-47-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(3-chloro-2-methylphenyl)amino]methylidene}propanedioate, CAS# 58666-10-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(3-chlorophenyl)amino](3-nitrophenyl)methyl}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(3-chlorophenyl)amino](phenyl)methyl}propanedioate, CAS# 1030388-01-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(3-cyanophenyl)amino]methylidene}propanedioate, CAS# 59551-10-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(3-fluorophenyl)amino]methylidene}propanedioate, CAS# 26832-95-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(3-oxocyclohex-1-en-1-yl)amino]methylidene}propanedioate, CAS# 72912-99-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(4-benzylphenyl)amino]methylidene}propanedioate, CAS# 24805-59-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(4-bromo-3-methoxyphenyl)amino]methylidene}propanedioate, CAS# 953803-77-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(4-bromophenyl)amino](2,6-dichlorophenyl)methyl}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(4-bromophenyl)amino](2-chlorophenyl)methyl}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(4-hydroxyphenyl)amino]methylidene}propanedioate, CAS# 111185-74-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(4-iodophenyl)amino]methylidene}propanedioate, CAS# 40107-05-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(4-methoxyphenyl)methyl]amino}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(4-nitrophenyl)amino]methylidene}propanedioate, CAS# 78596-42-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(5-methoxy-5-oxopentyl)amino]methylidene}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(5-methyl-1,2-oxazol-3-yl)amino]methylidene}propanedioate, CAS# 85207-74-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(6-bromopyridin-3-yl)amino]methylidene}propanedioate, CAS# 1220700-73-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(6-methoxy-6-oxohexyl)amino]methylidene}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(6-methylpyridin-2-yl)amino]methylidene}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(naphthalen-1-yl)amino]methylidene}propanedioate, CAS# 131775-94-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[(tert-butyldimethylsilyl)oxy]methyl}-2-(hydroxymethyl)propanedioate, CAS# 924884-95-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[1,1'-biphenyl]-4-yl}-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate, CAS# 143867-42-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[1,1'-biphenyl]-4-yl}propanedioate, CAS# 6725-51-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[2-bromo-5-(trifluoromethyl)phenyl]methyl}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-diethyl 2-{[methyl(phenyl)carbamoyl]methyl}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-{1-[(5-methyl-1,2-oxazol-3-yl)amino]ethylidene}propanedioate, CAS# 1228657-25-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-acetamido-2-(16-hydroxyhexadecyl)propanedioate, CAS# 1426083-44-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-acetamido-2-(2-nitro-1-phenylethyl)propanedioate, CAS# 93437-31-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-diethyl 2-acetamido-2-(4-phenylbutyl)propanedioate, CAS# 80887-21-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-acetamido-2-(pent-4-en-1-yl)propanedioate, CAS# 10325-16-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-acetamido-2-(prop-2-en-1-yl)propanedioate, CAS# 14109-62-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-acetamido-2-[(1S)-2-nitro-1-phenylethyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-amino-2-phenylpropanedioate, CAS# 22225-53-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-benzyl-2-(2-methylprop-2-en-1-yl)propanedioate, CAS# 37119-66-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-benzyl-2-(prop-2-yn-1-yl)propanedioate, CAS# 288632-71-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-benzyl-2-(tert-butylperoxy)propanedioate, CAS# 1237543-05-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-benzyl-2-{[(tert-butoxy)carbonyl]amino}propanedioate, CAS# 518314-53-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-benzyl-2-hydroxypropanedioate, CAS# 56150-08-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-bromo-2-phenylpropanedioate, CAS# 69836-07-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-butyl-2-({4-[2-butyl-3-ethoxy-2-(ethoxycarbonyl)-3-oxopropyl]-2,5-dimethylphenyl}methyl)propanedioate, CAS# 1268257-83-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-butyl-2-(3-oxo-1,3-diphenylpropyl)propanedioate, CAS# 75919-30-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-butyl-2-(prop-2-yn-1-yl)propanedioate, CAS# 100964-52-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-butyl-2-hydroxypropanedioate, CAS# 58567-07-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-chloro-2-fluoropropanedioate, CAS# 130409-82-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-decanoylpropanedioate, CAS# 15776-03-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-decylidenepropanedioate, CAS# 135692-97-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-ethyl-2-(3-oxo-1,3-diphenylpropyl)propanedioate, CAS# 75919-29-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-ethyl-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-hexadecyl-2-methylpropanedioate, CAS# 52303-65-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-hydroxy-2-(1-methyl-1H-pyrrol-2-yl)propanedioate, CAS# 95680-26-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-hydroxy-2-(2-oxo-2-phenylethyl)propanedioate, CAS# 80989-82-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-hydroxy-2-(2-oxocyclohexyl)propanedioate, CAS# 57346-40-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-hydroxy-2-(2-phenylprop-2-en-1-yl)propanedioate, CAS# 78925-84-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-diethyl 2-hydroxy-2-(5-methylfuran-2-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 2-hydroxy-2-[(2-nitrophenyl)methyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-hydroxy-2-[(5-methylthiophen-2-yl)methyl]propanedioate, CAS# 95680-23-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-hydroxy-2-[2-(4-methylcyclohex-3-en-1-yl)prop-2-en-1-yl]propanedioate, CAS# 73961-91-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-hydroxy-2-phenylpropanedioate, CAS# 73640-03-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-diethyl 2-hydroxy-5-(pyrrolidin-1-yl)benzene-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diethyl 2-hydroxybenzene-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-iodopropanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-methyl-2-(1-phenylethenyl)propanedioate, CAS# 35293-95-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate, CAS# 58809-99-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-diethyl 2-methyl-2-(4-methylphenyl)propanedioate, CAS# 124493-34-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-diethyl 2-methyl-2-[(2E)-3-phenylprop-2-en-1-yl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-diethyl 2-methyl-2-[2-(thiophen-2-yl)ethyl]propanedioate, CAS# 19995-39-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-diethyl 2-methylnaphthalene-1,3-dicarboxylate, CAS# 1280677-90-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-diethyl 2-oxo-2,3-dihydro-1H-1,3-benzodiazole-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-diethyl 2-phenyl-2-(phenylsulfanyl)propanedioate, CAS# 82751-22-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-diethyl 4,5-dihydroxycyclopenta-1(5),3-diene-1,3-dicarboxylate, CAS# 103008-86-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-diethyl 4-hydroxy-2-(2-hydroxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-diethyl 4-hydroxy-4-methyl-2-(4-methylphenyl)-6-oxocyclohexane-1,3-dicarboxylate, CAS# 79988-72-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-diethyl 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-diethyl 5-(benzyloxy)benzene-1,3-dicarboxylate, CAS# 251912-45-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diethyl 5-[(3-{[3,5-bis(ethoxycarbonyl)phenoxy]methyl}phenyl)methoxy]benzene-1,3-dicarboxylate, CAS# 147566-72-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-diethyl 5-methylbenzene-1,3-dicarboxylate, CAS# 100613-06-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl 6-fluoro-2-methylnaphthalene-1,3-dicarboxylate, CAS# 1280678-02-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diethyl 9,10-dioxo-9,10-dihydroanthracene-1,3-dicarboxylate, CAS# 1606171-82-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diethyl-[1,3]diazetidine-2,4-dione, CAS# 23336-34-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-diethyl-1,3-bis(4-nitrophenyl)urea, CAS# 3846-49-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-diethyl-1,3-diazinan-2-one, CAS# 30826-85-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethyl-1H-1,3-benzodiazol-3-ium bromide, CAS# 95348-62-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-diethyl-1H-imidazol-3-ium bromide, CAS# 54304-66-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-diethyl-1-nitrosourea, CAS# 49540-32-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-diethyl-2-(2-phenylethynyl)benzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-diethyl-2,4-dimethyl-benzene, CAS# 96857-28-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-diethyl-2,4-pyrimidindione, CAS# 22390-04-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-diethyl-2-isothiocyanatobenzene, CAS# 25343-69-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-diethyl-2-nitrobenzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-diethyl-2-propyl-1,2-dihydro-quinoline, CAS# 61037-81-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-diethyl-3a,8a-dihydroxy-1H,2H,3H,3aH,8H,8aH-indeno[1,2-d]imidazolidine-2,8-dione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-diethyl-4,5-dimethyl-2,3-dihydro-1H-imidazole-2-thione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-diethyl-4-methyl-octahydroimidazo[4,5-d]imidazolidine-2,5-dione, CAS# 263403-91-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diethyl-7-(2-hydroxy-ethyl)-3,7-dihydro-purine-2,6-dione, CAS# 31542-51-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-diethyl-7H-purine-2,6-dione, CAS# 5169-95-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diethylbarbituric acid, CAS# 32479-73-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-diethyl-benzene-1,3-diyloxydiacetate, CAS# 66644-04-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diethylbenzimidazolium iodide, CAS# 24351-22-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-diethylcyclohexane, CAS# 1678-99-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-diethyl-imidazolidin-2-one, CAS# 40424-21-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diethylimidazolidine-2-thione, CAS# 30826-80-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-Diethylphenobarbital, CAS# 38024-60-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-diethylquinoxalin-2(1H)-one, CAS# 848746-58-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-Diethylthymine, CAS# 21472-93-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-diethynyl-5-methoxybenzene, CAS# 1542157-70-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-difluoro-2-(2-phenylethynyl)benzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-difluoro-2,2-bis(fluoromethyl)propane, CAS# 338-23-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-difluoro-2,4-dimethoxy-5-nitrobenzene, CAS# 195136-63-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-difluoro-2-fluoromethylbenzene, CAS# 62037-91-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-difluoro-2-iodo-4-nitrobenzene, CAS# 1145881-54-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-difluoro-2-methylsulfonyloxy-propane, CAS# 660-29-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-difluoro-4-(methoxymethoxy)benzene, CAS# 210350-62-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-difluoro-5-(2-methoxyethoxy)benzene, CAS# 1355011-33-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-difluoro-5-(isothiocyanatomethyl)benzene, CAS# 107186-81-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-difluoro-5-(propan-2-yloxy)benzene, CAS# 1369849-69-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-difluoro-5-[(propan-2-yloxy)methyl]benzene, CAS# 1395283-31-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-difluoroadamantane, CAS# 54043-61-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-difluorobutane, CAS# 691-42-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-difluorofluoren-9-one, CAS# 2969-76-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-difluorotetramethyldisiloxane, CAS# 674-09-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-diheptyl-1,1,3,3-tetramethyl-disiloxane, CAS# 18544-27-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-diheptylurea, CAS# 1798-20-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1',3'-dihexadecyl L-glutamate, CAS# 59274-90-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1',3'-dihexadecyl L-glutamate p-toluenesulfonate, CAS# 95992-27-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dihexyl-1H-1,3-benzodiazol-3-ium bromide, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dihexyl-1H-1,3-benzodiazol-3-ium iodide, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dihexyl-2,3-dihydro-1H-1,3-benzodiazol-2-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dihexyltetramethyldisiloxane, CAS# 18546-93-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-dihydrazino-benzene, CAS# 15658-61-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-dihydro-(1-methylene)isobenzofuran, CAS# 84666-75-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dihydro-1-(phenylmethyl)-2H-benzimidazol-2-one, CAS# 28643-53-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-dihydro-1,1,3,3-tetramethyl-2,1,3-benzoxadisilole, CAS# 15074-38-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-dihydro-1,3,3-trimethyl-5-nitro-2H-indole-2-one, CAS# 120791-55-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-dihydro-1,3-diimino-6-nitroisoindoline, CAS# 31643-53-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-dihydro-1,3-dimethyl-2H-Imidazol-2-one, CAS# 39799-78-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-Dihydro-1,3-dioxo-N-(pyridin-2-ylmethyl)-2H-isoindol-2-acetamide, CAS# 349417-32-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-dihydro-1,3-diphenylcyclopenta[l]phenanthren-2-one, CAS# 58077-44-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-dihydro-1-hydroxy-4,7-dimethoxyisobenzofuran, CAS# 64019-79-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dihydro-1-methyl-4,5-diphenyl-2H-imidazol-2-one, CAS# 3653-23-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-dihydro-1-methylisobenzofuran, CAS# 38189-85-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dihydro-1-phenyl-2H-pyrrolo[2,3-b]pyridine-2-one, CAS# 127555-71-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dihydro-2-benzofuran-1-carbonitrile, CAS# 1246678-37-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dihydro-2-benzofuran-1-imine hydrochloride, CAS# 1195988-94-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dihydro-2-benzoselenophene-1,3-dione, CAS# 69246-88-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dihydro-2-benzothiophene, CAS# 2471-92-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dihydro-2-benzothiophene 2,2-dioxide, CAS# 2471-91-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dihydro-2H-isoindole-1,2-dicarboxylic acid, 2-tert-butyl ester, 1-methyl ester, CAS# 444607-92-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dihydro-2λ4-benzotellurole-2,2-diyl diiodide, CAS# 66149-48-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dihydro-3-(methylthio)-4-phenyl-2H-indol-2-one, CAS# 80726-52-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-dihydro-3-(phenylimino)-2H-indol-2-one, CAS# 101671-27-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-Dihydro-3,3-dimethyl-5-methoxy-2H-indol-2-one, CAS# 87234-57-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dihydro-3-[(4-methoxyphenyl)imino]-2H-indol-2-one, CAS# 29775-73-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-dihydro-3-[2-(4-methoxyphenyl)-2-oxoethylidene]indol-2(1H)-one, CAS# 66447-82-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dihydro-3-hydroxy-3-(2-phenyl-2-oxoethylidene)-indol-2(1H)-one, CAS# 88730-73-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dihydro-3-methyl-5-phenyl-2H-1,4-benzodiazepin-2-one, CAS# 34099-62-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-Dihydro-3-oxo-2-isobenzofuranylidenmalonsaeurediethylester, CAS# 897-38-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-Dihydro-3-oxobenzo[c]furan-1-ylacetic acid, CAS# 4743-58-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dihydro-4-(2-furanoyl)-2H-imidazol-2-one, CAS# 77671-36-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-Dihydro-4-(2-hydroxyphenyl)-2H-1,5-benzodiazepin-2-one, CAS# 61487-06-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Dihydro-4-(2-methylphenyl)-2H-imidazol-2-one, CAS# 936250-01-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dihydro-4-phenyl-2H-thieno<3,4-b><1,4>diazepin-2-one, CAS# 143810-66-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dihydro-5(1,1-dimethylethyl)-1,3-dioxo-2H-isoindole, CAS# 50727-07-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-dihydro-5-(pyridin-2-yl)-3(R,S)-[(benzyloxycarbonyl)-amino]-2H-1,4-benzodiazepin-2-one, CAS# 152665-84-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-dihydro-5,5,6-trihydroxy-6-methylpyrimidine-2,4-dione, CAS# 861542-63-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-dihydro-5,6-dichlorobenzo(c)thiophene, CAS# 87743-19-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dihydro-5,6-dimethoxy-3-oxo-1-isobenzofurancarboxylic acid, CAS# 91099-14-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dihydro-5,7-dimethoxy-3-oxo-1-isobenzofurancarboxylic acid, CAS# 91099-16-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dihydro-5-mercapto-1-methyl-2H-indol-2-one, CAS# 166883-22-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-dihydro-5-methoxy-1-methyl-2H-indol-2-one, CAS# 7699-22-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dihydro-5-nitro-2H-benzimidazole-2-spirocyclohexane, CAS# 27429-78-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-Dihydro-5-phenyl-3(R,S)-[(benzyloxycarbonyl)-amino]-2H-1,4-benzodiazepin-2-one, CAS# 108895-98-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-Dihydro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-imidazo[4,5-b]pyridin-2-one, CAS# 1209485-79-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dihydro-6-nitro-2-oxo-2H-benzimidazole-5-carboxylic acid methyl ester, CAS# 205259-23-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dihydro-benzo[c][1,2,3]thiadiazepine 2,2-dioxide, CAS# 31910-72-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dihydrohexaphenyltrisilane, CAS# 18816-18-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dihydroisobenzofuran-1-thione, CAS# 4741-68-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1',3'-dihydro-spiro[[1,3]dioxolane-2,2'-indene], CAS# 183-24-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1',3'-dihydrospiro[1,5-diazinane-3,2'-indene]-2,4,6-trione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1',3'-Dihydrospiro[cyclohexane-1,2'-[2H]imidazo[4,5-b]pyridine], CAS# 76902-24-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1',3'-dihydrospiro[cyclopentane-1,2'-indole]-3'-one, CAS# 4669-18-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-dihydrospiro[indene-2,2'-[1,3]oxathiolane]-1,3,5'-trione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dihydrothieno<3,4-b>quinoxaline, CAS# 3138-80-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-dihydroxy-1,3-dihydro-isoindole-2-carboxylic acid amide, CAS# 67209-36-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-dihydroxy-12H-5-oxatetracen-12-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-dihydroxy-12H-5-oxatetraphen-12-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-dihydroxy-12H-5-oxatetraphen-12-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-dihydroxy-2-(2-thienyl)-4,4,5,5-tetramethylimidazolidine, CAS# 202331-20-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-dihydroxy-2-(4-nitrophenyl)propane, CAS# 91748-03-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dihydroxy-2-chloro-4,6-dinitrobenzene, CAS# 116920-31-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dihydroxy-5,12-dihydro-5-azatetracen-12-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-Dihydroxy-5-methoxy-2-nitrobenzene, CAS# 16600-93-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dihydroxy-5-methoxy-9(10H)-acridinone, CAS# 63110-81-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-dihydroxy-5-methoxyxanthone, CAS# 6563-47-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-dihydroxy-5-methyl-9H-xanthen-9-one, CAS# 50493-39-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-dihydroxy-6H,7H,8H,9H,10H-cyclohexa[c]chromen-6-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-dihydroxy-6-methoxy-9H-xanthen-9-one, CAS# 52606-31-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dihydroxy-6-methyl-9H-xanthen-9-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-dihydroxy-7-methoxy-9,10-dihydroacridin-9-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dihydroxy-7-methoxyxanthone, CAS# 491-64-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-dihydroxy-9,10-dioxoanthracene-2-carbaldehyde, CAS# 3736-59-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-Dihydroxy-9-acridinecarboxylic acid, CAS# 28332-99-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-dihydroxy-9H-thioxanthen-9-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-Dihydroxy-9H-xanthen-9-one, CAS# 3875-68-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dihydroxyacetone bis-THP ether, CAS# 32888-40-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dihydroxyacridin-9(10H)-one, CAS# 20324-10-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-dihydroxyanthracene-9,10-dione, CAS# 518-83-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dihydroxy-anthraquinone-3-carboxylic acid methyl ester, CAS# 6155-37-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-dihydroxy-anthrone, CAS# 61281-25-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dihydroxybenzene-4-sulfonic acid, CAS# 6409-58-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dihydroxyl-2-(2'-hydroxyphen-1'-yl)-4,4,5,5-tetramethylimidazolidine, CAS# 626206-01-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-dihydroxyl-2-(3',4'-methylenedioxyphen-1'-yl)-4,4,5,5-tetramethylimidazolidine, CAS# 898562-14-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dihydroxyl-2-(4'-bromophen-1'-yl)-4,4,5,5-tetramethylimidazolidine, CAS# 623946-20-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-dihydroxyl-2-(4'-methoxyphen-1'-yl)-4,4,5,5-tetramethylimidazolidine, CAS# 41359-25-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dihydroxyl-2-(4'-nitrophen-1'-yl)-4,4,5,5-tetramethylimidazolidine, CAS# 38577-50-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dihydroxyl-2-phenyl-4,4,5,5-tetramethylimidazolidine, CAS# 18389-99-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dihydroxy-propan-2-one hydrate, CAS# 42429-85-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dihydroxypropan-2-yl tetradecanoate, CAS# 3443-83-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-Diimino-5,6-bis(octyloxy)isoindoline, CAS# 118156-18-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-Diiod-2-(iodmethyl)-2-methylpropan, CAS# 85963-60-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-diiodo-1-phenylpropane, CAS# 125763-65-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-diiodo-2,2-diethylpropane, CAS# 85807-77-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Diiodo-2,4,5,6-tetrafluorobenzene, CAS# 67815-57-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diiodo-2-methoxy-5-(4-nitro-phenoxy)-benzene, CAS# 857578-54-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diiodo-2-methoxy-5-methylbenzene, CAS# 51699-90-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-Diiodo-2-methoxy-5-nitrobenzene, CAS# 31106-75-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diiodo-2-methyl-5-nitrobenzene, CAS# 10388-20-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-diiodo-3-methylbutane, CAS# 66688-55-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-Diiodo-4,5,6-trimethoxy-2-methylbenzene, CAS# 115592-75-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Diiodopropan-2-ol, CAS# 534-08-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diisobutyryl-2,4,6-trihydroxybenzene, CAS# 3133-29-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-diisopentyltrisulfane, CAS# 955371-64-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-Diisopropyl-2-methoxybenzene, CAS# 2944-52-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-di-isopropyl-4-methylbenzene, CAS# 1460-98-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-di-isopropyl-4-nitrobenzene, CAS# 33696-11-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-Diisopropyl-imidazolinium chloride, CAS# 871126-32-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-diisopropylimidazolium bromide, CAS# 429641-40-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-diketo-1,3-diphenyl-2-(p-chlorophenylazo)propane, CAS# 84037-21-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-DIMERCAPTOPROPAN-2-OL, CAS# 584-04-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dimesityl-butan-1-one, CAS# 855220-79-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-dimethoxy-1-phenylpropane, CAS# 26278-67-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dimethoxy-2-(1-methylethenyl)benzene, CAS# 25108-61-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-dimethoxy-2-(3-methylbut-2-en-1-yl)benzene, CAS# 6468-84-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-dimethoxy-2-(phenylselanyl)benzene, CAS# 860556-94-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-dimethoxy-2-(toluene-4-sulfonyloxy)-propane, CAS# 85608-70-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-dimethoxy-2,4,5-trimethyl-benzene, CAS# 59968-27-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethoxy-2,4-dinitro-benzene, CAS# 18523-14-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-dimethoxy-2,5-dimethylbenzene, CAS# 21390-25-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dimethoxy-2-[(4-methoxyphenyl)sulfanyl]benzene, CAS# 1314254-20-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethoxy-2-ethylbenzene, CAS# 18610-90-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-dimethoxy-2-methyl-4-nitrobenzene, CAS# 109365-01-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dimethoxy-2-methylcyclohexa-1,4-diene, CAS# 84247-66-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dimethoxy-2-phenoxybenzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dimethoxy-3-methyl-butane, CAS# 39836-89-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dimethoxy-4-(4-methoxybenzyl)benzene, CAS# 53039-53-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-DIMETHOXY-4-TERT-BUTYLCALIX(4)ARENE, CAS# 122406-45-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-((4-methoxyphenyl)ethynyl)benzene, CAS# 400608-31-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-(2-methylprop-1-en-1-yl)benzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-(2-phenylethynyl)benzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-(4-nitrophenoxy)benzene, CAS# 307308-48-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-(phenylsulfanyl)benzene, CAS# 1228273-34-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-(prop-2-yn-1-yloxy)benzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-(p-tolyloxy)benzene, CAS# 61343-97-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-(trimethylsilyl)benzene, CAS# 17988-28-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-dimethoxy-5,6-dimethylbenzene, CAS# 59968-26-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-[2-(4-methoxyphenyl)ethyl]benzene, CAS# 83638-45-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-{2-[(trifluoromethyl)sulfanyl]ethynyl}benzene, CAS# 1388753-62-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-<14'-(3'',5''-dimethoxyphenyl)tetradecyl>benzene, CAS# 21390-07-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-ethylbenzene, CAS# 51768-56-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-methylcyclohexa-1,4-diene, CAS# 28495-21-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-methylthiobenzene, CAS# 2570-45-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-nitrobenzene, CAS# 16147-07-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-pentadecylbenzene, CAS# 23032-48-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-propylbenzene, CAS# 41395-10-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethoxy-5-tridecylbenzene, CAS# 1226942, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-dimethoxy-6-methyl-xanthen-9-one, CAS# 57615-53-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-dimethoxy-7-nitro-9H-xanthen-9-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-Dimethoxybutane, CAS# 10143-66-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-dimethoxy-cyclohexane, CAS# 36897-97-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-dimethoxyphthalan, CAS# 24388-70-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dimethoxypropanimine hydrochloride, CAS# 61737-87-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dimethyl (1R,2S,3S,4R)-2-(4-fluorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-dimethyl (1R,2S,3S,4R)-4-hydroxy-4-methyl-2-(3-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dimethyl (1R,3S,3aR,6aS)-4,6-dioxo-5-phenyl-octahydropyrrolo[3,4-c]pyrrole-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-dimethyl (1S,2R)-4-methyl-6-(morpholin-4-yl)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate, CAS# 142592-01-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(1,3-dihydro-2-benzofuran-1-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(1-cyanopropan-2-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(1H-indol-2-yl)-2-methylpropanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(2,2-dicyano-1-phenylethyl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(2,2-diethoxyethyl)propanedioate, CAS# 906652-81-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(2,4,6-trimethylphenyl)propanedioate, CAS# 107855-61-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(2-bromoprop-2-en-1-yl)propanedioate, CAS# 118453-36-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(2-butoxyethyl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(2-chloro-2-phenylethyl)propanedioate, CAS# 82437-42-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(2-chloro-4-nitrophenyl)propanedioate, CAS# 73088-10-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(2-cyanoethyl)propanedioate, CAS# 58763-40-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(2-nitrophenyl)-2-(prop-2-en-1-yl)propanedioate, CAS# 610315-36-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(2-oxocyclopentyl)propanedioate, CAS# 168566-72-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(2-oxoethyl)propanedioate, CAS# 51534-74-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(2-phenyl-1,2,3,4-tetrahydroisoquinolin-1-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(2-phenyl-1,2-dihydroisoquinolin-1-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3,4-dihydro-1H-2-benzopyran-1-yl)-2-methylpropanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3,4-dihydro-1H-2-benzopyran-1-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3,4-dimethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate, CAS# 64670-42-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3-bromopropyl)-2-methylpropanedioate, CAS# 1040724-80-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3-iodopropyl)-2-(prop-2-en-1-yl)propanedioate, CAS# 1185747-35-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3-methoxyphenoxy)propanedioate, CAS# 189574-46-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3-methylbut-2-en-1-yl)propanedioate, CAS# 43219-18-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3-nitropyridin-4-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3-oxo-1,3-dihydro-2-benzofuran-1-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3-oxo-2,3-dihydro-1H-indol-2-ylidene)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3-oxo-2,3-dihydro-1H-isoindol-1-yl)propanedioate, CAS# 1345532-47-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3-oxobutyl)-2-(prop-2-en-1-yl)propanedioate, CAS# 391612-68-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3-oxocyclopentyl)propanedioate, CAS# 111209-96-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(3-phenylpropylidene)propanedioate, CAS# 443305-36-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(4-bromobutylidene)propanedioate, CAS# 79917-27-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(4-bromophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate, CAS# 471260-00-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate, CAS# 358731-69-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(4-fluorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(4-methoxyphenyl)propanedioate, CAS# 71146-13-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(4-methyl-1-nitropentan-2-yl)propanedioate, CAS# 100401-40-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(4-methylbenzenesulfonamido)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(4-oxobutan-2-yl)propanedioate, CAS# 136917-89-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(4-oxopentyl)propanedioate, CAS# 1417578-81-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(5-bromofuran-2-carbonyloxy)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(5-fluoro-2-nitrophenyl)propanedioate, CAS# 147124-34-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(5-methoxy-2-nitrophenyl)propanedioate, CAS# 213627-32-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(5-methyl-2-nitrophenyl)propanedioate, CAS# 73087-98-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(pent-2-yn-1-yl)-2-(prop-2-en-1-yl)propanedioate, CAS# 191801-56-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(pent-4-en-1-yl)propanedioate, CAS# 93185-10-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(pent-4-yn-1-yl)propanedioate, CAS# 130905-55-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(phenylformamido)propanedioate, CAS# 53872-43-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(phenyl-λ3-iodanylidene)propanedioate, CAS# 145838-86-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(prop-2-en-1-yl)-2-(prop-2-yn-1-yl)propanedioate, CAS# 107428-06-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(pyrrolidin-1-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(thiophen-3-yl)propanedioate, CAS# 70158-52-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-(tributyl-λ?