EOS Med Chem is world TOP CMO and Impurity supplier, until 2020,7, we have more than 150000 impurity, customers include: TCI, TRC, TLC, SIGMA and so on.
R&D Center: 8000 sq, More than 100 hoods
Pilot Plant: 20000sq, 40 reactors from 5-200L
Manufacturing Site: 800000sq, 40 reactors from 100-5000L
Web: www.eosmedchem.com
Email: info@eosmedchem.com; eosmedchem@gmail.com(few time open)
This is my R&D youtube: https://youtu.be/r5cJdXKNXHk
R&D Center: 8000 sq, More than 100 hoods
Pilot Plant: 20000sq, 40 reactors from 5-200L
Manufacturing Site: 800000sq, 40 reactors from 100-5000L
Web: www.eosmedchem.com
Email: info@eosmedchem.com; eosmedchem@gmail.com(few time open)
This is my R&D youtube: https://youtu.be/r5cJdXKNXHk
| N2,N6-Bis[(phenylmethoxy)carbonyl]-L-lysyl]glycine1,1-DimethylethylEster, cas: , stock 16.7g, assay 97%, molecular formula: C₂₈H₃₇N₃O₇, molecular weight: . |
| N2,N6-Diacetyl-DL-Lysine, cas: 35436-74-9, stock 37.1g, assay 97.8%, molecular formula: C10H18N2O4, molecular weight: 230.26. |
| N2,N6-diacetyl-DL-Lysine, cas: N/A, stock 42g, assay 98.7%, molecular formula: C9H13F2N2O14P3, molecular weight: 504.12. |
| N2,N6-Di-CbzAvizafone, cas: 60067-14-3, stock 23.4g, assay 98.9%, molecular formula: C₃₈H₃₉ClN₄O₇, molecular weight: . |
| N2-[(2R)-4-(Hydroxyamino)-2-(2-naphthalenylmethyl)-1,4-dioxobutyl]-L-arginyl-L-tryptophyl-L-α-glutamine, cas: 1093740-12-5, stock 19.9g, assay 95.8%, molecular formula: C₃₇H₄₅N₉O₈, molecular weight: . |
| N2-[(2R)-4-[(1,1-Dimethylethoxy)amino]-2-(2-naphthalenylmethyl)-1,4-dioxobutyl]-N5-[[[2,3-dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl]sulfonyl]amino]iminoethyl-L-ornithine, cas: 1093740-20-5, stock 45.7g, assay 96.1%, molecular formula: C₃₈H₅₁N₅O₈S, molecular weight: . |
| N-2-[(Dimethylamino)methylene]aminoPemetrexed, cas: 1265908-58-4, stock 11.9g, assay 98.8%, molecular formula: C₂₃H₂₆N₆O₆, molecular weight: . |
| N2-[(Phenylmethoxy)carbonyl]-L-glutamine, cas: 2650-64-8, stock 42.4g, assay 96.3%, molecular formula: C₁₃H₁₆N₂O₅, molecular weight: . |
| N2-[(Phenylmethoxy)carbonyl]-L-glutamineMethylEster-13C5, cas: , stock 15.9g, assay 97.9%, molecular formula: C₉¹³C₅H₁₈N₂O₅, molecular weight: . |
| N2-[(Phenylmethoxy)carbonyl]-L-glutamine-13C5, cas: , stock 29.9g, assay 95.7%, molecular formula: C₈¹³C₅H₁₆N₂O₅, molecular weight: . |
| N2-[(Phenylmethoxy)carbonyl]-L-lysine-phenylmethylEsterBenzensulfonicAcid, cas: , stock 47.5g, assay 98.5%, molecular formula: C₂₁H₂₆N₂O₄ • C ₆H₆O₃S, molecular weight: . |
| N2-[4-(Diethylamino)butyl]-6-(3,5-dimethoxyphenyl)-pyrido[2,3-d]pyrimidine-2,7-diamine, cas: 862370-79-4, stock 30.3g, assay 97.1%, molecular formula: C₂₃H₃₂N₆O₂, molecular weight: . |
| N2-[4-[[(2,4-Diamino-6-pteridinyl)methyl]methylamino]benzoyl]-N-[5-[[(1,1-dimethylethoxy)carbonyl]amino]pentyl]-L-glutamine1,1’-DimethylethylEster, cas: 1637756-15-0, stock 26.5g, assay 98.5%, molecular formula: C₃₄H₅₀N₁₀O₆, molecular weight: . |
| N2’,N2’’’-[Dithiobis(1-oxo-3,1-propanediyl)]bis[N2’-deacetyl-maytansine, cas: 905449-88-9, stock 39.7g, assay 98%, molecular formula: C₇₀H₉₄Cl₂N₆O₂₀S₂, molecular weight: . |
| N2’-Deacetyl-N2’-(4-mercapto-4-methyl-1-oxopentyl)-maytansine, cas: 796073-69-3, stock 35.6g, assay 97.5%, molecular formula: C₃₈H₅₄ClN₃O₁₀S, molecular weight: . |
| N2’-Deacetyl-N2’-(4-methyl-4-methylthio-1-oxopentyl)maytansine, cas: 890654-03-2, stock 25g, assay 98.9%, molecular formula: C₃₉H₅₆ClN₃O₁₀S, molecular weight: . |
| N2’-Deacetyl-N2’-(4-methyl-4-methylthio-1-oxopentyl)maytansine-d3, cas: , stock 37.8g, assay 97.6%, molecular formula: C₃₉H₅₃D₃ClN₃O₁₀S, molecular weight: . |
| N2’-Deacetyl-N2’-[3-(methylthio)-1-oxopropyl]-maytansine, cas: 912569-84-7, stock 24.9g, assay 95.3%, molecular formula: C₃₆H₅₀ClN₃O₁₀S, molecular weight: . |
| N2’-Deacetyl-N2’-[3-(methylthio)-1-oxopropyl]-maytansine-d3, cas: , stock 42g, assay 97.5%, molecular formula: C₃₆H₄₇D₃ClN₃O₁₀S, molecular weight: . |
| N2’-Deacetyl-N2’-[3-[(1-ethyl-2,5-dioxo-3-pyrrolidinyl)thio]-1-oxopropyl]-maytansine, cas: 1343477-01-9, stock 44.8g, assay 97.3%, molecular formula: C₄₁H₅₅ClN₄O₁₂S, molecular weight: . |
| N2’-Deacetyl-N2’-[3-[(1-ethyl-2,5-dioxo-3-pyrrolidinyl)thio]-1-oxopropyl]-maytansine-d5, cas: , stock 18.6g, assay 95.2%, molecular formula: C₄₁H₅₀D₅ClN₄O₁₂S, molecular weight: . |
| N2-Ac-DL-Lysine, cas: N/A, stock 29.7g, assay 95.9%, molecular formula: C9H10F2N2O5, molecular weight: 264.19. |
| N2-AcetylAcyclovirBenzoate, cas: 133186-23-9, stock 47.9g, assay 97.3%, molecular formula: C₁₇H₁₇N₅O₅, molecular weight: . |
| N2-AcetylAcyclovirBenzoate-d4, cas: , stock 16.5g, assay 97.6%, molecular formula: C₁₇H₁₃D₄N₅O₅, molecular weight: . |
| N2-AcetylAcyclovirBenzoate-d5, cas: , stock 47.4g, assay 99%, molecular formula: C₁₇H₁₂D₅N₅O₅, molecular weight: . |
| N2-AcetylAcyclovirMethylAcetate, cas: , stock 38.2g, assay 96.2%, molecular formula: C₁₃H₁₇N₅O₆, molecular weight: . |
| N2-AcetylAcyclovir-d4, cas: , stock 13g, assay 95.3%, molecular formula: C₁₀H₉D₄N₅O₄, molecular weight: . |
| N2-Acetylguanine, cas: 19962-37-9, stock 40.5g, assay 97.1%, molecular formula: C₇H₇N₅O₂, molecular weight: . |