-phosphanylidene)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dimethyl 2,2-bis(2-cyanoethyl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-dimethyl 2,2-bis(chlorosulfanyl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2,2-bis(undec-10-en-1-yl)propanedioate, CAS# 680197-69-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2,2-bis[2-(4-methoxyphenyl)-2-oxoethyl]propanedioate, CAS# 485819-17-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1,3-dioxolan-2-yl)methyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1-methyl-1H-indol-3-yl)methylidene]propanedioate, CAS# 72010-37-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1-methyl-1H-pyrrol-2-yl)methylidene]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1R)-1-(2-nitrophenyl)-3-oxopropyl]propanedioate, CAS# 1231764-64-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1R)-1-(4-bromophenyl)-3-oxopropyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1R)-1-(4-chlorophenyl)-3-oxopropyl]propanedioate, CAS# 1198800-78-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1R)-1-(4-fluorophenyl)-3-oxopropyl]propanedioate, CAS# 1032429-79-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1R)-1-(4-methoxyphenyl)-3-oxopropyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1R)-1-(4-nitrophenyl)-3-oxopropyl]propanedioate, CAS# 1208865-04-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1R)-3-oxo-1-phenylpropyl]propanedioate, CAS# 908303-06-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1R)-3-oxocycloheptyl]propanedioate, CAS# 287493-82-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1R)-3-oxocyclopentyl]propanedioate, CAS# 287493-81-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1S)-1-(4-methylphenyl)-2-nitroethyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1S)-2-nitro-1-phenylethyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1S)-3-oxo-1-phenylbutyl]propanedioate, CAS# 359876-02-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1S)-3-oxocyclohexyl]propanedioate, CAS# 154194-50-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1S)-3-oxocyclopentyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(1S,2S)-1-hydroxy-1,2-dihydronaphthalen-2-yl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(2,4-dinitrophenyl)methylidene]propanedioate, CAS# 87840-69-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(2-bromophenyl)methyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(2-chlorophenyl)methylidene]propanedioate, CAS# 59832-47-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(2-fluorophenyl)methylidene]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(2-iodophenyl)methyl]-2-(prop-2-en-1-yl)propanedioate, CAS# 179735-69-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(2-iodophenyl)methyl]propanedioate, CAS# 122950-98-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(2-methoxyphenyl)methylidene]propanedioate, CAS# 22621-54-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(2R,3R,4R,5R,6R)-4,5-bis(acetyloxy)-6-[(acetyloxy)methyl]-2-methoxyoxan-3-yl]propanedioate, CAS# 195722-44-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(3,4-dimethoxyphenyl)methyl]-2-methylpropanedioate, CAS# 5846-22-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(3,4-dimethoxyphenyl)methyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(3-methoxyphenyl)methylidene]propanedioate, CAS# 22621-56-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(3-nitrophenyl)methylidene]propanedioate, CAS# 74313-93-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(3-oxo-2,3-dihydro-1-benzofuran-2-ylidene)methyl]propanedioate, CAS# 139221-06-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(3-phenylprop-2-ynoyl)oxy]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(3R)-3,7-dimethyloct-6-en-1-ylidene]propanedioate, CAS# 106431-76-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(3S)-1-methyl-2,5-dioxopyrrolidin-3-yl]propanedioate, CAS# 1344715-70-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(4-cyanophenyl)methylidene]propanedioate, CAS# 93098-69-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(anthracen-9-yl)methyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(furan-2-yl)methylidene]propanedioate, CAS# 74299-84-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(furan-3-yl)methylidene]propanedioate, CAS# 909904-14-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(naphthalen-1-yl)methylidene]propanedioate, CAS# 115324-50-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(naphthalen-2-yl)methyl]propanedioate, CAS# 142077-84-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(S)-phenyl[(1,3,4-thiadiazol-2-yl)amino]methyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[(thiophen-3-yl)methylidene]propanedioate, CAS# 1300690-47-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[1-(1H-indol-3-yl)-3-phenylpropyl]propanedioate, CAS# 1051398-01-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[1-(4-methoxyphenyl)-2-nitroethyl]propanedioate, CAS# 100719-44-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[2-(3,4-difluorophenyl)hydrazin-1-ylidene]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[2-(acetyloxy)propyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[2-amino-3-(methoxycarbonyl)-4H-chromen-4-yl]propanedioate, CAS# 1111277-58-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[3-(trimethylsilyl)prop-2-yn-1-yl]propanedioate, CAS# 317842-66-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[4-(1,3-dimethoxy-1,3-dioxopropan-2-ylidene)cyclohexylidene]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[4-(benzyloxy)phenoxy]propanedioate, CAS# 1204483-46-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[4-(oxan-2-yloxy)butyl]propanedioate, CAS# 135460-53-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-[cyclohexyl(1H-indol-3-yl)methyl]propanedioate, CAS# 1051398-00-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-{[(2S)-1-[(benzyloxy)carbonyl]pyrrolidin-2-yl]formamido}propanedioate, CAS# 75526-74-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-{[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene}propanedioate, CAS# 70107-43-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-{[2-(benzyloxy)phenyl]methylidene}propanedioate, CAS# 1173178-79-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-{[2-(prop-2-en-1-yloxy)phenyl]methylidene}propanedioate, CAS# 99558-32-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-{[3-(methoxycarbonyl)pyridin-2-yl]methyl}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-{[4-(benzyloxy)phenyl]methylidene}propanedioate, CAS# 302589-19-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-{[4-(dimethylamino)phenyl]methylidene}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-{[4-(methoxycarbonyl)phenyl]methylidene}propanedioate, CAS# 104633-19-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-{[4-(propan-2-yl)phenyl]methylidene}propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-{1,4-dioxaspiro[4.5]decan-7-yl}propanedioate, CAS# 861924-46-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl 2-{1-[(tert-butoxy)carbonyl]piperidin-4-ylidene}propanedioate, CAS# 554451-50-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-dimethyl 2-{3-[(tert-butyldimethylsilyl)oxy]propyl}propanedioate, CAS# 206270-84-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-dimethyl 2-{4-[(tert-butoxy)carbonyl]piperazin-1-yl}propanedioate, CAS# 554450-77-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-benzyl-2-(2-nitrophenyl)propanedioate, CAS# 610315-34-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-benzyl-2-(prop-2-en-1-yl)propanedioate, CAS# 145429-73-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-benzyl-2-[(dimethylamino)methyl]propanedioate, CAS# 51122-90-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-dimethyl 2-benzyl-2-chloropropanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-butyl-2-hydroxypropanedioate, CAS# 1203647-56-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-dimethyl 2-chloro-2-(3,4-dihydro-1H-2-benzopyran-1-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dimethyl 2-cyclohexylidenepropanedioate, CAS# 94286-34-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-dimethyl 2-fluoro-2-(hydroxymethyl)propanedioate, CAS# 107843-23-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-methyl-2-(3-oxobutyl)propanedioate, CAS# 95929-65-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-methyl-2-(prop-2-en-1-yl)propanedioate, CAS# 123507-71-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl 2-methyl-2-[(1R)-2-nitro-1-phenylethyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-methylnaphthalene-1,3-dicarboxylate, CAS# 1280677-88-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-dimethyl 2-nonylpropanedioate, CAS# 128600-99-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-dimethyl 2-octylpropanedioate, CAS# 54494-86-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dimethyl 4-(benzylamino)-6-hydroxy-6-methyl-2-(4-nitrophenyl)cyclohex-3-ene-1,3-dicarboxylate, CAS# 1176846-04-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-dimethyl 4-(benzyloxy)benzene-1,3-dicarboxylate, CAS# 63295-94-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-dimethyl 4,5-bis(furan-2-yl)-5-hydroxy-2-oxocyclopent-3-ene-1,3-dicarboxylate, CAS# 16344-55-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dimethyl 4,6-diethyl-2-hydroxybenzene-1,3-dicarboxylate, CAS# 202858-61-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethyl 4,6-dioxo-5-phenyl-octahydropyrrolo[3,4-c]pyrrole-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dimethyl 4-hydroxy-1-phenylcyclohex-3-ene-1,3-dicarboxylate, CAS# 951314-25-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl 4-hydroxy-2-(3-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate, CAS# 142592-10-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dimethyl 4-hydroxy-2-(4-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate, CAS# 142592-11-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dimethyl 4-hydroxy-4-methyl-2-(3-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate, CAS# 142592-09-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-dimethyl 4-hydroxy-4-methyl-2-(4-methylphenyl)-6-oxocyclohexane-1,3-dicarboxylate, CAS# 142592-13-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethyl 4-hydroxy-4-methyl-2-(4-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate, CAS# 142695-86-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethyl 4-hydroxy-5-[4-methoxy-4-oxo-3-(propan-2-ylidene)but-1-en-2-yl]-2,6-dimethylbenzene-1,3-dicarboxylate, CAS# 1224737-56-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl 4-methyl-2-phenyl-6-(piperidin-1-yl)cyclohexa-3,5-diene-1,3-dicarboxylate, CAS# 142592-22-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-dimethyl 5-({6-[3,5-bis(methoxycarbonyl)phenoxy]hexyl}oxy)benzene-1,3-dicarboxylate, CAS# 22937-68-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(2,5-dimethyl-1H-pyrrol-1-yl)benzene-1,3-dicarboxylate, CAS# 307341-12-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(2-bromoethoxy)benzene-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(2-chloroacetamido)benzene-1,3-dicarboxylate, CAS# 198488-19-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(2-hydroxyethoxy)benzene-1,3-dicarboxylate, CAS# 153117-82-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(2-methylpropoxy)benzene-1,3-dicarboxylate, CAS# 1185753-91-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(3,4-dicyanophenoxy)benzene-1,3-dicarboxylate, CAS# 243965-29-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(4-bromobutoxy)benzene-1,3-dicarboxylate, CAS# 1312290-27-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(diethoxyphosphoryl)benzene-1,3-dicarboxylate, CAS# 210969-59-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(hex-5-en-1-yloxy)benzene-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(hexadecyloxy)benzene-1,3-dicarboxylate, CAS# 258883-88-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(hexyloxy)benzene-1,3-dicarboxylate, CAS# 482620-72-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(methanesulfonyloxy)benzene-1,3-dicarboxylate, CAS# 887969-80-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(methoxymethoxy)benzene-1,3-dicarboxylate, CAS# 848498-23-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(octadecyloxy)benzene-1,3-dicarboxylate, CAS# 96274-06-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(pyrrolidin-1-yl)benzene-1,3-dicarboxylate, CAS# 1041204-71-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(tributylstannyl)benzene-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dimethyl 5-(trifluoromethyl)benzene-1,3-dicarboxylate, CAS# 868286-79-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethyl 5,5-dicyano-2-hydroxy-4,6-diphenylcyclohex-1-ene-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dimethyl 5-[(tert-butyldimethylsilyl)oxy]benzene-1,3-dicarboxylate, CAS# 182629-24-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl 5-[2-(4-{2-[3,5-bis(methoxycarbonyl)phenyl]ethynyl}phenyl)ethynyl]benzene-1,3-dicarboxylate, CAS# 350670-89-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl 5-{2-[3,5-bis(methoxycarbonyl)phenyl]ethenyl}benzene-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl 5-{4-[3,5-bis(methoxycarbonyl)phenoxy]butoxy}benzene-1,3-dicarboxylate, CAS# 503153-25-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dimethyl 5-acetyl-4-methylbenzene-1,3-dicarboxylate, CAS# 114106-79-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-dimethyl 5-ethoxybenzene-1,3-dicarboxylate, CAS# 474407-10-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dimethyl propanedicarboximidate hydrochloride, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-dimethyl-1-(2-methyl-2-phenylpropyl)-3-phenyl-2H-indene, CAS# 41906-71-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dimethyl-1-(4-nitrophenyl)-3-phenylurea, CAS# 118619-52-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl-1,1',2,2',3,4,6,7,8,9-decahydrospiro[chromeno[2,3-d]pyrimidine-5,3'-indole]-2,2',4,6-tetrone, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dimethyl-1,2,3,4-tetrahydroquinazoline-2,4-dione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Dimethyl-1,2,3,5-tetrahydro-4,1-benzoxazepin-5-on, CAS# 85805-17-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-Dimethyl-1,2,4-triazoline-5-thione, CAS# 41125-66-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dimethyl-1,3,2-diazaborolidine, CAS# 38151-26-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dimethyl-1,3,6,7(9)-tetrahydro-purin-2-one, CAS# 6501-67-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dimethyl-1,3-bis(3-naphthalenyl-1-oxy)-3-(thiophenyl)propyl urea, CAS# 1350249-48-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-dimethyl-1,3-bis(4-nitrophenyl)urea, CAS# 34594-47-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dimethyl-1,3-diazepan-2-one, CAS# 16597-38-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl-1,3-diazinane-2,4,5,6-tetrone, CAS# 2757-85-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl-1,3-diazinane-2-thione, CAS# 16597-35-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl-1H,2H,3H,4H,5H,6H,7H-pyrano[2,3-d]pyrimidine-2,4-dione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dimethyl-1H-imidazol-3-ium, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl-1H-imidazol-3-ium acetate, CAS# 78643-53-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-dimethyl-1H-imidazol-3-ium; hexafluoro-λ?-phosphane, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-dimethyl-1H-imidazol-3-ium; tetrafluoro-λ?-borane, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethyl-1H-imidazol-3-ium-5-carboxylate, CAS# 51800-34-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-Dimethyl-1H-imidazolium-(p-toluolsulfonat), CAS# 54722-21-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dimethyl-1H-indazole, CAS# 34879-84-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethyl-1H-indole-2-carbaldehyde, CAS# 1971-44-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-Dimethyl-1H-pyrazol-4-sulfonamide, CAS# 88398-53-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-Dimethyl-1H-pyrazolo[3,4-b]pyridine, CAS# 116834-97-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-dimethyl-1-nitroso-thiourea, CAS# 79645-01-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3'-dimethyl-1'-phenyl-1,1',2,6',7',8'-hexahydrospiro[indole-3,4'-pyrazolo[3,4-e][1,4]thiazepine]-2,7'-dione, CAS# 1318252-75-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-dimethyl-1-phenyl-thiourea, CAS# 2740-95-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-dimethyl-1-trimethylsilyloxy-1,3-butadiene, CAS# 6651-47-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethyl-2-(1-naphthyl)imidazolidine, CAS# 88802-84-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-dimethyl-2-(2-methylphenoxy)benzene, CAS# 38630-00-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethyl-2-(2-naphthyl)imidazolidine, CAS# 88802-90-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl-2-(3'-methyl-2'-thienyl)imidazolidine, CAS# 391936-73-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dimethyl-2-(4-methylphenoxy)benzene, CAS# 118095-15-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl-2-(oct-1-yn-1-yl)benzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dimethyl-2-(phenylethynyl)benzene, CAS# 180783-48-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-Dimethyl-2-(phenylmethoxy)benzene, CAS# 19578-74-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dimethyl-2-(phenylsulfanyl)benzene, CAS# 54088-93-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dimethyl-2,3-dihydro-1H-benzo[f][1,3]benzoxazine, CAS# 6296-72-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dimethyl-2,3-dihydro-1H-indol-2-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-Dimethyl-2,4,6-trioxo-hexahydro-pyrimidine-5-carbaldehyde, CAS# 42604-63-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethyl-2,4-dinitrobenzene, CAS# 603-02-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dimethyl-2,4-dioxo--1,2,3,4-tetrahydro-10H-pyrimido<5,4-b><1,4>benzothiazine, CAS# 25861-95-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-pyrimidin-6-carbonsaeuremethylester, CAS# 4116-39-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-pyrimidine-5-carbonyl chloride, CAS# 38009-10-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydroquinazoline-6-sulfonic acid, CAS# 1134967-52-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dimethyl-2,5-bis-prop-2-ynyloxy-benzene, CAS# 750624-36-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl-2,5-cyclohexadiene-1-carboxylic acid, CAS# 31689-43-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-dimethyl-2,5-dioxo-imidazolidine-4-carboxylic acid methylamide, CAS# 857812-45-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-Dimethyl-2,6-dioxo-1,2,3,6-tetrahydropurin-7-yl-acetaldehyd, CAS# 5614-53-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl-2,6-diphenylpiperidin-4-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dimethyl-2-[(2-methylphenyl)sulfanyl]benzene, CAS# 38630-01-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dimethyl-2-[2-(4-methylphenyl)ethynyl]benzene, CAS# 1219617-41-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dimethyl-2-acetylindole, CAS# 16244-26-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-dimethyl-2-cyclohexen-1-ol, CAS# 29481-98-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dimethyl-2-diethylamino-1,3,2-diazaboracyclohexane, CAS# 25031-73-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-Dimethyl-2-ethylindole, CAS# 3749-24-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl-2-imidazolone-4-carboxylic acid, CAS# 17245-63-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-dimethyl-2-imino-4-imidazolidinone, CAS# 34293-22-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-Dimethyl-2-methylmercapto-1,4,5,6-tetrahydro-pyrimidinium iodid, CAS# 65345-88-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-Dimethyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carbaldehyde, CAS# 55241-49-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-dimethyl-2-phenoxybenzene, CAS# 31582-90-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-dimethyl-2-phenyl-1,2,3,4-tetrahydroquinazoline, CAS# 1596243-51-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dimethyl-2-phenyl-1,3,2-diazaborolidine, CAS# 5709-94-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-dimethyl-2-phenyl-1,3,2-diazaphospholidine-2-oxide, CAS# 1580167, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-Dimethyl-2-phenyl-1H-indole, CAS# 3558-28-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dimethyl-2-phenylbenzene, CAS# 3976-34-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-dimethyl-2-phenylbenzimidazolium iodide, CAS# 640394, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dimethyl-2-phenylimidazolidine, CAS# 23229-37-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-DiMethyl-2-phenylnaphthalene, CAS# 119264-82-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-dimethyl-2-propan-2-yloxybenzene, CAS# 54350-31-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-dimethyl-2-propylbenzimidazolium iodide, CAS# 76116-90-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-dimethyl-2-sulfanylideneimidazolidine-4,5-dione, CAS# 21035-65-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-dimethyl-2-sulfanylidenequinazolin-4-one, CAS# 17730-53-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-dimethyl-2-thiobarbituric acid, CAS# 3158-63-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl-3,4-dihydroquinoxalin-2(1H)-one, CAS# 67074-64-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethyl-3-cyclohexenecarboxylic acid, CAS# 28886-57-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-dimethyl-4-(p-tolyloxy)benzene, CAS# 612069-15-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dimethyl-4,5-dihydroxy-4,5-diphenylimidazolidin-2-one, CAS# 66242-64-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dimethyl-4,6-bis(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine, CAS# 86789-18-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dimethyl-4-aza-phenanthrene, CAS# 605-67-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethyl-4-nitro-1H-pyrazole-5-carbonyl chloride, CAS# 37141-71-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dimethyl-4-nitro-1H-pyrazole-5-carboxamide, CAS# 59023-32-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-dimethyl-4-nitroimidazol-1-ium iodide, CAS# 3034-43-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl-4-nitronaphthalene, CAS# 24055-39-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-dimethyl-4-nitrosobenzene, CAS# 38974-06-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-dimethyl-4-oxo-1,4-dihydro-quinazolinium, CAS# 2453-94-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-dimethyl-4-sulfanylidenepyrimidin-2-one, CAS# 49785-67-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dimethyl-4-triphenylphosphoranylideneamino-pyrimdine-2,4-dione, CAS# 99747-54-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(2-iodophenyl)-hexahydro-2-oxo-1,3,5-triazine, CAS# 130749-97-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(2-methylprop-2-enoxy)benzene, CAS# 3698-47-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(2-methylpropylidene)-1,3-diazinane-2,4,6-trione, CAS# 83814-08-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(2-nitrophenyl)-2,3,4,5-tetrahydro-1H-12-oxa-1,3-diazatetraphene-2,4-dione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(2-oxo-2-phenylethylidene)-pyrimidine-2,4,6(1H,3H,5H)-trione, CAS# 1063626-88-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(2-phenylethynyl)benzene, CAS# 201278-01-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione, CAS# 66941-04-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(3-nitrophenyl)-2,3,4,5-tetrahydro-1H-12-oxa-1,3-diazatetraphene-2,4-dione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(3-oxo-1,3-diphenyl-propyl)-pyrimidine-2,4,6-trione, CAS# 54890-67-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(3-oxocyclohexyl)-1,3-diazinane-2,4,6-trione, CAS# 1590422-16-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(3-phenylpropyl)pyrimidine-2,4,6-trione, CAS# 82657-34-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, CAS# 1220696-53-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-Dimethyl-5-(4'-methoxycinnamoyl)-6-aminouracil, CAS# 93599-95-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(4-methylbenzenesulfonyl)benzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(4-methyl-benzylidene)-pyrimidine-2,4,6-trione, CAS# 57270-84-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(4-methylphenoxy)benzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(4-methylphenyl)-2,3,4,5-tetrahydro-1H-12-oxa-1,3-diazatetraphene-2,4-dione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(4-nitrobenzylidene)-2,4,6(1H,3H,5H)pyrimidinetrione, CAS# 57270-89-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(4-nitrophenoxy)benzene, CAS# 1630-17-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(4-nitrophenyl)-1H,2H,3H,4H,5H,6H,7H,8H,9H-chromeno[2,3-d]pyrimidine-2,4,6-trione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(4-nitrophenyl)-2,3,4,5-tetrahydro-1H-12-oxa-1,3-diazatetraphene-2,4-dione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(phenylmethylene)-2,4,6(1H,3H,5H)-pyrimidinetrione, CAS# 54459-73-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(phenylselanyl)benzene, CAS# 1122617-67-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(phenylsulfanyl)benzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(phenylthio)pyrimidine-2,4(1H,3H)-dione, CAS# 55832-80-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(prop-2-yne-1-sulfinyl)benzene, CAS# 451524-36-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(propan-2-yl)-1,3,5-triazinan-2-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-dimethyl-5-(trifluoromethyl)pyrazole, CAS# 82755-49-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dimethyl-5,5-bis(prop-2-en-1-yl)-1,3-diazinane-2,4,6-trione, CAS# 722-97-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-dimethyl-5,5-difluoro-5,6-dihydro-6-acetoxyuracil, CAS# 115923-83-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dimethyl-5,5-dinitropyrimidine-2,4,6-trione, CAS# 269077-46-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethyl-5,5-diphenylhydantoin, CAS# 1664051, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl-5,6-dihydropyrimidine-2,4-dione, CAS# 4874-13-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-dimethyl-5,6-dinitro-1,3-dihydro-benzoimidazol-2-one, CAS# 90324-08-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dimethyl-5,6-diphenylpyrimidin-2,4-dion, CAS# 55625-99-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl-5,6-oxyranyl-5,6-dihydro uracil, CAS# 100011-19-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dimethyl-5,7-diphenylpyrido[2,3-d]pyrimidine-2,4-dione, CAS# 59796-99-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-Dimethyl-5-[(1-methyl-2-pyrrolidinylidene)ethylidene]-2-thioxoimidazolidine-4-one, CAS# 2445-60-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dimethyl-5-[(2E)-3-phenylprop-2-en-1-ylidene]-1,3-diazinane-2,4,6-trione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl-5-[(2-methylprop-1-en-1-yl)oxy]benzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dimethyl-5-[(2-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione, CAS# 39259-99-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-dimethyl-5-[(3-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione, CAS# 57270-90-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl-5-[(E)-2-phenylethenyl]benzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dimethyl-5-[(thiophen-2-yl)methylidene]-1,3-diazinane-2,4,6-trione, CAS# 198276-19-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dimethyl-5-[(trifluoromethyl)sulfanyl]benzene, CAS# 129724-23-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl-5-[2,3,4,5-tetrakis(3,5-dimethylphenyl)cyclopenta-2,4-dien-1-yl]benzene, CAS# 308284-69-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dimethyl-5-[4-(trifluoromethyl)phenoxy]benzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-dimethyl-5-{[2-(prop-2-en-1-yloxy)phenyl]methylidene}-1,3-diazinane-2,4,6-trione, CAS# 159470-37-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethyl-5-chloro-pyrazole-4-carbonyl chloride, CAS# 27006-83-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dimethyl-5-cyclohexylbenzene, CAS# 32406-09-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-dimethyl-5-morpholin-4-yl-1H-pyrazole-4-carbaldehyde, CAS# 26990-69-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethyl-5'-nitro-1,1',2,2',3,4,6,7,8,9-decahydrospiro[chromeno[2,3-d]pyrimidine-5,3'-indole]-2,2',4,6-tetrone, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1',3'-dimethyl-5-nitro-1,1',2,2',3',4'-hexahydro-12'-oxa-1',3'-diazaspiro[indole-3,5'-tetraphene]-2,2',4'-trione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-dimethyl-5-nitro-1,2-dihydropyridin-2-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-dimethyl-5-nitro-benzimidazolium, CAS# 52142-81-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethyl-5-nitroindazole, CAS# 5757-84-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dimethyl-5-nitromethyl-benzene, CAS# 62030-35-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dimethyl-5-nitropyrimidine-2,4-dione, CAS# 41613-26-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dimethyl-5-oxo-N-phenyl-4,5-dihydropyrazole-4-carboxamide, CAS# 64429-35-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dimethyl-5-phenethylbenzene, CAS# 86846-72-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethyl-5-phenyl-1,2,3,4-tetrahydropyrido[2,3-d]pyrimidine-2,4-dione, CAS# 59797-01-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl-5-phenyl-2,3,4,5-tetrahydro-1H-12-oxa-1,3-diazatetraphene-2,4-dione, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dimethyl-5-phenylaminomethylenepyrimidine-2,4,6-(1H,3H,5H)-trione, CAS# 23069-97-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-Dimethyl-5-phenylbarbituric acid, CAS# 7391-66-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dimethyl-5-phenylimidazolidine-2,4-dione, CAS# 16935-41-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-dimethyl-5-prop-2-enoxybenzene, CAS# 20531-93-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dimethyl-5-propyl-benzene, CAS# 3982-64-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-dimethyl-5-trifluoromethyl-1H-pyrimidine-2,4-dione, CAS# 85199-75-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dimethyl-5-trifluoromethyl-5,6-dihydrouracil, CAS# 85199-77-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethyl-5-trifluoromethylbenzene, CAS# 86845-29-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dimethyl-5-trimethylsilyluracil, CAS# 62803-31-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dimethyl-6-(2,5-dimethylphenyl)uracil, CAS# 110225-41-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dimethyl-6-(4-methoxyphenyl)-1,2,3,4-tetrahydropyrimidine-2,4-dione, CAS# 94937-24-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-dimethyl-6-(methylamino)pyrimidine-2,4-dione, CAS# 5770-42-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dimethyl-6,7-dimethoxy-3,4-dihydroisoquinoline, CAS# 87095-05-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dimethyl-6-[(4-methylphenyl)amino]pyrimidine-2,4-dione, CAS# 7256-86-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dimethyl-6-ethyluracil, CAS# 49786-02-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethyl-6-formyluracil, CAS# 83174-90-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-DIMETHYL-6-HYDROXYLAMINOURACIL, CAS# 60331-17-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-Dimethyl-6-hydroxymethyl-5,6-dihydrouracil, CAS# 61755-90-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dimethyl-6-n-butyluracil, CAS# 109856-25-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dimethyl-6-n-propyluracil, CAS# 28267-45-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dimethyl-6-phenyl-1H-pyrimidine-2,4-dithione, CAS# 33227-70-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dimethyl-6-phenylpteridine-2,4-dione, CAS# 25477-76-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl-6-phenylpyrimidine-2,4(1H,3H)-dione, CAS# 42542-99-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dimethyl-6-propylamino-1H-pyrimidine-2,4-dione, CAS# 5770-45-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dimethyl-6-thioxo-1,3,6,7(9)-tetrahydro-purin-2-one, CAS# 2398-70-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-dimethyl-7-(2-methylsulfanyl-ethyl)-3,7-dihydro-purine-2,6-dione, CAS# 670715, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-dimethyl-7-(2-morpholin-4-yl-2-oxoethyl)purine-2,6-dione, CAS# 100706-81-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dimethyl-7-(morpholin-4-ylmethyl)purine-2,6-dione, CAS# 5089-89-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dimethyl-7-(trimethylsilyl)xanthine, CAS# 62374-32-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dimethyl-7-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]purine-2,6-dione, CAS# 88338-63-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-dione, CAS# 39112-72-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dimethyl-7-methoxypyrimido<4,5-b>quinoline-2,4(1H,3H)-dione, CAS# 64664-00-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-dimethyl-7-phenyl-1H-purine-2,6(3H,7H)-dione, CAS# 960-61-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-dimethyl-7-phenyllumazine, CAS# 964-45-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-dimethyl-7-prop-2-enylpurine-2,6-dione, CAS# 61444-26-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dimethyl-7-prop-2-ynylpurine-2,6-dione, CAS# 14114-45-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dimethyl-8-(2-methylpropyl)-7H-purine-2,6-dione, CAS# 5770-30-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethyl-8-(trifluoromethyl)-7H-purine-2,6-dione, CAS# 57281-12-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dimethyl-8-[4-[[m-nitrophenoxy]sulfonyl]phenyl]xanthine, CAS# 666715-88-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dimethyl-8H-pyrido[2,3-d]pyrimidine-2,4,7-trione, CAS# 57821-20-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dimethyl-8-pentan-3-yl-7H-purine-2,6-dione, CAS# 5429-31-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-dimethyl-8-phenoxymethyl-3,7-dihydro-purine-2,6-dione, CAS# 5426-70-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimethyl-8-piperazin-1-yl-3,7(9)-dihydro-purine-2,6-dione, CAS# 54119-57-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-dimethyl-8-propan-2-yl-7H-purine-2,6-dione, CAS# 2850-40-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-Dimethyl-9H-carbazole, CAS# 18992-68-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethyl-9H-fluoren-9-one, CAS# 24061-10-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dimethyl-9H-xanthene, CAS# 38731-83-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dimethyl-azepan-2-one, CAS# 55917-05-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dimethylbenzo[f][2]benzofuran-4,9-dione, CAS# 1256316, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dimethylbenzotriazol-3-ium iodide, CAS# 22713-35-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dimethylcyclohexa-1,3-diene, CAS# 976416, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-DIMETHYLCYCLOHEXENE, CAS# 2808-76-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethylcyclopent-2-en-1-ol, CAS# 23685-97-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dimethylcyclopropene, CAS# 82190-83-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dimethyl-hexahydro-{1,3,5}triazine-2,4,6-trione, CAS# 6726-48-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dimethyl-ψ-uridine, CAS# 64272-68-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-dimethylidenecyclobutane, CAS# 2045-78-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-Dimethylimidazolidine-2-thione, CAS# 13461-16-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-Dimethylimidazolium methanesulfonate, CAS# 521304-36-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dimethylimidazolium nitrate, CAS# 941584-21-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-dimethyl-indole-2-carboxylic acid amide, CAS# 857777-04-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-dimethylorotaldehyde diethyl acetal, CAS# 83174-91-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dimethylparabanic acid, CAS# 5176-82-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dimethylpiperidine-2-one, CAS# 1690-76-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dimethyl-purino[8,7-b]quinazolin-2,4,6(1H,3H,12H)-trione; 1,3-Dimethyl-purino[8,7-b]quinazolin-2,4,6(1H,3H,11H)-trione, CAS# 169692-29-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-dimethylpyrazolo[3,4-d]pyrimidin-4-amine, CAS# 5346-58-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dimethylpyrimido<1,2-a>benzimidazole, CAS# 25513-98-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-dimethylpyrimido<4,5-b>quinoline-2,4(1H,3H)-dione, CAS# 39260-04-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-dimethylpyrimido<4,5-d>pyrimidine-2,4-(1H,3H)dione, CAS# 14684-52-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dimethylpyrrolo[1,2-a]quinoline-5-carbonitrile, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-dimethylquinolin-2(1H)-one, CAS# 55539-83-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-dimethyluracil-5-carbaldehyde phenylhydrazone, CAS# 80981-29-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-dimethyluracil-6-carboxamide, CAS# 2019-20-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dimethyluracil-6-ylmethyl chloride, CAS# 162284-62-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dimethylxanth-9-one, CAS# 859785-44-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dimorpholin-4-ylpropane-1,3-dithione, CAS# 27759-71-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-Dimorpholinopropan-2-ol, CAS# 7250-87-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-dinaphthalen-2-ylurea, CAS# 33102-63-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-dinitro-1,2,3-triphenyl-propane, CAS# 859953-67-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-dinitro-1,3-diazinan-5-yl nitrate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dinitro-10H-phenoxazine, CAS# 26103-32-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dinitro-2,5-bis(trifluoromethyl)benzene, CAS# 116470-64-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dinitro-5-(trifluoromethyl)-2-[(trifluoromethyl)sulfanyl]benzene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-dinitro-5-trichloromethylbenzene, CAS# 90325-19-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dinitroadamantane, CAS# 55100-59-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-dinitrobenzene radical anion, CAS# 34509-56-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dinitroimidazolidin-2-one, CAS# 2536-18-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dinitrooxybutan-2-yl nitrate, CAS# 84002-64-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dinitrosoimidazolidin-2-one, CAS# 54850-18-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-di-O-(para-toluenesulfonyl)butane, CAS# 49662-28-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-di-O-butyryl-2-O-benzylglycerol, CAS# 105434-68-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-di-O-chloroacetyl-2-O-benzylglycerol, CAS# 105409-41-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dioctadecylurea, CAS# 4051-66-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-dioctyl 2,2-bis(hydroxymethyl)propanedioate, CAS# 183206-14-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-Dioctyl-2-thiourea, CAS# 34853-57-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dioctylurea, CAS# 15922, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-di-O-palmitoyl-2-O-benzyl-rac-glycerol, CAS# 76163-48-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-di-O-propionyl-2-O-benzylglycerol, CAS# 105409-40-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-di-o-tolyltriazene, CAS# 614-63-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-Dioxa-2-silacyclopentane,2-(4-bromophenyl)-2,4,4,5,5-pentamethyl-, CAS# 40528-98-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-Dioxa-2-silacyclopentane,2-chloro-4,4,5,5-tetramethyl-2-(2-propenyl)-, CAS# 447440-42-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-Dioxa-5-aza-2,4,6-trisilacyclohexane, 2,2,4,4,6,6-hexamethyl-, CAS# 7418-21-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dioxa-5-ethyl-2,2-dimethyl-5-cyclohexylmethanol, CAS# 20761-68-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-Dioxa-6-aza-2-silacyclooctane, 2-ethenyl-2-methyl-, CAS# 100343-77-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-dioxa-cycloheptadecan-2-one, CAS# 90383-24-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dioxacyclotridecan-2-one, CAS# 67990-00-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-Dioxan-2-amine, N,N-diethyl-4-methyl-2-(1,2,2,2-tetrafluoroethyl)-, CAS# 89752-26-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dioxan-2-ylmethyl bromide, CAS# 5695-63-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-Dioxan-5-amine,2-phenyl-, cis-, CAS# 13042-46-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-dioxan-5-one, CAS# 87683-81-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dioxan-5-yl 4-methylbenzenesulfonate, CAS# 32061-16-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dioxan-5-yl benzoate, CAS# 49784-60-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dioxan-5-yl pyridin-3-yl ketone, CAS# 85727-04-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-Dioxane 2-propane nitrile, CAS# 80692-35-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-Dioxane, 2-(2-cyclohexylethyl)-, CAS# 111865-39-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-Dioxane, 2-(4-bromophenyl)-2,5,5-trimethyl-, CAS# 105114-65-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-Dioxane, 2-(4-bromophenyl)-5,5-dimethyl-, CAS# 105114-53-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-Dioxane, 2-(4-chlorophenyl)-2-methyl-, CAS# 10359-12-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-Dioxane, 2,2,5,5-tetramethyl-, CAS# 767-55-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-Dioxane, 2,2-diphenyl-, CAS# 786-03-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-Dioxane, 2,5,5-trimethyl-, CAS# 766-33-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-Dioxane, 2-[2-(1,3-dithian-2-yl)ethyl]-, CAS# 76159-93-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-Dioxane, 2-ethoxy-, CAS# 76508-46-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-Dioxane, 2-phenyl-, CAS# 772-01-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-Dioxane, 4,4,5-trimethyl-, CAS# 1122-03-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-Dioxane, 4-ethenyl-, CAS# 1072-96-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-Dioxane, 5-(bromomethyl)-2,2-dimethyl-, CAS# 111934-94-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-Dioxane,2-(1-ethylpentyl)-5-methyl-5-nitro-, CAS# 17144-55-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-Dioxane,2-(2-chloroethyl)-, CAS# 13297-07-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-Dioxane,2-(2-furanyl)-4,4,6-trimethyl-, CAS# 1204-54-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-Dioxane,2-(2-methoxyphenyl)-, CAS# 13309-95-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-Dioxane,2-(3-bromopropyl)-5,5-dimethyl-, CAS# 108808-09-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-Dioxane,2,2,4,6-tetramethyl-, (4R,6R)-rel-, CAS# 20268-00-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-Dioxane,2,2-dipropyl-, CAS# 27874-25-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-Dioxane,2,4,4,6,6-pentamethyl-, CAS# 5663-28-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-Dioxane,2-cyclohexyl-, CAS# 76241-77-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-Dioxane,2-hexyl-5,5-dimethyl-, CAS# 13273-90-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-Dioxane,2-methoxy-2-phenyl-, CAS# 76109-82-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-Dioxane,2-methoxy-5,5-dimethyl-, CAS# 78319-58-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-Dioxane,5,5-dimethyl-2-phenyl-, CAS# 776-88-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-Dioxane-2-carboxylic acid ethyl ester, CAS# 90392-05-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-Dioxane-2-carboxylicacid, 5,5-dimethyl-, CAS# 744220-87-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-Dioxane-2-ethanol, b,b,5,5-tetramethyl-, CAS# 7299-86-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-Dioxane-2-thione, 4,4,6-trimethyl-, CAS# 102368-18-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-Dioxane-4,5,6-trione, 2,2-dimethyl-, 5-(1H-imidazol-2-ylhydrazone), CAS# 112298-42-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-DIOXANE-4,5,6-TRIONE, 2,2-DIMETHYL-, 5-[(4-BROMOPHENYL)HYDRAZONE] (EN), CAS# 248583-68-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-(1-methylethyl)-, CAS# 72651-95-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-(2-methyl-1-oxopropyl)-, CAS# 74965-86-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-(2-piperidinylidene)-, CAS# 70912-53-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-(2-propenyl)-, CAS# 113427-02-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-(phenylmethylene)-, CAS# 1214-54-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-[(2E)-3-phenyl-2-propenylidene]-, CAS# 548765-13-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-[(methylamino)methylene]-, CAS# 111286-54-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-[(methylthio)phenylmethylene]-, CAS# 112182-61-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-[1-(1-pyrrolidinyl)propyl]-, CAS# 93498-07-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-[1-(methylthio)propylidene]-, CAS# 112182-60-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-phenyl-5-(phenylmethyl)-, CAS# 109687-35-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-propyl-, CAS# 74965-91-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 5-(1,1-dimethylethyl)-2,2-dimethyl-, CAS# 81710-06-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 5-(1-hydroxyhexylidene)-2,2-dimethyl-, CAS# 66696-79-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 5,5-dibutyl-2,2-dimethyl-, CAS# 83540-56-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 5-[(butylamino)methylene]-2,2-dimethyl-, CAS# 90367-98-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 5-[(cyclohexylamino)methylene]-2,2-dimethyl-, CAS# 15568-90-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione, 5-butylidene-2,2-dimethyl-, CAS# 25464-87-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,2,2-dimethyl-5-(1-oxooctyl)-, CAS# 103576-44-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,2,2-dimethyl-5-[(4-methylphenyl)methylene]-, CAS# 15795-51-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,2,2-dimethyl-5-[[4-(phenylmethoxy)phenyl]methyl]-, CAS# 920525-54-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,2,2-dimethyl-5-[1-(methylthio)-2-phenylethylidene]-, CAS# 112306-53-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,5-(1H-indol-3-ylmethyl)-2,2-dimethyl-, CAS# 72651-98-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,5-(2-furanylmethyl)-2,2-dimethyl-, CAS# 72651-97-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,5,5-bis[(1,2-dimethyl-1H-indol-3-yl)methyl]-2,2-dimethyl-, CAS# 88344-30-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,5-[(1,2-dimethyl-1H-indol-3-yl)methyl]-2,2-dimethyl-, CAS# 88341-25-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,5-[(2,3-dimethoxyphenyl)methylene]-2,2-dimethyl-, CAS# 847259-16-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,5-[(2,5-dimethoxyphenyl)methylene]-2,2-dimethyl-, CAS# 117646-10-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,5-[(3,5-dimethoxyphenyl)methylene]-2,2-dimethyl-, CAS# 874111-41-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,5-[[(2-mercaptoethyl)amino]methylene]-2,2-dimethyl-, CAS# 188601-30-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,5-[1H-indol-3-yl(3-nitrophenyl)methyl]-2,2-dimethyl-, CAS# 67996-12-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Dioxane-4,6-dione,5-[1H-indol-3-yl(4-nitrophenyl)methyl]-2,2-dimethyl-, CAS# 676642-31-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-Dioxane-4-methanol, 2-(4-methoxyphenyl)-, (2S,4S)-, CAS# 103708-37-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-Dioxane-4-methanol, 5-hydroxy-2-phenyl-, (2R,4S,5R)-, CAS# 117122-84-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-dioxane-5,5-dicarboxylic acid, CAS# 100351-22-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-Dioxane-5,5-dimethanol, 2,2-dimethyl-, CAS# 770-74-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-Dioxane-5,5-dimethanol, 2-phenyl-, diacetate, CAS# 107058-94-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-Dioxane-5-carboxaldehyde, 2,2-dimethyl-4,6-dioxo-, CAS# 72793-38-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-Dioxane-5-carboxaldehyde,2,2-dimethyl-, CAS# 102573-84-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dioxane-5-methanol, 5-ethyl-2-(2-furanyl)-, cis-, CAS# 25437-25-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-Dioxane-5-methanol,5-ethyl-2-(2-furanyl)-, CAS# 22698-73-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-Dioxaspiro[4.4]nonan-2-one,4-methylene-, CAS# 184007-11-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-dioxa-spiro[4.5]decane, CAS# 176-97-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-Dioxaspiro[5.5]undecan-9-one, 2-phenyl-, CAS# 189509-25-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Dioxepane-5-carbonitrile, 6-hydroxy-2,2-dimethyl-, trans-, CAS# 141077-78-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-Dioxepin, 2-(2-chloroethyl)-4,7-dihydro-, CAS# 100604-63-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-Dioxepin, 4,5-dihydro-, CAS# 74076-64-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-Dioxepin, 4,7-dihydro-2-(4-methoxyphenyl)-, CAS# 74076-63-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Dioxepin, 4,7-dihydro-2-(4-nitrophenyl)-, CAS# 73150-61-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-Dioxepin, 4,7-dihydro-2-methyl-, CAS# 7045-86-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-Dioxepin,2-(bromomethyl)-4,7-dihydro-, CAS# 117381-06-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dioxo-1-(2-hydroxyphenyl)butyl methyl ester, CAS# 55386-79-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dioxo-1-(phenylamino)butan-2-yl acetate, CAS# 124070-06-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-dioxo-1,3-dihydro-isobenzofuran-4-carboxylic acid, CAS# 3786-39-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-dioxo-1,3-dihydro-isobenzofuran-5-carboxylic acid dodecyl ester, CAS# 22485-51-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-dioxo-1,3-dihydro-isoindole-5-carboxylic acid amide, CAS# 21343-93-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dioxo-1,3-diphenylpropan-2-yl methanesulfonate, CAS# 111772-79-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-dioxo-1H,3H-naphtho<1,8-cd>pyran-5-sulfonic acid, CAS# 69409-07-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-dioxo-1-phenylbutan-2-yl acetate, CAS# 13054-84-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dioxo-1-phenylbutan-2-yl methanesulfonate, CAS# 116858-72-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 4-(trifluoromethyl)benzoate, CAS# 1441984-36-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 4-fluorobenzoate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 4-methylbenzoate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl acetate, CAS# 17720-64-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl prop-2-ynoate, CAS# 1622071-50-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl thiophene-2-carboxylate, CAS# 82649-27-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-dioxo-2,3-dihydro-1H-phenalen-2-yl 4-methylbenzenesulfonate, CAS# 5551-72-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dioxo-2-phenylisoindole-5-carboxylic acid, CAS# 4649-27-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-dioxocane, CAS# 6572-90-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-dioxoindene-2-carbonitrile, CAS# 42382-92-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-dioxoisoindole-5-carboxylic acid, CAS# 20262-55-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dioxoisoindoline-2-carbonitrile, CAS# 63571-77-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-dioxoisoindoline-5-carbonitrile, CAS# 34613-09-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-Dioxol-2-one,4-[[(4-fluorophenyl)thio]methyl]-5-methyl-, CAS# 111738-35-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-Dioxolan-2-amine, N,N,4-triethyl-2-(1,2,2,2-tetrafluoroethyl)-, CAS# 89752-27-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-Dioxolan-2-amine, N,N-diethyl-4-methyl-2-(1,2,2,2-tetrafluoroethyl)-, CAS# 89752-24-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-Dioxolan-2-one, 4-fluoro-4-methyl-, CAS# 114435-07-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dioxolan-2-spiro-1'-(2'-ethoxycarbonylmethyl)cyclopentane, CAS# 82253-44-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 2-(1,1-dimethylethyl)-5-methyl-, CAS# 146528-25-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 2-(1,1-dimethylethyl)-5-phenyl-, (2R,5R)-, CAS# 116907-30-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 2-(1,1-dimethylethyl)-5-phenyl-, (2S,5R)-, CAS# 834909-35-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 2,2,5-trimethyl-, (S)-, CAS# 89104-22-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 2,2-diethyl-5-methyl-, (S)-, CAS# 89053-62-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 2,2-dimethyl-5-(1-methylethyl)-, (S)-, CAS# 89104-23-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 2,2-dimethyl-5-(phenylmethyl)-, (S)-, CAS# 89053-64-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 2,2-dimethyl-5-phenyl-, (R)-, CAS# 111718-68-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 5-(1-methylethyl)-, (S)-, CAS# 89053-59-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 5-(2-methylpropyl)-, (S)-, CAS# 89053-60-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 5-(phenylmethyl)-, (S)-, CAS# 89053-61-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 5-(phenylmethyl)-2,2-bis(trifluoromethyl)-, (5S)-, CAS# 748134-70-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 5-(phenylmethylene)-2,2-bis(trifluoromethyl)-, CAS# 7712-19-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 5-methyl-, (S)-, CAS# 89053-58-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dioxolan-4-one, 5-phenyl-, (S)-, CAS# 60646-33-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(1-ethylpentyl)-, CAS# 4359-47-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(1-methylpropyl)-, CAS# 14447-25-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(2,5-dimethoxyphenyl)-, CAS# 72054-76-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, CAS# 78842-55-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(2-azidoethyl)-, CAS# 111752-08-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(2-bromo-4,5-dimethoxyphenyl)-, CAS# 103477-58-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(2-bromo-5-fluorophenyl)-, CAS# 773094-69-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(2-furanyl)-4-methyl-, CAS# 4359-54-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(2-phenylethyl)-, CAS# 4360-60-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(3-bromophenyl)-2-ethyl-, CAS# 73275-86-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(3-butynyl)-, CAS# 71948-69-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(4-bromo-2-methoxyphenyl)-, CAS# 109142-86-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(bromomethyl)-2-(4-bromophenyl)-4-phenyl-, CAS# 59362-74-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-(diphenylmethylene)-4,4-dimethyl-, CAS# 109911-29-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2,2,4,5-tetramethyl-, (4R,5S)-rel-, CAS# 17226-65-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2,2-dimethyl-4-[(2-methylphenoxy)methyl]-, (S)-, CAS# 52094-01-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2,2-dimethyl-4-[(2-propenyloxy)methyl]-, (S)-, CAS# 56083-15-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2,2-dimethyl-4-[(octadecyloxy)methyl]-, (S)-, CAS# 10585-86-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2,2-dimethyl-4-phenyl-, CAS# 52129-03-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-[[(1R)-2,2,3-trimethyl-3-cyclopenten-1-yl]methyl]-, CAS# 153355-57-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-[2-(trifluoromethyl)phenyl]-, CAS# 116063-84-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-[4-nitro-3-[(phenylsulfonyl)methyl]phenyl]-, CAS# 89303-15-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-ethoxy-2,4-dimethyl-, CAS# 61562-13-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-methoxy-4-phenyl-, CAS# 61562-00-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-methyl-2-(2-nitroethyl)-, CAS# 79958-77-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-methyl-2-(3-nitropropyl)-, CAS# 19639-74-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dioxolane, 2-methyl-2,4-diphenyl-, CAS# 101854-08-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-Dioxolane, 4-(1-methylethenyl)-2-phenyl-, CAS# 105873-61-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dioxolane, 4-(3-iodopropyl)-2,2-dimethyl-, (4S)-, CAS# 123151-59-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-Dioxolane, 4-(chloromethyl)-2,2-diethyl-, (R)-, CAS# 139892-49-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-Dioxolane, 4-[(pentyloxy)methyl]-, CAS# 19921-29-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-Dioxolane, 4-[[(2-methyl-2-propenyl)oxy]methyl]-, CAS# 126121-31-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-Dioxolane, 4-[[(4-methoxyphenyl)methoxy]methyl]-2,2-dimethyl-, (R)-, CAS# 109786-76-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-Dioxolane, 4-[[(4-methoxyphenyl)methoxy]methyl]-2,2-dimethyl-,(4S)-, CAS# 109786-73-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-Dioxolane, 4-ethynyl-2,2-dimethyl-, (4S)- (9CI), CAS# 56017-85-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-Dioxolane, 4-hexyl-, CAS# 72493-07-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Dioxolane, 4-methyl-2-(3-nitrophenyl)-, CAS# 72024-78-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-Dioxolane, 4-methyl-2-(phenylmethyl)-, CAS# 1303310, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-Dioxolane, 4-methyl-2,2-diphenyl-, CAS# 77130-19-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-Dioxolane, 4-phenyl-, CAS# 1075-20-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-Dioxolane,2-(1-butyn-1-yl)-2-methyl-, CAS# 35792-10-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Dioxolane,2-(2-chloro-1-methylethyl)-, CAS# 35502-17-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-Dioxolane,2-(2-chloropropyl)-, CAS# 35502-16-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-Dioxolane,2-(2-nitropropyl)-, CAS# 106334-27-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-Dioxolane,2-(3-bromo-4-fluorophenyl)-, CAS# 77771-04-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-Dioxolane,2-(bromomethyl)-2-(4-bromophenyl)-4-(2,4-dichlorophenyl)-, CAS# 59362-68-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-Dioxolane,2-(bromomethyl)-2-(4-chlorophenyl)-4-(2,4-dichlorophenyl)-, CAS# 59362-66-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-Dioxolane,2-(dichloromethyl)-2-methyl-, CAS# 22052-63-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Dioxolane,2,2-dimethyl-4-[(tetradecyloxy)methyl]-, CAS# 13879-87-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-Dioxolane,2-[2-(methylthio)ethyl]-, CAS# 16630-62-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-Dioxolane,2-methoxy-2-methyl-, CAS# 19798-71-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-Dioxolane,2-methyl-2-(4-penten-1-yl)-, CAS# 86646-44-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-Dioxolane,2-methyl-2-(4-pentyn-1-yl)-, CAS# 74066-96-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dioxolane,4-(3-bromopropyl)-2,2-dimethyl-, (4S)-, CAS# 130995-39-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-Dioxolane,4-(chloromethyl)-, CAS# 1072-61-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-Dioxolane,4-(chloromethyl)-2-ethyl-, CAS# 116111-72-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-Dioxolane,4,4,5,5-tetramethyl-2-(phenylmethyl)-, CAS# 121074-61-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-Dioxolane,4-[[(2,6-dichlorophenyl)methoxy]methyl]-4-ethyl-2,2-dimethyl-, CAS# 55117-01-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Dioxolane,4-[2-[(4-methoxy-3-nitrophenyl)methoxy]ethyl]-2,2-dimethyl-, (S)-, CAS# 113479-25-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dioxolane-2,2-dipropanoicacid, 2,2-diethyl ester, CAS# 19719-88-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-Dioxolane-2-acetaldehyde, 2-methyl-, CAS# 18871-63-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-Dioxolane-2-aceticacid, 2-propyl-, ethyl ester, CAS# 76924-94-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-Dioxolane-2-carbonyl fluoride, 4-fluoro-5-oxo-2,4-bis(trifluoromethyl)-, CAS# 7345-49-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-Dioxolane-2-ethanol,2-(1-methylethyl)-, CAS# 113778-66-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-Dioxolane-2-propanal, b-methyl-, CAS# 161559-09-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-Dioxolane-2-propanoic acid, 2-methyl-, ethyl ester, CAS# 941-43-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-dioxolane-2-thione, CAS# 20628-59-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Dioxolane-4,4-diaceticacid, 5-oxo-, CAS# 144-16-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-Dioxolane-4,5-dicarboxamide, N,N,N',N'-tetramethyl-2-nonyl-,(4R,5R)-, CAS# 495403-20-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-Dioxolane-4,5-dicarboxylic acid, 2,2-dimethyl-, dimethyl ester, cis-, CAS# 6134-82-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-Dioxolane-4,5-dimethanol,2,2-dimethyl-, 4,5-dimethanesulfonate, (4S,5S)-, CAS# 4248-74-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-acetaldehyde, 2,2-dimethyl-, (R)-, CAS# 72496-37-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-aceticacid, 2,2-dimethyl-5-oxo-, CAS# 114458-03-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-acetyl chloride, 2,2-dimethyl-5-oxo-, (R)-, CAS# 174563-67-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-butanol,2,2-dimethyl-, CAS# 14739-10-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-carbonylchloride, 2,2,5-trimethyl-, (4S-cis)- (9CI), CAS# 124600-39-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-carbonylchloride, 2,2-dimethyl-, (4S)-, CAS# 116561-26-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-carboxaldehyde, 2,2,5-trimethyl-, (4S,5R)-, CAS# 99603-55-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-carboxaldehyde, 2,2-dimethyl-4-(2-oxoethoxy)-, (S)-, CAS# 113863-58-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-carboxaldehyde,2,2,5-trimethyl-, (4R,5S)-, CAS# 84519-53-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-carboxamide, N,N,2,2-tetramethyl-, (R)-, CAS# 102563-44-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-carboxamide, N-methoxy-N,2,2-trimethyl-, (4S)-, CAS# 133481-14-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-carboxylicacid, 2,2,5-trimethyl-, (4S-trans)- (9CI), CAS# 127062-02-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-carboxylicacid, 2,2-dimethyl-, methyl ester, CAS# 108865-84-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-carboxylicacid, 2,2-dimethyl-, potassium salt (1:1), (4S)-, CAS# 117205-81-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-ethanol, 2,2,4-trimethyl-, CAS# 79298-42-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-ethanol, 2,2-dimethyl-, 3,5-dinitrobenzoate, (R)-, CAS# 116556-68-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-ethanol, 2,2-dimethyl-, 4-methylbenzenesulfonate, (S)-, CAS# 94992-56-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-methanol, 2-(bromomethyl)-2-(2,4-dichlorophenyl)-,(2S,4R)-, CAS# 512791-61-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-methanol, 2,2-dimethyl-, 4-nitrobenzoate, CAS# 61656-62-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-methanol, 2,2-dimethyl-, methanesulfonate, (4R)-, CAS# 83461-40-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-methanol, 2,2-dimethyl-, propanoate, (4S)-, CAS# 117438-31-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-methanol, 5-hexyl-2,2-dimethyl-,4-methylbenzenesulfonate, (4S,5S)-, CAS# 244071-55-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-methanol,2-(2,4-dichlorophenyl)-2-(2H-tetrazol-2-ylmethyl)-, benzoate (ester), cis-, CAS# 89614-28-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-methanol,2-hexyl-, CAS# 1708-35-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-DIOXOLANE-4-METHANOL,2-METHYL-2-PENTYL-, CAS# 4361-59-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-methanol,5-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-2,2-dimethyl-, (4R,5R)-, CAS# 145554-06-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-Dioxolane-4-propanoic acid, 2,2-dimethyl-, (4S)-, CAS# 111192-54-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-dioxole-2-thione, CAS# 37635-87-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-Dioxolo[4,5-g]isoquinoline,5,6,7,8-tetrahydro-6-[(4-methoxyphenyl)methyl]-, CAS# 107602-51-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Dioxolo[4,5-g]quinolin-8(5H)-one, CAS# 154504-43-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-Dioxolo[4,5-g]quinoline-7-carbonylchloride, 5-ethyl-5,8-dihydro-8-oxo-, CAS# 19658-59-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-Dioxolo[4,5-g]quinoline-7-carboxylic acid,5-amino-5,8-dihydro-8-oxo-, ethyl ester, CAS# 90428-40-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dioxolo<4,5-g><3,1>benzoxazine-6,8(5H)dione, CAS# 57385-14-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-dioxo-N,2-diphenylisoindole-5-carboxamide, CAS# 529151, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dioxo-N-phenyl-2-benzofuran-5-carboxamide, CAS# 92424-72-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-dioxo-phthalan-4,6-disulfonic acid, CAS# 876487-24-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-dipalmitoyloxy-2-propanone, CAS# 24472-45-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-dipentylurea, CAS# 2078-76-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-diphenacylbenzene, CAS# 25423-81-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-Diphenoxy-2-propanol, CAS# 622-04-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-diphenoxypropan-2-one, CAS# 57641-21-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diphenoxypropan-2-yl acetate, CAS# 71159-31-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diphenyl 2-(prop-2-en-1-yl)-2,3-dihydro-1H-1,3-benzodiazole-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-diphenyl 2-(prop-2-en-1-yl)-2,3-dihydro-1H-imidazole-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-diphenyl imidazolidine-2,4-dione, CAS# 459177, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-Diphenyl isothianaphthene, CAS# 16587-39-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-diphenyl(11C)urea, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-DIPHENYL-.DELTA.2-PYRAZOLINE, CAS# 2538-52-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-diphenyl-1-(phenylcarbamoyl)urea, CAS# 2645-39-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-diphenyl-1-(pyridin-2-yl)prop-2-yn-1-ol, CAS# 55690-02-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-diphenyl-1,3-bis(pyridin-2-yl)urea, CAS# 1040129-94-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diphenyl-1,3-diazinane-2,4,6-trione, CAS# 7391-60-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diphenyl-1,4-pentanedione, CAS# 83188-10-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-Diphenyl-1-benzoyloxy-3-oxo-2-aza-1-propen, CAS# 55824-85-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-diphenyl-1-butyne, CAS# 58040-58-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-diphenyl-1H-indazole, CAS# 1575-25-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-diphenyl-1H-indole, CAS# 20538-11-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-diphenyl-1H-pyrazole, CAS# 946717, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-diphenyl-1H-pyrrole, CAS# 53646-85-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-diphenyl-1H-pyrrole-2,5-dione, CAS# 75066-70-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-diphenyl-1-oxo-4-pentene, CAS# 140863-27-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-Diphenyl-1-thiosemicarbazono-propanon-(3), CAS# 89457-96-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-diphenyl-2-(1,2,3,4-tetrahydronaphthalen-1-yl)propane-1,3-dione, CAS# 954374-38-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-diphenyl-2-(1H-1,2,4-triazol-1-yl)prop-2-en-1-one, CAS# 99736-86-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-diphenyl-2-(1-phenyl-ethyl)-propane-1,3-dione, CAS# 116140-58-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diphenyl-2-(1-phenylethylidene)propane-1,3-dione, CAS# 39568-00-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-diphenyl-2-(diphenylmethyl)propane-1,3-dione, CAS# 60999-93-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-diphenyl-2-(phenylamino)propan-1-one, CAS# 111584-85-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-diphenyl-2-(phenyl-λ3-iodanylidene)propane-1,3-dione, CAS# 128753-03-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-diphenyl-2-(prop-2-yn-1-yl)propane-1,3-dione, CAS# 19823-69-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-diphenyl-2,3-bis(tosyloxy)-1-oxopropane, CAS# 89959-83-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-diphenyl-2,3-di(piperidin-1-yl)propan-1-one, CAS# 6281-88-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diphenyl-2,3-diazaprop-2-en-1-one, CAS# 952-53-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-diphenyl-2,3-dihydro-1H-naphth[1,2-e][1,3]oxazine, CAS# 53983-77-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-diphenyl-2,3-dimethylcyclopropene, CAS# 50902-99-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-diphenyl-2-[phenyl(phenylsulfanyl)methyl]propane-1,3-dione, CAS# 1011232-57-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Diphenyl-2-azaallenium-hexachloroantimonat, CAS# 76058-07-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-diphenyl-2-imidazolidineselenone, CAS# 86453-45-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-diphenyl-2-methyl-1-H-indene, CAS# 51310-26-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-diphenyl-2-methyl-2-propanol, CAS# 42117-23-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-diphenyl-2-naphthol, CAS# 24243-67-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diphenyl-2-phenyliminopropane-1,3-dione, CAS# 24416-28-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-Diphenyl-2-phenylthio-1,3-propandion, CAS# 28195-12-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diphenyl-2-propen-1-one oxime, CAS# 21067-42-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-diphenyl-2-propyl-imidazolidine, CAS# 55320-82-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione, CAS# 35221-12-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-diphenyl-3-(1H-1,2,4-triazol-1-yl)propan-1-one, CAS# 69100-73-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-diphenyl-3-(1H-pyrrol-2-yl)propan-1-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diphenyl-3-(2-phenyl-1H-indol-3-yl)propan-1-one, CAS# 557785-79-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diphenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-one, CAS# 199999-46-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-diphenyl-3-(butylthio)propan-1-one, CAS# 21205-11-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diphenyl-3-(p-carboxyphenylamino)-1-propanone, CAS# 3711-57-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-diphenyl-3-(phenylselanyl)propan-1-one, CAS# 76618-48-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-diphenyl-3-(trimethylsilyl)propan-1-one, CAS# 30262-98-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diphenyl-3-(triphenylphosphoranylidene)propan-1-one, CAS# 14630-49-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-diphenyl-3-[(pyridin-2-yl)amino]propan-1-one, CAS# 159639-03-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-diphenyl-3-[(trimethylsilyl)oxy]propan-1-one, CAS# 92234-01-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-diphenyl-3-[(trimethylsilyl)oxy]propan-1-one, CAS# 104108-14-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diphenyl-3-[2-(pyridin-2-yl)phenyl]propan-1-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-diphenyl-3-[4-(trifluoromethyl)phenyl]propan-1-one, CAS# 53448-97-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-diphenyl-3-{[3-(trifluoromethyl)phenyl]amino}propan-1-one, CAS# 1231685-12-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diphenyl-3-{[4-(propan-2-yl)phenyl]amino}propan-1-one, CAS# 1262109-22-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-diphenyl-3H-benzo[f]chromene, CAS# 117922-01-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-diphenyl-3-hydroxy-1-butanone, CAS# 6397-70-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-diphenyl-3-methoxy-1-propanone, CAS# 89524-37-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-diphenyl-3-phenyliminopropene, CAS# 64723-86-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-diphenyl-3-piperidin-1-ylpropan-1-one, CAS# 5350-97-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-Diphenyl-3-thioxopropane-1-one, CAS# 1215-43-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-diphenyl-4-(phenyldiazenyl)-1H-pyrazol-5-amine, CAS# 100644-98-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diphenyl-4-(pyridin-2-yl)butan-1-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-diphenyl-4-(pyridin-2-yl)pentan-1-one, CAS# 1274835-54-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-diphenyl-4-(pyrimidin-4-yl)butan-1-one, CAS# 1274835-51-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-diphenyl-4-(quinolin-2-yl)butan-1-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-diphenyl-4-benzylidenepyrazol-5(4H)-one, CAS# 36221-08-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-Diphenyl-4-cyanopyrazole, CAS# 17647-21-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Diphenyl-4-cyclohexenyl-5-pyrazolamine, CAS# 91623-41-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diphenyl-4-methyl-1H,6H-pyrano<2,3-c>pyrazol-6-one, CAS# 30020-86-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-diphenyl-4-oxo-2-thioxoimidazolidine, CAS# 15355-79-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-diphenyl-4-pentene-1-one, CAS# 38940-36-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-diphenyl-5-(3-nitrophenyl)-2-pyrazoline, CAS# 1851512, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-diphenyl-5-(4-methoxyphenyl)pyrazole, CAS# 27301-46-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-diphenyl-5-(thiazol-4-yl)-1,2,4-triazole, CAS# 137555-65-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diphenyl-5-(trifluoromethyl)-1H-pyrazole, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diphenyl-5-benzoylpyrazoline, CAS# 54606-21-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diphenyl-5-bromopyrazol, CAS# 1188115-46-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diphenyl-5-pyridin-2-ylpentane-1,5-dione, CAS# 81765-26-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-diphenyl-5-vinyl-1,2,4-triazole, CAS# 115591-23-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-Diphenyl-5-vinylpyrazol, CAS# 87995-98-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diphenylacetone benzoylhydrazone, CAS# 205121-86-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diphenylacetone dimethyl acetal, CAS# 193829-29-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-Diphenylacetone O-methyloxime, CAS# 370025, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-diphenylazulene, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-diphenylbenzo[c]selenophene, CAS# 1054569-49-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diphenylbenzo[f]quinoline, CAS# 3837-42-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-diphenylbenzo[h]quinazoline, CAS# 36547-38-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-diphenylbut-1-ene, CAS# 16606-47-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-diphenylbut-3-en-2-one, CAS# 68646-49-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-diphenylbutan-1-ol, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diphenylbutan-1-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diphenylcyclopenta[l]phenanthren-2-one, CAS# 5660-91-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-diphenylheptan-1-one, CAS# 1454-57-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-diphenylhex-5-en-1-one, CAS# 21136-48-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diphenylhex-5-yn-1-one, CAS# 125488-46-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-diphenylhexane-1,4-dione, CAS# 80460-13-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-diphenylhexane-1,5-dione, CAS# 53857-09-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-diphenylimidazo[1,5-a]pyridine, CAS# 79159-65-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-diphenylimidazolidine, CAS# 2513-64-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-diphenylimidazolidine-2,4,5-trione, CAS# 6488-59-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diphenylindolin-2-one, CAS# 23210-25-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-diphenylisoquinoline, CAS# 34987-64-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-diphenylnaphthalene, CAS# 848-83-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-diphenyloctan-1-one, CAS# 2124-77-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-diphenylprop-2-yn-1-ol, CAS# 1817-49-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-Diphenylprop-2-yn-1-one, CAS# 7338-94-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-diphenylprop-2-yn-1-yl acetate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-diphenylprop-2-yn-1-yl acetate, CAS# 93321-44-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-diphenylprop-2-ynyl-1-amine, CAS# 134166-47-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-diphenylprop-2-ynylbenzene, CAS# 5467-43-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-diphenylpropan-1-amine, CAS# 5689-74-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diphenylpropan-1-ol, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-diphenylpropan-2-ol, CAS# 5381-92-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-diphenylpropane-1,3-diol, CAS# 5355-61-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-diphenylpropane-1,3-dioxime, CAS# 66917-88-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-diphenylpropane-2,2-dicarboxylic acid, CAS# 4372-32-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-diphenylpropane-2,2-dithiol, CAS# 42937-97-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-DIPHENYLPROPENE, CAS# 5209-18-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-Diphenylpyrazole-4-propionic acid, CAS# 108446-77-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-diphenylpyrimidine, CAS# 25095-48-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-diphenylundec-4-yn-1-one, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-dipiperidino-butane, CAS# 88472-64-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-dipropyl-1,3-diazinan-2-one, CAS# 30826-87-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dipropyl-1H,3H,5H-pyrimidine-2,4,6-trione, CAS# 64319-68-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-dipropyl-8-(3-thienyl)xanthine, CAS# 117027-85-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-Di-p-tolylguanidine, CAS# 54116-98-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dipyridin-2-ylpropan-2-one, CAS# 23580-81-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-dipyridin-3-ylpropane-1,3-dione, CAS# 6327-87-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-Disilacyclopentane, 1,1,3,3-tetramethyl-2-methylene-, CAS# 70284-70-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-distearoyl-2-chloroacetylglycerol, CAS# 339080-45-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-Distearoyloxy-2-chlorpropan, CAS# 26787-56-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-disulfo-1H-1,3-benzodiazol-3-ium chloride, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-disulfo-1H-imidazol-3-ium chloride, CAS# 1313873-53-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-di-t-butyl-5,5-dimethylhydantoin, CAS# 141312-47-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-di-tert-butyl 2-(2,2-dimethylpropanoyl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-di-tert-butyl 2-(2H-1,3-benzodioxol-5-yl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-di-tert-butyl 2-(2-methylpropanoyl)propanedioate, CAS# 235087-12-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-di-tert-butyl 2-(4-methoxyphenyl)propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-di-tert-butyl 2-(4-methylphenyl)propanedioate, CAS# 261513-58-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-di-tert-butyl 2-[(1R)-3-oxo-1-phenylpropyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-di-tert-butyl 2-[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]propanedioate, CAS# 592550-69-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-di-tert-butyl 2-[4-(trifluoromethyl)phenyl]propanedioate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-di-tert-butyl 2-acetylpropanedioate, CAS# 235087-10-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-di-tert-butyl 2-ethylidenepropanedioate, CAS# 888704-81-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-di-tert-butyl 2-oxo-2,3-dihydro-1H-1,3-benzodiazole-1,3-dicarboxylate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-di-tert-butyl 2-tetradecylpropanedioate, CAS# 149674-04-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.7 KG, Storage conditions at room temperature.