| N2-Acetyl-N5-[(phenylmethoxy)carbonyl]-L-ornithine, cas: 35515-72-1, stock 33.3g, assay 98.9%, molecular formula: C₁₅H₂₀N₂O₅, molecular weight: . |
| N2-Acetyl-O6-diphenylcarbamoylguanine, cas: 112233-74-6, stock 30g, assay 95.5%, molecular formula: C₂₀H₁₆N₆O₃, molecular weight: . |
| N2-Acetyl-O6-diphenylcarbamoylguanine-13C2,15N, cas: , stock 44.6g, assay 96.2%, molecular formula: C₁₈¹³C₂H₁₆N₅¹⁵NO₃, molecular weight: . |
| N2-Benzoyl-5’-O-(4,4-dimethoxytrity1)-2’-O-(tert-butyldimethylsilyl)6-chloroguanosine3’-O-(2-CyanoethylN,N-diisopropylphosphoramidite), cas: , stock 33.6g, assay 99%, molecular formula: C₅₃H₆₅ClN₇O₈PSi, molecular weight: . |
| N2-Benzoylguanosine, cas: 3676-72-0, stock 10.9g, assay 95.2%, molecular formula: C₁₇H₁₇N₅O₆, molecular weight: . |
| N2-Benzyl-2-deoxyguanosineCEP, cas: 209785-74-0, stock 27.1g, assay 95.5%, molecular formula: C₄₇H₅₄N₇O₇P, molecular weight: . |
| N2-Benzyloxycarbonyl-L-homoglutamine, cas: 83793-19-5, stock 19.2g, assay 96.4%, molecular formula: C₁₄H₁₈N₂O₅, molecular weight: . |
| N-2-BenzyloxyphenylIsobutyrylacetamide, cas: 265989-31-9, stock 11.1g, assay 98.6%, molecular formula: C₁₉H₂₁NO₃, molecular weight: . |
| N-2-Benzyloxyphenylα-BenzilideneIsobutyrylacetamide, cas: 163217-77-4, stock 31.4g, assay 98.9%, molecular formula: C₂₆H₂₅NO₃, molecular weight: . |
| N-2-Benzyloxyphenylα-Benzilidene-d5Isobutyrylacetamide, cas: 1020719-18-9, stock 33g, assay 95.3%, molecular formula: C₂₆H₂₀D₅NO₃, molecular weight: . |
| N2-Boc-D-glutamine, cas: 61348-28-5, stock 34.9g, assay 98.3%, molecular formula: C₁₀H₁₈N₂O₅, molecular weight: . |
| N2-Carboxy-N-(carboxymethyl)asparagineTribenzylEster, cas: 68802-36-8, stock 20.6g, assay 96.4%, molecular formula: C₂₈H₂₈N₂O₇, molecular weight: . |
| N2-Cbz-D-glutamine, cas: 13139-52-1, stock 36.6g, assay 96.9%, molecular formula: C₁₃H₁₆N₂O₅, molecular weight: . |
| N2-Cyclopropyl-4-methyl-2,3-pyridinediamine, cas: 284686-18-6, stock 48.3g, assay 96.5%, molecular formula: C₉H₁₃N₃, molecular weight: . |
| N2-Decanoyl-L-glutamine, cas: 26060-95-7, stock 47.7g, assay 95.8%, molecular formula: C₁₅H₂₈N₂O₄, molecular weight: . |
| N2-Des(L-valinyl)LopinavirN2,O5-Oxazine, cas: , stock 28.1g, assay 98.4%, molecular formula: C₂₉H₃₂N₂O₄, molecular weight: . |
| N2-Des(L-valinyl)LopinavirN2,O5-Oxazine-d9, cas: , stock 41.9g, assay 95.9%, molecular formula: C₂₉H₂₃D₉N₂O₄, molecular weight: . |
| N2-Des(L-valinyl)N2-AcetylLopinavir, cas: , stock 20.8g, assay 95.2%, molecular formula: C₃₀H₃₆N₂O₄, molecular weight: . |
| N2-Des(L-valinyl)N2-AcetylLopinavir-d3, cas: , stock 33.9g, assay 99%, molecular formula: C₃₀H₃₃D₃N₂O₄, molecular weight: . |
| N2-Des(L-valinyl)N2-AcetylLopinavir-d9, cas: , stock 21.3g, assay 96.2%, molecular formula: C₃₀H₂₇D₉N₂O₄, molecular weight: . |
| N2-Des(L-valinyl)N2-FormalLopinavir, cas: , stock 32.4g, assay 97%, molecular formula: C₂₉H₃₄N₂O₄, molecular weight: . |
| N2-Des(L-valinyl)N2-FormalLopinavir-d9, cas: , stock 42.9g, assay 98.9%, molecular formula: C₂₉H₂₅D₉N₂O₄, molecular weight: . |
| N-2-DesmethylRopivacaine-d5, cas: , stock 45.2g, assay 97.2%, molecular formula: C₁₆H₁₉D₅N₂O, molecular weight: . |
| N2-DL-Lysyl-DL-Lysine, cas: N/A, stock 46.4g, assay 95.9%, molecular formula: C9H11F2N2O8P, molecular weight: 344.16. |
| N2-Ethyl-6-(methylthio)-1,3,5-triazine-2,4-diamine(GS11355), cas: 4147-58-4, stock 15.7g, assay 98.8%, molecular formula: C6H11N5S, molecular weight: 185.25. |
| N-2-EthylhexanoylCloxacillnAcid, cas: , stock 32.6g, assay 97.5%, molecular formula: C₂₇H₃₃ClN₃NaO₇S, molecular weight: . |
| N-2-Fluorophenyl4-boronobenzamide, cas: 874288-06-9, stock 38.1g, assay 95.7%, molecular formula: C₁₃H₁₁BFNO₃, molecular weight: . |
| N2-Fmoc-D-glutamine, cas: 112898-00-7, stock 29g, assay 97.2%, molecular formula: C₂₀H₂₀N₂O₅, molecular weight: . |
| N2-Fmoc-L-glutamine, cas: 71989-20-3, stock 37.6g, assay 95.9%, molecular formula: C₂₀H₂₀N₂O₅, molecular weight: . |
| N-2-Hydroxy-3-[[2-(methoxyphenoxy)ethyl]amineCarvedilol-d5, cas: , stock 48.9g, assay 98.8%, molecular formula: C₃₆H₃₈D₅N₃O₇, molecular weight: . |
| N-2-Hydroxyethyl-N-(methyl-d3)-p-toluenesulfonamide, cas: 854634-39-2, stock 23.5g, assay 97%, molecular formula: C₁₀H₁₂D₃NO₃S, molecular weight: . |
| N-2-Hydroxyethyl-N-methyl-p-toluenesulfonamide, cas: 59724-61-7, stock 31.1g, assay 98.6%, molecular formula: C₁₀H₁₅NO₃S, molecular weight: . |
| N2-Isobutyl-2’-deoxyguanosine, cas: 142554-22-1, stock 49.9g, assay 98.5%, molecular formula: C₁₄H₂₁N₅O₄, molecular weight: . |
| N2-Lauroyl-L-glutamine, cas: 109570-04-9, stock 33.2g, assay 96.5%, molecular formula: C₁₇H₃₂N₂O₄, molecular weight: . |
| N2-Lauroyl-L-glutamine-d23, cas: 1795786-88-7, stock 32.7g, assay 95.1%, molecular formula: C₁₇H₉D₂₃N₂O₄, molecular weight: . |
| N2-L-Lysyl-L-LysineTrifluoroacetate, cas: N/A, stock 30.5g, assay 97.7%, molecular formula: 13C 14N2 C8H12F2NO7P, molecular weight: 344.16. |
| N2-L-Lysyl-L-Lysine(tri-Boc), cas: N/A, stock 41.6g, assay 98.8%, molecular formula: 13C 15N2 C8H14F2NO13P3 3 C6H15N, molecular weight: 506.12 3 101.19. |
| N2-MethylAlfuzosin, cas: 98902-34-2, stock 32.9g, assay 96.5%, molecular formula: C₁₉H₂₇N₅O₄, molecular weight: . |