1,3-di-tert-butyl 7-bromo-2-oxo-1,2,3,4-tetrahydroquinazoline-1,3-dicarboxylate, CAS# 1630951-16-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-di-tert-butyl-1,1,3,3-tetramethyldisilatellurane, CAS# 80594-86-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-di-tert-butyl-1H-1,2,3,4-tetrazol-3-ium perchlorate, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-di-tert-butyl-1-isopropylurea, CAS# 1202047-23-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-di-tert-butyl-1λ3,3λ3,2,4-dioxadialumetane, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-di-tert-butyl-2-{4,4,6,6-tetramethyl-5-oxa-4,6-disila-1-platinatricyclo[5.1.0.01,3]octa-2,7-dien-1-ylidene}-2,3-dihydro-1H-imidazole, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-di-tert-butyl-2-chloro-[1,3,2]diazaphospholidine, CAS# 89437-94-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-di-tert-butyl-2-methoxybenzene, CAS# 1516-95-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-di-tert-butyl-5-isothiocyanatobenzene, CAS# 259222-92-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-ditert-butyl-5-methoxybenzene, CAS# 68039-43-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-ditert-butyl-5-phenylbenzene, CAS# 5723-93-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-Dithian-2-yl- lithium; 1,3-Dithian-2-yl-lithium, CAS# 36049-90-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-dithiane 1,1,3,3-tetraoxide, CAS# 26413-18-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-dithiane 1-oxide, CAS# 16487-10-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-dithiane sulfone, CAS# 55337-75-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-Dithiane, 2-(2,2-dimethoxy-1-methylethylidene)-, CAS# 110918-95-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dithiane, 2-(2,6-dimethyl-1,5-heptadienyl)-, (E)-, CAS# 65447-84-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,3-Dithiane, 2-(4-methoxyphenyl)-2-methyl-, CAS# 77464-22-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-Dithiane, 2,2-dibutyl-, CAS# 76467-38-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dithiane, 2,2-dipropyl-, CAS# 79032-15-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-Dithiane,2-(4-chlorophenyl)-, CAS# 10359-09-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-Dithiane-2-acetic acid, ethyl ester, CAS# 70562-14-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-dithiane-2-carbaldehyde, CAS# 34906-12-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-dithiane-2-carbonitrile, CAS# 33927-42-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-dithiane-2-carboxylic acid, CAS# 20461-89-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-dithiolan-2-ylmethanol, CAS# 86032-47-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-dithiolan-4-ylmethanol, CAS# 5862-51-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-dithiolane 1,1,3,3-tetraoxide, CAS# 26413-19-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-dithiolane 1,1-dioxide, CAS# 162776-86-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-Dithiolane, 2-(2-bromophenyl)-, CAS# 113509-22-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-Dithiolane, 2-(4-methylphenyl)-2-phenyl-, CAS# 76312-48-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-Dithiolane, 2,2-dipentyl-, CAS# 103383-69-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-Dithiolane, 2-cyclohexyl-, CAS# 70777-60-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-Dithiolane, 2-ethylidene-, CAS# 76368-26-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-Dithiolane,2,2-bis(phenylmethyl)-, CAS# 76312-47-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-Dithiolane,2,4-dimethyl-2-phenyl-, CAS# 100059-87-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-Dithiolane,2-methyl-2-[(1E)-2-phenylethenyl]-, CAS# 107389-59-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-dithiolane-2-carboxylic acid, CAS# 5616-65-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dithiolane-2-thione, 4,4-dimethyl-, CAS# 111185-38-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dithiole, 2-(1,3-dithiol-2-ylidene)-4-(4-methoxyphenyl)-, CAS# 82991-94-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Dithiole, 4-(4-nitrophenyl)-2-[(4-nitrophenyl)methylene]-, CAS# 61782-79-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Dithiole,2-[4,5-bis(methylseleno)-1,3-dithiol-2-ylidene]-4,5-bis(methylseleno)-, CAS# 96913-57-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-Dithiole,2-[4,5-bis(methyltelluro)-1,3-dithiol-2-ylidene]-4,5-bis(methyltelluro)-, CAS# 100460-77-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Dithiole,2-[4,5-bis(octylseleno)-1,3-dithiol-2-ylidene]-4,5-bis(octylseleno)-, CAS# 109632-67-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-Dithiole-2-thione, 4,5-bis[(2,4-dinitrophenyl)thio]-, CAS# 138206-22-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-dithiole-2-thione-4,5-dithiolate(2-), CAS# 59089-88-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-Dithiolo[4,5-b][1,4]dithiin-2-thione, 5,6-dihydro-5-phenyl-, CAS# 111082-47-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-Dithiolo[4,5-b][1,4]dithiin-2-thione, 5-ethoxy-5,6-dihydro-, CAS# 110789-38-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-Dithiolo[4,5-f][1,3,5]trithiepin-2-thione, CAS# 102567-30-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1',3'-dithiolo<4',5':5,6><1,4>dithiino<2,3-b>quinoxaline-2-thione, CAS# 130689-31-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-ditrityloxypropan-2-ol, CAS# 1294335, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-divinyloxybutane, CAS# 53002-12-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,3-Di-Z-2-(trifluoromethylsulfonyl)guanidine, CAS# 207857-19-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-Heptadiyne, CAS# 10313-06-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Hexanedione,1,1'-[1,1':2',1''-terphenyl]-4,4''-diylbis[4,4,5,5,6,6,6-heptafluoro-, CAS# 200862-69-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-Imidazolidinedicarboxylic acid, 2-thioxo-, bis(1,1-dimethylethyl)ester, CAS# 173300-83-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-indandionedioxime, CAS# 6624-48-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-Isobenzofurandione, 3a,4,5,7a-tetrahydro-, cis-, CAS# 4325-56-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Isobenzofurandione, 3a,4,7,7a-tetrahydro-5-(tributylstannyl)-, CAS# 103238-12-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-Isobenzofurandione, 5-(dichloromethylsilyl)-, CAS# 104209-26-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-Isobenzofurandione,3a,4,7,7a-tetrahydro-4,5-dimethyl-7-(2-methyl-1-propenyl)-, CAS# 7672-77-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-Isobenzofurandione,4-(acetyloxy)-, CAS# 101976-15-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Isobenzofurandione,4,5,6,7-tetrachloro-3a,7a-dihydro-, CAS# 72524-46-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-Isobenzofurandione,5-chloro-3a,4,7,7a-tetrahydro-, CAS# 14737-08-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,3-Naphthalenedicarbonitrile,2-amino-4-(4-chlorophenyl)-5,6,7,8-tetrahydro-, CAS# 141811-23-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-naphthalenedicarboxylic acid, CAS# 2089-93-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-O-benzylidene D-arabitol, CAS# 80924-06-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-O-bis(tert-butyldimethylsilyl)resorcinol, CAS# 120951-86-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.8 KG, Storage conditions at room temperature.

1,3-octadiynylbenzene, CAS# 62217-45-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-Octanedione, 4-ethyl-1-phenyl-, CAS# 112405-99-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-Oxathiane, 2-(2-methylphenyl)-, CAS# 138470-24-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-Oxathiolan-5-one, 2,2,4,4-tetramethyl-, CAS# 87602-19-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-Oxathiolane, 2-ethyl-2-phenyl-, CAS# 100058-47-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-Oxathiolane, 2-heptyl-, CAS# 90467-73-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-oxazole-2-thiol, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-oxazolidine-2,4-dione, CAS# 285-52-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.5 KG, Storage conditions at room temperature.

1,3-Pentadiene, 4-methyl-, CAS# 926-56-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-Pentanediol, 2,4-dimethyl-, (2R,3S)-rel-, CAS# 3876-47-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-Pentanedione, 1-(2-hydroxyphenyl)-5-phenyl-, CAS# 61828-54-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-Pentanedione, 2-methoxy-4,4-dimethyl-1-phenyl-, CAS# 112370-81-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-Phenylenebis(methylene)selenocyanate, CAS# 59395-13-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-phenylenedipropynoic acid, CAS# 4843-46-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Piperazinedicarboxylic acid, 1-(1,1-dimethylethyl) 3-ethyl ester, CAS# 183742-29-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-Piperidinedicarboxylic acid, 2-oxo-3-(phenylseleno)-,1-(1,1-dimethylethyl) 3-(phenylmethyl) ester, CAS# 555153-61-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-Propanediamine, N-(1-methylethyl)-, dihydrochloride, CAS# 64670-73-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1 KG, Storage conditions at room temperature.