| N2-MethylAlfuzosinDestetrahydrofuran-2-carbaldehydeHydrochloride, cas: , stock 13.1g, assay 95.7%, molecular formula: C₁₄H₂₁N₅O₂•x(HCl), molecular weight: . |
| N2-MethylAlfuzosin-d7Hydrochloride, cas: 1346601-27-1, stock 42.1g, assay 96.9%, molecular formula: C₁₉H₂₁D₇ClN₅O₄, molecular weight: . |
| N2-MethylCarvedilol, cas: 72956-35-5, stock 19.1g, assay 96.4%, molecular formula: C₂₅H₂₈N₂O₄, molecular weight: . |
| N2-MethylTrimethoprim-D3(Impurity), cas: , stock 24.6g, assay 97%, molecular formula: C₁₅H₁₇D₃N₄O₃, molecular weight: . |
| N2-Methylamino-5-Methyl-TetrahydrofolicAcid(DiMeTHFA), cas: N/A；, stock 31.3g, assay 97.4%, molecular formula: C21H29N7O6, molecular weight: 475.51. |
| N-2-Naphthalenyl-1-pentyl-1H-indole-3-carboxamide, cas: 1338925-12-4, stock 49.5g, assay 96.9%, molecular formula: C₂₄H₂₄N₂O, molecular weight: . |
| N-2-Naphthalenyl-glycine2-[(3,5-Dibromo-2,4-dihydroxyphenyl)methylene]hydrazide, cas: 328541-79-3, stock 28.1g, assay 97.3%, molecular formula: C₁₉H₁₅Br₂N₃O₃, molecular weight: . |
| N-2-Naphthalenyl-L-leucine, cas: 99631-79-5, stock 35.9g, assay 98.9%, molecular formula: C₁₆H₁₉NO₂, molecular weight: . |
| N-2-Nitrophenylsulfenyl-L-alanineDicyclohexylammoniumSalt, cas: 7675-46-9, stock 16.6g, assay 96.6%, molecular formula: C₉H₁₀N₂O₄S • C₁₂H₂₃N, molecular weight: . |
| N-2-Nitrophenylsulfenyl-L-isoleucineDicyclohexylammoniumSalt, cas: 10382-52-2, stock 20.1g, assay 96.7%, molecular formula: C₁₂H₁₆N₂O₄S • C₁₂H₂₃N, molecular weight: . |
| N-2-Nitrophenylsulfenyl-L-valineDicyclohexylammoniumSalt, cas: 7675-57-2, stock 16.1g, assay 96.1%, molecular formula: C₁₁H₁₄N₂O₄S.C₁₂H₂₃N, molecular weight: . |
| N2-PhenoxyacetylGuanine, cas: 144782-23-0, stock 39.9g, assay 97.6%, molecular formula: C₁₃H₁₁N₅O₃, molecular weight: . |
| N2-Pivaloylguanine, cas: 136675-82-6, stock 28.5g, assay 96%, molecular formula: C₁₀H₁₃N₅O₂, molecular weight: . |
| N-2-Propen-1-yl-9H-purin-6-amineHydrobromide, cas: 1797133-49-3, stock 31.8g, assay 96.3%, molecular formula: C₈H₁₀BrN₅, molecular weight: . |
| N-2-PropynylRasagilineHCl, cas: 1458609-07-8, stock 48.2g, assay 96.5%, molecular formula: C15H15N. HCl, molecular weight: 209.29 36.46. |
| N-2-PropynylRasagilineHCl, cas: N/A, stock 26.7g, assay 99%, molecular formula: C22H34N2O5S. HCl, molecular weight: 438.58 36.46. |
| N-2-PropynylRasagilineHydrochloride, cas: 10409-00-4, stock 48.8g, assay 96%, molecular formula: C₁₅H₁₆ClN, molecular weight: . |
| N-2-Pyridinyl-(1,2-ethanediamine-d4), cas: , stock 39.2g, assay 96.3%, molecular formula: C₇H₇D₄N₃, molecular weight: . |
| N-2-Pyridinyl-1,2-ethanediamine, cas: 74764-17-3, stock 39.1g, assay 97.6%, molecular formula: C₇H₁₁N₃, molecular weight: . |
| N-2-Pyridinyl-β-alanine, cas: 104961-64-0, stock 45.5g, assay 96.9%, molecular formula: C₈H₁₀N₂O₂, molecular weight: . |
| N2-t-Boc-N6-(biotinamido-6-N-caproylamido)lysine, cas: 102910-26-9, stock 15.7g, assay 97.4%, molecular formula: C₂₇H₄₇N₅O₇S, molecular weight: . |
| N2-t-Boc-N6-(biotinamido-6-N-caproylamido)lysineN-HydroxysuccinimideEster, cas: 102910-27-0, stock 33.9g, assay 95.1%, molecular formula: C₃₁H₅₀N₆O₉S, molecular weight: . |
| N2-t-Boc-N6-(biotinamido-6-N-caproylamido)lysinylamidoethaneMethanethiosulfonate, cas: , stock 13g, assay 97.6%, molecular formula: C₃₀H₅₄N₆O₈S₃, molecular weight: . |
| N2-Tritylent-Valsartan, cas: , stock 40.4g, assay 96.1%, molecular formula: C₄₃H₄₃N₅O₃, molecular weight: . |
| N2-TritylValsartanBenzylEster-d9, cas: , stock 27.8g, assay 97.7%, molecular formula: C₅₀H₄₀D₉N₅O₃, molecular weight: . |
| N2-Trityl-ValsartanBenzylEster, cas: , stock 25.9g, assay 96.8%, molecular formula: C₅₀H₄₉N₅O₃, molecular weight: . |
| N3-(3-Dimethylamino,1-carboxyprop-2-yl)Afatinib, cas: , stock 20.5g, assay 97.2%, molecular formula: C₃₀H₃₆ClFN₆O₅, molecular weight: . |
| N3-(DL-trans-Carbamoyloxirane-2-carbonyl)-L-2,3-diaminopropanoicAcidTrifluoroacetate, cas: 168751-69-7, stock 32.8g, assay 96.3%, molecular formula: C₇H₁₁N₃O₅ • ( C₂HF₃O₂), molecular weight: . |
| N3-(D-trans-Carbamoyloxirane-2-carbonyl)-L-2,3-diaminopropanoicAcidTrifluoroacetate, cas: 168751-70-0, stock 22.8g, assay 97.2%, molecular formula: C₇H₁₁N₃O₅ • ( C₂HF₃O₂), molecular weight: . |
| N3-(L-trans-Carbamoyloxirane-2-carbonyl)-L-2,3-diaminopropanoicAcidTrifluoroacetate, cas: 168957-74-2, stock 36.2g, assay 96.2%, molecular formula: C₇H₁₁N₃O₅ • ( C₂HF₃O₂), molecular weight: . |
| N-3-(Sulfopropyl)-3-methoxy-5-methylaniline, cas: 766502-50-5, stock 28.3g, assay 96.8%, molecular formula: C₁₁H₁₇NO₄S, molecular weight: . |
| N3-EthylthiosulfonylmethylLumiflavin, cas: , stock 30.2g, assay 97.2%, molecular formula: C₁₆H₁₈N₄O₄S₂, molecular weight: . |
| N-3-Fluorophenyl4-boronobenzamide, cas: 874288-05-8, stock 25.9g, assay 95.4%, molecular formula: C₁₃H₁₁BFNO₃, molecular weight: . |
| N3-Methylthymidine, cas: 958-74-7, stock 37g, assay 95.6%, molecular formula: C₁₁H₁₆N₂O₅, molecular weight: . |
| N-3-OxobutylLinezolid, cas: , stock 42.2g, assay 95.3%, molecular formula: C₂₀H₂₆FN₃O₅, molecular weight: . |