1,3-Propanediamine, N,N,N',N'-tetraethyl-2-(3-methyl-2-furanyl)-, CAS# 112430-03-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-Propanediamine, N-[2-[(2-aminoethyl)amino]ethyl]-, CAS# 70209-08-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-Propanediamine,N-(1,3-dimethylbutylidene)-N'-[3-[(1,3-dimethylbutylidene)amino]propyl]-, CAS# 15753-92-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-Propanediamine,N-(2-pyridinylmethyl)-N'-[3-[(2-pyridinylmethyl)amino]propyl]-, CAS# 64739-67-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,3-Propanediamine,N'-(3-chloro-6-phenyl-4-pyridazinyl)-N,N-dimethyl-, CAS# 89868-01-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Propanediamine,N-(7-chloro-4-quinolinyl)-N'-[3-[(7-chloro-4-quinolinyl)amino]propyl]-, CAS# 53186-49-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-Propanediamine,N-[3-(dimethylamino)propyl]-N-(methoxymethyl)-N',N'-dimethyl-, CAS# 67151-61-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-Propanediamine,N1-(2-ethylhexyl)-, CAS# 13281-06-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Propanediamine,N1-1H-benzimidazol-2-yl-, CAS# 309718-03-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-Propanediamine,N1-4-quinolinyl-, CAS# 75090-53-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-Propanediamine,N1-methyl-N3-(2-nitrophenyl)-N1-[3-[(2-nitrophenyl)amino]propyl]-, CAS# 57402-83-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-propanediol diester of toluic acid, CAS# 32604-71-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,3-propanediol diformate, CAS# 1727-40-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-propanediol diglycidyl ether, CAS# 17342-30-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-Propanediol, 1-(4-methoxyphenyl)-, CAS# 70760-15-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-Propanediol, 1,3-diphenyl-, (1R,3R)-, CAS# 77291-92-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-Propanediol, 1,3-diphenyl-, (1S,3S)-, CAS# 108391-15-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-Propanediol, 1-phenyl-, 3-acetate, (1S)-, CAS# 142824-10-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Propanediol, 1-phenyl-, 3-methanesulfonate, (1R)-, CAS# 115290-78-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Propanediol, 2-(bromomethyl)-2-methyl-, CAS# 113294, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-Propanediol, 2-(hydroxymethyl)-2-[(phenylmethylene)amino]-, CAS# 64160-42-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,3-PROPANEDIOL, 2-(HYDROXYMETHYL)-2-METHYL-, TRIBENZOATE, CAS# 4196-87-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Propanediol, 2-(phenylmethoxy)-, diacetate, CAS# 105409-38-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Propanediol, 2,2-bis(azidomethyl)-, CAS# 104274-80-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-Propanediol, 2-[[(methylsulfonyl)oxy]methyl]-, dimethanesulfonate, CAS# 113967-52-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Propanediol, 2-dodecyl-, CAS# 10395-09-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-Propanediol, 2-ethyl-2-nitro-, CAS# 597-09-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-Propanediol, 2-methoxy-, CAS# 761-06-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-Propanediol, 2-methyl-, monobenzoate, CAS# 112057-72-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-Propanediol, 2-methyl-2-[(nitrooxy)methyl]-, dinitrate (ester), CAS# 3032-55-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-Propanediol, bis(hydrogen sulfate), CAS# 79431-21-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-Propanediol, monoacetate, CAS# 36678-05-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.1 KG, Storage conditions at room temperature.