| N-3-PiperidinylcarbamicAcid1,1-DimethylethylEster, cas: 172603-05-3, stock 29.6g, assay 97.6%, molecular formula: C₁₀H₂₀N₂O₂, molecular weight: . |
| N-4-(1-Pyrene)butyroylglycine, cas: 228414-55-9, stock 44.8g, assay 95.9%, molecular formula: C₂₂H₁₉NO₃, molecular weight: . |
| N-4-(1-Pyrene)butyroylglycylglycyl-L-phenylalanine, cas: 228414-53-7, stock 43.3g, assay 95%, molecular formula: C₃₃H₃₁N₃O₅, molecular weight: . |
| N-4-(1-Pyrene)butyroylglycyl-L-phenylalanine, cas: 228414-52-6, stock 21.9g, assay 98.4%, molecular formula: C₃₁H₂₈N₂O₄, molecular weight: . |
| N-4-(1-Pyrene)butyroyl-L-phenylalanineEthylEster, cas: 1331912-17-4, stock 29.3g, assay 99%, molecular formula: C₃₁H₂₉NO₃, molecular weight: . |
| N4-(2-Bromoethyl)-3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxamide, cas: 218456-06-5, stock 33.1g, assay 95.2%, molecular formula: C₁₃H₁₁N₂O₂Cl₂Br, molecular weight: . |
| N4-(3-Aminophenyl)-5-fluoro-n2-(4-(2-methoxyethoxy)phenyl)pyrimidine-2,4-diamineHydrochloride, cas: 2044706-73-0, stock 27.8g, assay 96.8%, molecular formula: C₁₉H₂₀N₅O₂F • HCl, molecular weight: . |
| N-4-(7-Chloroquinolinyl)-N’-3-[4-(7-Chloroquinolinyl)]-1-piperazinyl]-1-propylethylenediamine, cas: , stock 21.2g, assay 98.8%, molecular formula: C₂₇H₃₀Cl₂N₆, molecular weight: . |
| N4,3’,5’-Tribenzoyl,2’-deoxy-2’β-fluoro-2’C-α-methylCytidine, cas: , stock 13.6g, assay 96.8%, molecular formula: C₃₁H₂₆FN₃O₇, molecular weight: . |
| N-4,5-DimethylCytosine, cas: , stock 37.6g, assay 96.7%, molecular formula: C₇H₁₁N₃O, molecular weight: . |
| N4,N4’-Bis(2,6-dichlorophenyl)-[1,1’-biphenyl]-4,4’-diamine, cas: , stock 27.2g, assay 96.9%, molecular formula: C₂₄H₁₆Cl₄N₂, molecular weight: . |
| N4,N4’-Bis(2,6-dichlorophenyl)-3,3’-dimethyl-[1,1’-biphenyl]-4,4’-diamine, cas: , stock 20.6g, assay 95.9%, molecular formula: C₂₆H₂₀Cl₄N₂, molecular weight: . |
| N4,N6-Bis((1R,2S)-2-(3,4-difluorophenyl)cyclopropyl)-5-nitro-2-(propylthio)pyrimidine-4,6-diamine, cas: , stock 20g, assay 96.6%, molecular formula: C₂₅H₂₃F₄N₅O₂S, molecular weight: . |
| N4,Nα,Nα,Nε,Nε-[Pentakis(carboxymethyl)]-N4-(carboxymethyl)-2,6-diamino-4-azahexanoicHydrazide, cas: 412334-17-9, stock 11.5g, assay 97.5%, molecular formula: C₁₅H₂₅N₅O₁₁, molecular weight: . |
| N4.5-[(acetylamino)methyl]-DesmopressinEPImpurityF, cas: N/A, stock 32g, assay 98.6%, molecular formula: C29H27F3N6O2, molecular weight: 548.57. |
| N4-[(4-Fluorophenyl)methyl]-2-nitro-1,4-benzenediamine, cas: 150812-21-8, stock 48.4g, assay 95.4%, molecular formula: C₁₃H₁₂FN₃O₂, molecular weight: . |
| N4-[(4-Fluorophenyl)methyl]-2-nitro-1,4-benzenediamine-d4, cas: , stock 39.3g, assay 97%, molecular formula: C₁₃H₈D₄FN₃O₂, molecular weight: . |
| N4-[(Dimethylamino)methylidene]-5-[3-oxo-[[6-[(trifluoroacetyl)amino]hexyl]amino]-1-propenyl]-2’-deoxycytidine, cas: , stock 31.7g, assay 95.3%, molecular formula: C₂₃H₃₃F₃N₆O₆, molecular weight: . |
| N-4-Acetamidophenylsulfonylglycine, cas: 23776-98-9, stock 23.8g, assay 97%, molecular formula: C₁₀H₁₂N₂O₅S, molecular weight: . |
| N4-Acetylcytosine, cas: 14631-20-0, stock 24.7g, assay 95.8%, molecular formula: C₆H₇N₃O₂, molecular weight: . |
| N4-Benzoyl-2’-O-methylcytidine, cas: 52571-45-6, stock 44.7g, assay 95.8%, molecular formula: C₁₇H₁₉N₃O₆, molecular weight: . |
| N4-Benzoyl-5-(furan-2-yl)-2’-deoxycytidine, cas: 1119734-59-6, stock 37.8g, assay 98.7%, molecular formula: C₂₀H₁₉N₃O₆, molecular weight: . |
| N4-Benzoylcytosine, cas: 26661-13-2, stock 48.2g, assay 97.9%, molecular formula: C₁₁H₉N₃O₂, molecular weight: . |
| N-4-BenzyloxyphenylIsobutyrylacetamide, cas: 265989-30-8, stock 33.1g, assay 95.8%, molecular formula: C₁₉H₂₁NO₃, molecular weight: . |
| N-4-Benzyloxyphenylα-BenzilideneIsobutyrylacetamide, cas: 163217-66-1, stock 22.1g, assay 98.7%, molecular formula: C₂₆H₂₅NO₃, molecular weight: . |
| N-4-Benzyloxyphenylα-Benzilidene-d5Isobutyrylacetamide, cas: 1020719-20-3, stock 33.2g, assay 97%, molecular formula: C₂₆H₂₀D₅NO₃, molecular weight: . |
| N-4-Biphenylyl-beta-alanine, cas: 144653-45-2, stock 47.3g, assay 95.2%, molecular formula: C₁₅H₁₅NO₂, molecular weight: . |
| N-4-Boc-N-1-Cbz-2-piperazineCarboxylicAcid, cas: 126937-41-5, stock 23.1g, assay 96.3%, molecular formula: C₁₈H₂₄N₂O₆, molecular weight: . |
| N-4-Boc-N-1-Fmoc-2-piperazineAceticAcid, cas: 183742-34-9, stock 43.1g, assay 96.2%, molecular formula: C₂₆H₃₀N₂O₆, molecular weight: . |
| N-4-BOC-N-1-FMOC-2-PIPERAZINECARBOXYLICACID, cas: 183742-23-6, stock 21.4g, assay 98%, molecular formula: C₂₅H₂₈N₂O₆, molecular weight: . |
| N-4-Bromophenyl4-boronobenzamide, cas: 874287-99-7, stock 44.3g, assay 97%, molecular formula: C₁₃H₁₁BBrNO₃, molecular weight: . |
| N4-DesPyrazoloN4-AcetoacetylTeneligliptin, cas: , stock 31.2g, assay 96.6%, molecular formula: C₁₆H₂₆N₄O₃S, molecular weight: . |
| N4-DesPyrazoloN4-AcetoacetylTeneligliptin-d8, cas: , stock 20.3g, assay 98.3%, molecular formula: C₁₆H₁₈D₈N₄O₃S, molecular weight: . |
| N-4-Fluorophenyl-3-(trifluoromethyl)benzamide, cas: 33489-71-3, stock 13.9g, assay 98.6%, molecular formula: C₁₄H₉F₄NO, molecular weight: . |
| N4-Hydroxycytosine, cas: 20555-88-8, stock 11.1g, assay 96.3%, molecular formula: C₄H₅N₃O₂, molecular weight: . |
| N4-HydroxymethylHydrochlorothiazide, cas: 1216599-78-8, stock 28.8g, assay 95.9%, molecular formula: C₈H₁₀ClN₃O₅S₂, molecular weight: . |
| N-4-Hydroxyphenyl-N’-1,2,3-thiadiazol-5-ylurea, cas: 65647-48-5, stock 42.8g, assay 96.4%, molecular formula: C₉H₈N₄O₂S, molecular weight: . |
| N-4-Hydroxyphenyl-N’-1,2,3-thiadiazol-5-ylurea-d4, cas: , stock 39.9g, assay 97.5%, molecular formula: C₉H₄D₄N₄O₂S, molecular weight: . |
| N-4-Methyl-2,4-pyridinediamine, cas: 155617-64-4, stock 36.5g, assay 97.1%, molecular formula: C6H9N3, molecular weight: 123.16. |
| N4-MethyleneZolmitriptan, cas: , stock 40.4g, assay 98.7%, molecular formula: C₁₇H₂₁N₃O₂, molecular weight: . |
| N-4-NitrobenzyloxycarbonylMeropenem-d64-NitrobenzylEster, cas: 1246815-65-5, stock 23.3g, assay 98%, molecular formula: C₃₂H₂₉D₆N₅O₁₁S, molecular weight: . |
| N-4-Phenylα-Benzylidene-d5Isobutyrylacetamide, cas: 222412-73-9, stock 10.9g, assay 97.1%, molecular formula: C₁₉H₁₄D₅NO₂, molecular weight: . |
| N-4-Pyridinyl[1,1’-biphenyl]-4-acetamide, cas: 51484-42-5, stock 13.8g, assay 97.6%, molecular formula: C₁₉H₁₆N₂O, molecular weight: . |
| N-4-Quinazolinylnorvaline, cas: 1008675-41-9, stock 42.2g, assay 95.5%, molecular formula: C₁₃H₁₅N₃O₂, molecular weight: . |
| N4-tert-Butoxycarbonyl-1-[2-(2-hydroxyethoxy)ethyl]piperazineN1-Oxide, cas: 1216684-15-9, stock 27.2g, assay 98.6%, molecular formula: C₁₃H₂₆N₂O₅, molecular weight: . |
| N4-TriazolylTerconazole, cas: , stock 31.5g, assay 97.9%, molecular formula: C₂₆H₃₁Cl₂N₅O₃, molecular weight: . |
| N-5-(2-Carbamoyl)BenzofuranylVilazodone(VilazodoneImpurity), cas: , stock 31.9g, assay 97%, molecular formula: C₃₅H₃₂N₆O₄, molecular weight: . |
| N5.4-[(acetylamino)methyl]-DesmopressinEPImpurityE, cas: N/A, stock 23.8g, assay 98.9%, molecular formula: C11H19N3OS, molecular weight: 241.36. |
| N5-[[[(2,3-Dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl)sulfonyl]amino]iminomethyl]-L-ornithineMethylEsterHydrochloride, cas: 257288-19-0, stock 37.1g, assay 96.1%, molecular formula: C₂₀H₃₃ClN₄O₅S, molecular weight: . |
| N5-Des[(2,6-dimethylphenoxy)acetyl]N5-FormalLopinavir, cas: , stock 19.9g, assay 96%, molecular formula: C₂₈H₃₈N₄O₄, molecular weight: . |
| N5-HydroxylaminoCaspofunginDiacetate, cas: N/A, stock 32.9g, assay 96.7%, molecular formula: C17H16FN6O6P, molecular weight: 450.33. |
| N5-MethylEflornithine, cas: , stock 22.2g, assay 96.7%, molecular formula: C₇H₁₄F₂N₂O₂, molecular weight: . |
| N5-Methyl-d3Eflornithine, cas: , stock 35.1g, assay 98.1%, molecular formula: C₇H₁₁D₃F₂N₂O₂, molecular weight: . |
| N5-Methyllamotrigine, cas: 1373243-86-7, stock 45.9g, assay 95.8%, molecular formula: C₁₀H₉Cl₂N₅, molecular weight: . |
| N6-[Bis(4-methoxyphenyl)methyl]-N2-[(phenylmethoxy)carbonyl]-L-lysinePhenylmethylEster, cas: 1820794-34-0, stock 37.7g, assay 97.2%, molecular formula: C₃₆H₄₀N₂O₆, molecular weight: . |
| N6-[Bis(4-methoxyphenyl)methyl]-N6-[3,6-dideoxy-1,2-O-(1-methylethylidene)-α-D-ribo-hexofuranos-6-yl]-N2-[(phenylmethoxy)carbonyl]-L-lysinePhenylmethylEster, cas: 1820794-59-9, stock 28.5g, assay 96.8%, molecular formula: C₄₅H₅₄N₂O₁₀, molecular weight: . |
| N6-(2-Aminoethyl)-FAD, cas: 167962-39-2, stock 36.6g, assay 98.3%, molecular formula: C₂₉H₃₈N₁₀O₁₅P₂, molecular weight: . |
| N6-(2-Carboxyethyl) Ibrutinib, cas: N/A, stock 11.1g, assay 97.3%, molecular formula: C28H28N6O4, molecular weight: 512.56. |
| N6-(2-Carboxyethyl) Ibrutinib, cas: , stock 19.4g, assay 98.5%, molecular formula: C₂₈H₂₈N₆O₄, molecular weight: . |
| N6-(6-Aminohexyl)-2’-deoxyadenosine, cas: 147218-60-8, stock 37.2g, assay 98.3%, molecular formula: C₁₆H₂₆N₆O₃, molecular weight: . |
| N6,O-DitrifluoroacetylTenofovir, cas: , stock 50g, assay 98.3%, molecular formula: C₁₃H₁₂F₆N₅O₆P, molecular weight: . |
| N6-[(1,1-Dimethylethoxy)carbonyl]-N2-[(phenylmethoxy)carbonyl]-L-lysine-phenylmethylEster, cas: 128972-27-0, stock 43.5g, assay 97.9%, molecular formula: C₂₆H₃₄N₂O₆, molecular weight: . |
| N6-[(N2-(1(S)-Carboxy-3-phenyl-propyl)-D-lysyl]Lisinopril, cas: , stock 32g, assay 96.2%, molecular formula: C₃₇H₅₃N₅O₈, molecular weight: . |
| N6-[(N2-(1(S)-Carboxy-3-phenyl-propyl)-L-lysyl]Lisinopril, cas: , stock 19.7g, assay 96.1%, molecular formula: C₃₇H₅₃N₅O₈, molecular weight: . |
| N6022, cas: 1208315-24-5, stock 22g, assay 95.8%, molecular formula: C₂₄H₂₂N₄O₃, molecular weight: . |
| N6-Ac-DL-Lysine, cas: N/A, stock 22.8g, assay 96.4%, molecular formula: C9H12F2N2O11P2, molecular weight: 424.14. |
| N6-AcryloylIbrutinib, cas: 2031255-27-1, stock 32.6g, assay 95%, molecular formula: C28H26N6O3, molecular weight: 494.54. |
| N6-Benzoyl-3’-O-tert-butyldimethylsilyl-5’-O-DMT-adenosine2’-CEPhosphoramidite, cas: 129451-75-8, stock 28.6g, assay 96.5%, molecular formula: C₅₃H₆₆N₇O₈PSi, molecular weight: . |
| N6-Benzoyl-5’-O-DMT-2’-O-(2-methoxyethyl)adenosine3’-CEPhosphoramidite, cas: 251647-53-7, stock 13.9g, assay 96.8%, molecular formula: C₅₀H₅₈N₇O₉P, molecular weight: . |
| N6-Benzoyladenosine, cas: 4546-55-8, stock 47.6g, assay 95.2%, molecular formula: C₁₇H₁₇N₅O₅, molecular weight: . |