1,3-Propanediol,1-(4-hydroxy-3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)-, CAS# 92409-34-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-Propanediol,1-(dihydrogen phosphate), CAS# 13507-42-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.1 KG, Storage conditions at room temperature.

1,3-Propanediol,2-(1-piperazinyl)-, CAS# 78531-48-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-Propanediol,2-(2,2-diethoxyethyl)-, monoacetate, (2R)- (9CI), CAS# 144461-19-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,3-Propanediol,2-(4-aminobutyl)-, CAS# 125162-81-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Propanediol,2-(dimethylamino)-1-(4-nitrophenyl)-, (1R,2R)-, CAS# 18867-45-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-Propanediol,2-(dimethylamino)-1-(4-nitrophenyl)-, (1S,2S)-, CAS# 18867-44-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-Propanediol,2-(dimethylamino)-2-(hydroxymethyl)-, CAS# 1112-24-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-Propanediol,2-(hydroxymethyl)-2-propyl-, CAS# 7426-71-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,3-Propanediol,2,2'-[oxybis(methylene)]bis[2-[(nitrooxy)methyl]-, 1,1',3,3'-tetranitrate, CAS# 13184-80-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-Propanediol,2,2-bis(hydroxymethyl)-, 1-acetate, CAS# 13051-29-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-Propanediol,2,2-bis[(nitrooxy)methyl]-, 1-nitrate, CAS# 1607-17-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-Propanediol,2,2-bis[[(aminocarbonyl)oxy]methyl]-, 1,3-dicarbamate, CAS# 24794-44-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Propanediol,2-[[(2-hydroxy-3-methoxyphenyl)methylene]amino]-2-(hydroxymethyl)-, CAS# 19028-75-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-Propanediol,2-[[(2-hydroxyphenyl)methylene]amino]-2-methyl-, CAS# 18278-95-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-Propanediol,2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-2-methyl-, CAS# 368886-41-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.1 KG, Storage conditions at room temperature.