| N6-Boc-1,6-Diazaspiro[3.3]heptaneSemiOxalate, cas: 1431868-60-8, stock 14.5g, assay 97%, molecular formula: C₁₀H₁₈N₂O₂•0.5[C₂H₂O₄], molecular weight: . |
| N6-Carbobenzoxy-L-lysineN-Carboxyanhydride, cas: 1676-86-4, stock 42.8g, assay 96.4%, molecular formula: C₁₅H₁₈N₂O₅, molecular weight: . |
| N6-Cyclopropyl-9-[(1R,4S)-4-[(1,1-dimethylethoxy)methyl]-2-cyclopenten-1-yl]-9H-purine-2,6-diamine, cas: 1443421-68-8, stock 14.5g, assay 98.1%, molecular formula: C₁₈H₂₆N₆O, molecular weight: . |
| N6-Cyclopropyl-9-[(1R,4S)-4-[(1,1-dimethylethoxy)methyl]-2-cyclopenten-1-yl]-9H-purine-2,6-diamine-d4, cas: , stock 45.8g, assay 95.1%, molecular formula: C₁₈H₂₂D₄N₆O, molecular weight: . |
| N6-Cyclopropyl-9H-purine-2,6-diamineMethanolate, cas: , stock 22.7g, assay 95.9%, molecular formula: C₉H₁₄N₆O, molecular weight: . |
| N6-Cyclopropyl-9H-purine-2,6-diamine-d4Methanolate, cas: , stock 31.1g, assay 96.8%, molecular formula: C₉H₁₀D₄N₆O, molecular weight: . |
| N6-DL-Lysyl-DL-Lysine, cas: N/A, stock 45.4g, assay 95.7%, molecular formula: C9H11F2N3O5, molecular weight: 279.20. |
| N6-LauroylCordycepin, cas: 77378-06-4, stock 49.9g, assay 95.3%, molecular formula: C₂₂H₃₅N₅O₄, molecular weight: . |
| N6-LauroylCordycepin-d23, cas: , stock 14.5g, assay 98.4%, molecular formula: C₂₂H₁₂D₂₃N₅O₄, molecular weight: . |
| N6-L-Lysyl-L-LysineTrihydrochloride, cas: 164262-23-1, stock 18.7g, assay 96.7%, molecular formula: C12H26N4O3. 3 HCl, molecular weight: 274.37 3 36.46. |
| N6-L-Lysyl-L-LysineTrimesylate, cas: N/A, stock 16.6g, assay 98.2%, molecular formula: C9H13F2N3O10P2. 3 C6H15N, molecular weight: 503.14 3 101.19. |
| N6-L-Lysyl-L-Lysine(tri-Boc), cas: N/A, stock 21.6g, assay 95.9%, molecular formula: 13C 15N2 C8H13F2NO10P2. 3 C6H15N, molecular weight: 426.14 3 101.19. |
| N6-Monobutyryladenosine3’:5’-CyclicMonophosphateSodiumSalt, cas: 70253-67-7, stock 31.6g, assay 95.8%, molecular formula: C₁₄H₁₇N₅NaO₇P, molecular weight: . |
| N6-OctanoylCordycepin, cas: 77378-05-3, stock 32.9g, assay 96.5%, molecular formula: C₁₈H₂₇N₅O₄, molecular weight: . |
| N6-OctanoylCordycepin-d15, cas: , stock 19.5g, assay 98.2%, molecular formula: C₁₈H₁₂D₁₅N₅O₄, molecular weight: . |
| N6-PropionylCordycepin, cas: 77378-04-2, stock 44.2g, assay 96.1%, molecular formula: C₁₃H₁₇N₅O₄, molecular weight: . |
| N6-PropionylCordycepin-d5, cas: , stock 47.6g, assay 98.6%, molecular formula: C₁₃H₁₂D₅N₅O₄, molecular weight: . |
| N6-SuccinylAdenosine, cas: 4542-23-8, stock 26.1g, assay 96.3%, molecular formula: C₁₄H₁₇N₅O₈, molecular weight: . |
| N6-TrifluoroacetylTenofovirPhospho(N-methylimidazolide)TEASalt, cas: , stock 16.4g, assay 95.3%, molecular formula: C₁₅H₁₈F₃N₇O₄P⁻, molecular weight: . |
| N6-Trifluoroacetyl-L-lysyl-L-proline, cas: 103300-89-6, stock 15.4g, assay 95.4%, molecular formula: C₁₃H₂₀F₃N₃O₄, molecular weight: . |
| N7-(2’,3’,4’-Trihydroxybutyl)guanine,>90%, cas: 93905-80-7, stock 44.3g, assay 96.5%, molecular formula: C₉H₁₃N₅O₄, molecular weight: . |
| N7-(2’,3’,4’-Trihydroxybutyl)guanine-d6, cas: , stock 36.8g, assay 95.5%, molecular formula: C₉H₇D₆N₅O₄, molecular weight: . |
| N7-(2-Carbamoyl-2-hydroxyethyl)guanine, cas: 163734-06-3, stock 14.6g, assay 98.2%, molecular formula: C₈H₁₀N₆O₃, molecular weight: . |
| N7-(2-Hydroxyethyl)adenine, cas: 126595-74-2, stock 17g, assay 95.6%, molecular formula: C₇H₉N₅O, molecular weight: . |
| N7-(2-Hydroxyethyl)guanine, cas: 53498-52-5, stock 22.4g, assay 98.1%, molecular formula: C₇H₉N₅O₂, molecular weight: . |
| N7-(2-Hydroxyethyl)guanine-d4, cas: 1246818-81-4, stock 23.9g, assay 95.5%, molecular formula: C₇H₅D₄N₅O₂, molecular weight: . |
| N7-(2-Hydroxyethyl-d4)adenine, cas: 1246818-44-9, stock 29.6g, assay 97.2%, molecular formula: C₇H₅D₄N₅O, molecular weight: . |
| N7-[(2-Hydroxyethoxy)methyl)guanine-d4, cas: 1794787-59-9, stock 37g, assay 95.9%, molecular formula: C₈H₇D₄N₅O₃, molecular weight: . |
| N7-AcetylFamciclovir, cas: , stock 39.8g, assay 95.7%, molecular formula: C₁₆H₂₃N₅O₅, molecular weight: . |
| N8-AcetylspermidineDihydrochloride, cas: 34450-15-2, stock 35.2g, assay 98%, molecular formula: C₉H₂₃Cl₂N₃O, molecular weight: . |
| N8-Acetylspermidine-d3Dihydrochloride, cas: , stock 18.6g, assay 96.2%, molecular formula: C₉H₂₀D₃Cl₂N₃O, molecular weight: . |
| N8-BenzoylVarenicline, cas: , stock 36.6g, assay 96.6%, molecular formula: C₂₀H₁₇N₃O, molecular weight: . |
| N8-BenzoyloxyVarenicline, cas: , stock 49.1g, assay 97.9%, molecular formula: C₂₀H₁₇N₃O₂, molecular weight: . |
| N8-Caffeoylspermidine, cas: 95687-22-2, stock 16.8g, assay 96%, molecular formula: C₁₆H₂₅N₃O₃, molecular weight: . |
| N8-Coumaroylspermidine, cas: 67005-74-7, stock 20.1g, assay 95.6%, molecular formula: C₁₆H₂₅N₃O₂, molecular weight: . |
| N8-Desethylcarbamoyl-N1-ethylcarbamoylCabergoline, cas: 166533-36-4, stock 48.3g, assay 97.7%, molecular formula: C₂₆H₃₇N₅O₂, molecular weight: . |
| N8-Desethylcarbamoyl-N1-ethylcarbamoylCabergoline-d5, cas: , stock 33.2g, assay 95.4%, molecular formula: C₂₆H₃₂D₅N₅O₂, molecular weight: . |
| N8-Feruloylspermidine, cas: 95687-20-0, stock 27.3g, assay 96.6%, molecular formula: C₁₇H₂₇N₃O₃, molecular weight: . |