1,3-Propanediol,2-[1-(5,6-dichloro-1H-benzimidazol-1-yl)-2-hydroxyethoxy]-, (R)-, CAS# 91649-70-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,3-Propanediol,2-[2-(2-amino-9H-purin-9-yl)ethyl]-, 1,3-dipropanoate, CAS# 104227-90-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.

1,3-Propanediol,2-amino-1-[4-(methylsulfonyl)phenyl]-, [S-(R*,R*)]- (9CI), CAS# 51591-89-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-Propanediol,2-butyl-2-(hydroxymethyl)-, CAS# 4704-89-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.4 KG, Storage conditions at room temperature.

1,3-Propanediol,2-hexyl-2-(hydroxymethyl)-, CAS# 4780-31-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-Propanediol,2-methyl-2-propyl-, 1,3-dinitrate, CAS# 10605-24-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-Propanedione, 1-(1-naphthalenyl)-3-phenyl-, CAS# 73981-95-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,3-Propanedione, 1-(2-hydroxy-5-methylphenyl)-3-(4-nitrophenyl)-, CAS# 106149-34-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.4 KG, Storage conditions at room temperature.

1,3-Propanedione, 1-(2-hydroxyphenyl)-3-(3-nitrophenyl)-, CAS# 109899-85-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.2 KG, Storage conditions at room temperature.

1,3-Propanedione, 1,1'-(1,4-phenylene)bis[3-phenyl-, CAS# 7488-30-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-Propanedione, 2-(4-methylphenyl)-1,3-diphenyl-, CAS# 71597-70-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.6 KG, Storage conditions at room temperature.

1,3-Propanedione, 2-[amino(phenylamino)methylene]-1,3-diphenyl-, CAS# 114688-21-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-Propanedione, 2-fluoro-1,3-diphenyl-, CAS# 109801-24-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,3-Propanedione,1-(2-hydroxy-3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)-, CAS# 119858-10-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Propanedione,1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-methoxyphenyl)-, CAS# 76288-41-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-Propanedione,1-(4-methoxyphenyl)-2,2-dimethyl-3-phenyl-, CAS# 71591-81-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-Propanedione,1,3-bis(2,4-difluorophenyl)-, CAS# 142472-18-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-Propanedione,1,3-di-2-thienyl-, CAS# 1138-14-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,3-Propanedione,2-(acetyloxy)-1,3-diphenyl-, CAS# 13054-83-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.3 KG, Storage conditions at room temperature.

1,3-Propanedione,2-methyl-1,3-diphenyl-, CAS# 1846-29-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,3-Propanedione,2-p-anisoyl-1,3-diphenyl- (6CI), CAS# 111473-17-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 5 KG, Storage conditions at room temperature.

1,3-PROPANEDISULFONYL CHLORIDE, CAS# 20686-91-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,3-Propanedithiol diethyl ether, CAS# 33672-52-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,3-Propanediyl Bismethanethiosulfonate, CAS# 55-96-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,3-propanediyl dilaurate, CAS# 26719-54-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.2 KG, Storage conditions at room temperature.

1,3-propylenbis(phosphonic acid), CAS# 4671-82-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,3-Propylenebismelamine, CAS# 89352-30-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,3-PROPYLENEBISSTEARAMIDE, CAS# 29417-02-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,3-propylenebisurea, CAS# 1374445, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-propylenephosphoric acid, CAS# 13507-10-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,3-Pyrrolidinedicarboxylic acid, 2-oxo-, 1-(1,1-dimethylethyl) 3-ethylester, CAS# 188528-95-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,3-Pyrrolidinedicarboxylic acid, 2-oxo-, 1-(1,1-dimethylethyl)3-(phenylmethyl) ester, CAS# 193264-88-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.3 KG, Storage conditions at room temperature.

1,3-Thiaselenole-2-thione,5-phenyl-, CAS# 1128-52-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,3-Thiazino[6,5-b]indole,4,9-dihydro-2-(methylthio)-, CAS# 105748-58-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,3-thiazol-2-ylsulfamic acid, CAS# 87198-68-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,3-trans-dibromocyclohexane, CAS# 29624-17-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.2 KG, Storage conditions at room temperature.

1,3-Xylyl-15-crown-4 ether, CAS# 57624-50-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,4 - Anhydroerythritol, CAS# 81313-42-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.8 KG, Storage conditions at room temperature.

1,4 - Bis(dicyanomethylene)cyclohexane, CAS# 1518-15-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.7 KG, Storage conditions at room temperature.

1,4 - Diazocane - 5,8 - dione, CAS# 57531-01-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,4(2H)-Pyridinedicarboxylic acid, 3,6-dihydro-, 1-(1-chloroethyl) 4-ethylester, CAS# 824981-92-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,4-(bis-3-sulfopropyloxy)benzene, CAS# 540759-86-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.4 KG, Storage conditions at room temperature.

1,4-(phenylenedioxy)-4,4'-bisbenzaldehyde, CAS# 126026-43-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,4-(Z,Z)-bis-propenyloxy-butane, CAS# 3329-71-3, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,4,10,13-Tetraoxa-7,16-diazacyclooctadecane, 7,16-diacetyl-, CAS# 105400-12-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.9 KG, Storage conditions at room temperature.

1,4,10,13-Tetraoxa-7,16-diazacyclooctadecane, 7,16-dihexyl-, CAS# 105400-00-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.3 KG, Storage conditions at room temperature.

1,4,10,13-Tetraoxa-7,16-diazacyclooctadecane,7-(9-anthracenylmethyl)-, CAS# 245415-89-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.6 KG, Storage conditions at room temperature.

1,4,10,13-Tetraoxa-7,16-diazacyclooctadecane,7,16-bis(2-pyridinylmethyl)-, CAS# 103837-13-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,4,10,13-Tetraoxa-7,16-diazacyclooctadecane,7,16-bis(methoxyacetyl)-, CAS# 93000-68-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.9 KG, Storage conditions at room temperature.

1,4,10,13-Tetraoxa-7,16-diazacyclooctadecane,7,16-bis(oxiranylmethyl)-, CAS# 124940-67-6, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,4,10,13-Tetraoxa-7,16-diazacyclooctadecane,7,16-bis[(3-nitrophenyl)methyl]-, CAS# 105400-15-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3 KG, Storage conditions at room temperature.

1,4,10,13-Tetraoxa-7,16-diazacyclooctadecane-7,16-diacetic acid,diethyl ester, CAS# 62871-83-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,4,10-trihydroxy-anthrone, CAS# 115374-43-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.5 KG, Storage conditions at room temperature.

1,4,10-Trioxa-7,13-diazacyclopentadecane,7,13-bis(2-pyridinylmethyl)-, CAS# 130985-64-7, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.8 KG, Storage conditions at room temperature.

1,4,10-trioxa-7,13-diaza-cyclopentadecane-8,12-dione, CAS# 30989-20-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.9 KG, Storage conditions at room temperature.

1,4,11,14,17,24,29,36-octaazapentacyclo[12.12.12.2?,?.21?,22.231,3?]tetratetraconta-4,6,8,10,17,19,21,23,29,31,33,35,39,41,43-pentadecaene, CAS# 119142-70-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.9 KG, Storage conditions at room temperature.

1,4,2,6,3,5-Dithiadiazadiborine,tetrahydro-3,5-dimethyl-2,6-bis(trimethylsilyl)-, CAS# 94397-69-0, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.5 KG, Storage conditions at room temperature.

1,4,2-Diazaphospholidin-5-one,3-(4-hydroxy-3-methoxyphenyl)-1,4-dimethyl-2-phenoxy-, 2-oxide, CAS# 57848-27-8, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.8 KG, Storage conditions at room temperature.

1,4,2-Diazaphospholo[4,5-a]pyridine, CAS# 107700-34-5, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.7 KG, Storage conditions at room temperature.

1,4,2-Dioxaphosphepane, 2-(2-chloroethoxy)-, 2-oxide, CAS# 74858-28-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4.6 KG, Storage conditions at room temperature.

1,4,2-Dioxazole-5-acetic acid, 5-(methoxycarbonyl)-3-phenyl-, methylester, CAS# 41931-34-4, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,4,4 A,8 A-TETRAHYDRO-ENDO-1,4-METHANONAPHTHALENE-5,8-DIONE, CAS# 1200-89-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.7 KG, Storage conditions at room temperature.

1,4,4a,5,8,8a-hexahydronaphthalene-cis-4a,8a-dicarboxylic acid, CAS# 636348, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 3.3 KG, Storage conditions at room temperature.

1,4,4a,8a-tetrahydro-1,4-methanonaphthalene-5,8-dione, CAS# 54353-48-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2 KG, Storage conditions at room temperature.

1,4,4a,9a-tetrahydro-2,3-dimethylanthracene-9,10-dione, CAS# 55538-11-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.5 KG, Storage conditions at room temperature.

1,4,4a,9a-tetrahydroanthracene-9,10-dione, CAS# 56136-14-2, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.4 KG, Storage conditions at room temperature.

1,4,4-trimethoxy-but-3-en-2-one, CAS# 65120-62-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 2.2 KG, Storage conditions at room temperature.

1,4,4-trimethyl-2,3,3a,4,5,6-hexahydro-1H-indol-2-one, CAS# 1431464-21-9, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.6 KG, Storage conditions at room temperature.

1,4,4-trimethyl-2-cyclohexen-1-ol, CAS# 60934-84-1, White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 4 KG, Storage conditions at room temperature.

1,4,4-trimethyl-2-oxocyclopentane-1-carbaldehyde, CAS# , White powder, HPLC99%+ , HNMR, MS, COA, MSDS, MOA, ROS is ok, stock more than 1.1 KG, Storage conditions at room temperature.