| N-9CondensationCompound, cas: 122497-17-0, stock 22.2g, assay 96%, molecular formula: C17H22ClN5O6, molecular weight: 427.84. |
| N9-Benzylbis-(6-OGuaninyl-Benzyl)GuaninylValacyclovir, cas: , stock 46.3g, assay 98.6%, molecular formula: C₄₀H₄₇N₁₁O₅, molecular weight: . |
| N-9H-Fluoren-2-yl-N-hydroxy-acetamide, cas: 53-95-2, stock 21.6g, assay 98.8%, molecular formula: C₁₅H₁₃NO₂, molecular weight: . |
| N-9H-Fluoren-4-yl-N-hydroxy-acetamide, cas: 22225-34-9, stock 23.2g, assay 95.2%, molecular formula: C₁₅H₁₃NO₂, molecular weight: . |
| NA, cas: N/A, stock 33.4g, assay 96.1%, molecular formula: C10H10Br2N4O2, molecular weight: 378.02. |
| NAADPTetrasodiumSalt, cas: , stock 20.8g, assay 96.6%, molecular formula: C₂₁H₂₃N₆Na₄O₁₈P₃, molecular weight: . |
| NAADP-AM, cas: 1115066-04-0, stock 10.4g, assay 95.5%, molecular formula: C₃₃H₄₄N₆O₂₆P₃, molecular weight: . |
| NAB2, cas: 1504588-00-4, stock 32.4g, assay 95.2%, molecular formula: C₂₃H₂₀ClN₃O, molecular weight: . |
| Nabumetone, cas: 42924-53-8, stock 21.2g, assay 95.3%, molecular formula: C15H16O2, molecular weight: 228.29. |
| NabumetoneD3, cas: 1216770-08-9, stock 31.3g, assay 96%, molecular formula: C15H13D3O2, molecular weight: 231.31. |
| NabumetoneEPImpurityA, cas: 343272-52-6, stock 35.3g, assay 98.9%, molecular formula: C18H20O2, molecular weight: 268.36. |
| NabumetoneEPImpurityB, cas: 343272-51-5 , stock 44.4g, assay 98.9%, molecular formula: C18H18O2, molecular weight: 266.34. |
| NabumetoneEPImpurityC, cas: 65726-24-1, stock 38.2g, assay 95.3%, molecular formula: C15H18O2, molecular weight: 230.31. |
| NabumetoneEPImpurityD, cas: 127053-22-9 , stock 16.4g, assay 95.7%, molecular formula: C15H14O2, molecular weight: 226.28. |
| NabumetoneEPImpurityE, cas: 343272-53-7 , stock 37g, assay 98.9%, molecular formula: C27H26O3, molecular weight: 398.5. |
| NabumetoneEPImpurityF, cas: 29619-45-2 , stock 14.9g, assay 97.2%, molecular formula: C22H18O2, molecular weight: 314.38. |
| NabumetoneImpurity2（NabumetoneEPImpurityB）, cas: 343272-51-5, stock 28.2g, assay 98.2%, molecular formula: , molecular weight: . |
| NabumetoneImpurity4（NabumetoneEPImpurityD）, cas: 127053-22-9, stock 10.1g, assay 97.3%, molecular formula: , molecular weight: . |
| NabumetoneImpurity5（NabumetoneEPImpurityE）, cas: 343272-53-7, stock 37.7g, assay 98.1%, molecular formula: , molecular weight: . |
| N-AcetalBromopride, cas: 94135-22-5, stock 41.7g, assay 96%, molecular formula: C₁₆H₂₄BrN₃O₃, molecular weight: . |
| N-AcetamidorhodanineMonohydrate, cas: 73855-54-6, stock 24.2g, assay 96.1%, molecular formula: C₅H₆N₂O₂S₂ • H ₂O, molecular weight: . |
| N-Acetyl1,1-Diethylester5-AminopentanoicAcid, cas: , stock 24.1g, assay 95.7%, molecular formula: C₁₃H₂₁NO₇, molecular weight: . |
| N-Acetyl1,1-Diethylester5-AminopentanoicAcid-d6, cas: , stock 11.2g, assay 98.6%, molecular formula: C₁₃H₁₅D₆NO₇, molecular weight: . |
| N-Acetyl1,1-Diethylester5-Aminopentanol-O-t-butyldimethylsilylEther, cas: , stock 11.1g, assay 96.6%, molecular formula: C₁₉H₃₇NO₆Si, molecular weight: . |
| N-Acetyl1,1-Diethylester5-Aminopentanol-O-t-butyldimethylsilylEther-d8, cas: , stock 44.1g, assay 97.4%, molecular formula: C₁₉H₂₉D₈NO₆Si, molecular weight: . |
| N-Acetyl1,1-Diethylester5-Aminopentaol, cas: , stock 27.3g, assay 98.3%, molecular formula: C₁₃H₂₃NO₆, molecular weight: . |
| N-Acetyl1,1-Diethylester5-Aminopentaol-d8, cas: , stock 28.5g, assay 95.8%, molecular formula: C₁₃H₁₅D₈NO₆, molecular weight: . |
| N-Acetyl2-ButyrylPhenothiazine, cas: , stock 33g, assay 96.3%, molecular formula: C₁₈H₁₇NO₂S, molecular weight: . |
| N-Acetyl-4-aminosalicyclicAci, cas: N/A, stock 43.3g, assay 96.5%, molecular formula: 2 C11H17NO3. H2O4S, molecular weight: 2 211.26 98.08. |
| N-Acetyl6-Chlorotryptophan, cas: 50517-10-7, stock 42.4g, assay 96.6%, molecular formula: C₁₃H₁₃ClN₂O₃, molecular weight: . |
| N-AcetylAmoxicilloicAcid, cas: , stock 49.6g, assay 95.1%, molecular formula: C₁₈H₂₃N₃O₇S, molecular weight: . |
| N-AcetylAmphotericinB(~75%), cas: 902457-23-2, stock 38.2g, assay 97.4%, molecular formula: C₄₉H₇₅NO₁₈, molecular weight: . |
| N-AcetylBenzocaine, cas: 5338-44-3, stock 36.7g, assay 98.1%, molecular formula: C11H13NO3 , molecular weight: 207.23. |
| N-AcetylBisoprolol, cas: 66722-65-4, stock 12.3g, assay 97.2%, molecular formula: C₂₀H₃₃NO₅, molecular weight: . |
| N-Acetylcefdinir, cas: N/A, stock 28.7g, assay 98.1%, molecular formula: C16H15N5O6S2, molecular weight: 437.4. |
| N-AcetylCefixime, cas: , stock 30g, assay 96.8%, molecular formula: C₁₈H₁₇N₅O₈S₂, molecular weight: . |
| N-AcetylCefpodoximeProxetil, cas: 947692-15-1, stock 23.9g, assay 96.1%, molecular formula: C₂₃H₂₉N₅O₁₀S₂, molecular weight: . |
| N-AcetylCefpodoximeProxetil-d3, cas: , stock 30.2g, assay 96.1%, molecular formula: C₂₃H₂₆D₃N₅O₁₀S₂, molecular weight: . |
| N-AcetylCyclizedIodixanol, cas: 171897-72-6, stock 25.9g, assay 95.6%, molecular formula: C₃₅H₄₃I₅N₆O₁₅, molecular weight: . |
| N-AcetylD,L-α-MethylDOPADimethylEther, cas: 5934-66-7, stock 13.4g, assay 95.6%, molecular formula: C₁₄H₁₉NO₅, molecular weight: . |
| N-AcetylDaclatasvir, cas: 1800502-75-3, stock 40.3g, assay 98.9%, molecular formula: C₄₄H₅₄N₈O₈, molecular weight: . |
| N-AcetylDaclatasvir-d6, cas: , stock 11.8g, assay 97.7%, molecular formula: C₄₄H₄₈D₆N₈O₈, molecular weight: . |
| N-AcetylDesethylChloroquine-d4, cas: 1216619-20-3, stock 41g, assay 95.2%, molecular formula: C₁₈H₂₀D₄ClN₃O, molecular weight: . |
| N-AcetylDesethylChloroquine-d5, cas: N/A, stock 25.6g, assay 97.4%, molecular formula: C10H12N2O2. HCl, molecular weight: 192.22 36.46. |
| N-AcetylD-α-MethylDOPADimethylEther(+)-α-MethylbenzylamineSalt, cas: 17772-88-2, stock 14.1g, assay 98.9%, molecular formula: C₂₂H₃₀N₂O₅, molecular weight: . |
| N-AcetylEphedrine, cas: 2272-83-5, stock 43.9g, assay 95.1%, molecular formula: C12H17NO2, molecular weight: 207.27. |
| N-AcetylFamciclovir, cas: , stock 46g, assay 96.7%, molecular formula: C₁₆H₂₁N₅O₅, molecular weight: . |
| N-AcetylFamciclovir-d4, cas: , stock 27.5g, assay 97.4%, molecular formula: C₁₆H₁₇D₄N₅O₅, molecular weight: . |
| N-AcetylFluvoxamineAcid, cas: 88699-87-0, stock 13.8g, assay 95.3%, molecular formula: C₁₆H₁₉F₃N₂O₄, molecular weight: . |
| N-AcetylFolicAcidD4, cas: 461426-36-8, stock 39.4g, assay 96.9%, molecular formula: C21H17D4N7O7, molecular weight: 487.47. |
| N-AcetylGlufosinate, cas: 73634-73-8, stock 13.5g, assay 98.7%, molecular formula: C7H14NO5P, molecular weight: 223.16. |
| N-AcetylGlufosinateSodium, cas: 133659-60-6, stock 25.7g, assay 95.8%, molecular formula: C₇H₁₂NNa₂O₅P, molecular weight: . |
| N-AcetylGlufosinate-d3DisodiumSalt, cas: 1356933-74-8, stock 16.8g, assay 97.9%, molecular formula: C₇H₉D₃NNa₂O₅P, molecular weight: . |
| N-AcetylGlyphosate, cas: 129660-96-4, stock 48.3g, assay 97.2%, molecular formula: C₅H₁₀NO₆P, molecular weight: . |
| N-AcetylGlyphosate-13C2,15N, cas: 1346598-31-9, stock 14.8g, assay 97.4%, molecular formula: C₃¹³C₂H₁₀¹⁵NO₆P, molecular weight: . |
| N-AcetylGlyphosate-d3, cas: 1346604-36-1, stock 25.3g, assay 95.1%, molecular formula: C₅H₇D₃NO₆P, molecular weight: . |
| N-AcetylIminostilbene, cas: 19209-60-0, stock 42.4g, assay 98.5%, molecular formula: C16H13NO, molecular weight: 235.29. |
| N-Acetyl-L-AsparticAcid-d3, cas: 1383929-94-9, stock 31.9g, assay 98.1%, molecular formula: C₆H₆D₃NO₅, molecular weight: . |
| N-AcetylLenalidomide, cas: 1421593-80-7, stock 31.8g, assay 97.8%, molecular formula: C15H15N3O4, molecular weight: 301.3. |
| N-AcetylLorcaserin, cas: 1181690-72-1, stock 30.5g, assay 98.3%, molecular formula: C₁₃H₁₆ClNO, molecular weight: . |
| N-AcetylLorcaserin-d3, cas: , stock 31.2g, assay 95%, molecular formula: C₁₃H₁₃D₃ClNO, molecular weight: . |
| N-AcetylL-ThyroxineEthylEster, cas: 30804-52-5, stock 49.9g, assay 97.6%, molecular formula: C₁₉H₁₇I₄NO₅, molecular weight: . |
| N-AcetylL-Thyroxine-13C6, cas: , stock 37.4g, assay 95.1%, molecular formula: C₁₁¹³C₆H₁₃I₄NO₅, molecular weight: . |
| N-AcetylL-Thyroxine-d3, cas: , stock 45.7g, assay 97.3%, molecular formula: C₁₇H₁₀D₃I₄NO₅, molecular weight: . |
| N-AcetylMesalazine, cas: 51-59-2, stock 39g, assay 97.4%, molecular formula: C₉H₉NO₄, molecular weight: . |
| N-AcetylMesalazine-d3, cas: 1309935-89-4, stock 29.5g, assay 95.8%, molecular formula: C₉H₆D₃NO₄, molecular weight: . |
| N-AcetylMesalazine-d3, cas: 93968-79-7, stock 28g, assay 98.1%, molecular formula: C₉H₆D₃NO₄, molecular weight: . |
| N-AcetylMescaline, cas: 4593-89-9, stock 33.2g, assay 95.4%, molecular formula: C₁₃H₁₉NO₄, molecular weight: . |
| N-AcetylMescaline-d3, cas: 1329610-11-8, stock 41.8g, assay 97.2%, molecular formula: C₁₃H₁₆D₃NO₄, molecular weight: . |
| N-AcetylMetoclopramide-d3, cas: 105314-01-0, stock 26.7g, assay 98.5%, molecular formula: C₁₆H₂₁D₃ClN₃O₃, molecular weight: . |
| N-AcetylNorgestimate-d6, cas: 1263195-02-3, stock 40.8g, assay 99%, molecular formula: C₂₅H₂₇D₆NO₄, molecular weight: . |
| N-AcetylN-Penta-cbzNeomycinB, cas: , stock 38.3g, assay 95.5%, molecular formula: C₆₅H₇₈N₆O₂₄, molecular weight: . |
| N-AcetylN-Penta-cbzNeomycinBO-Pentaacetate, cas: , stock 16.1g, assay 95.2%, molecular formula: C₇₅H₈₈N₆O₂₉, molecular weight: . |
| N-AcetylO-Benzyl5’-EpiLamivudine, cas: 131086-33-4, stock 21.1g, assay 96.7%, molecular formula: C₁₇H₁₇N₃O₅S, molecular weight: . |
| N-AcetylO-BenzylLamivudine, cas: 1091585-30-6, stock 23.5g, assay 95.6%, molecular formula: C₁₇H₁₇N₃O₅S, molecular weight: . |
| N-AcetylPhenylephrine, cas: 58952-80-0, stock 21.4g, assay 96.4%, molecular formula: C11H15NO3 , molecular weight: 209.25. |
| N-AcetylRetigabine, cas: 229970-68-7, stock 32.8g, assay 97.2%, molecular formula: C₁₅H₁₆FN₃O, molecular weight: . |
| N-AcetylRetigabine(Ezogabine), cas: 102877-75-9, stock 28.4g, assay 95.5%, molecular formula: C18H20FN3O3, molecular weight: 345.38. |
| N-AcetylRetigabine(Ezogabine)-d5, cas: 1028277-75-9, stock 25.4g, assay 98.9%, molecular formula: C18H15FN3O3D5, molecular weight: 350.41. |
| N-AcetylSerotoninTri-O-acetyl-β-D-glucuronideMethylEster, cas: , stock 45g, assay 98.7%, molecular formula: C₂₅H₃₀N₂O₁₁, molecular weight: . |
| N-AcetylSerotoninβ-D-Glucuronide, cas: 18430-06-3, stock 13.2g, assay 98.7%, molecular formula: C₁₈H₂₂N₂O₈, molecular weight: . |
| N-AcetylSerotonin-d4Tri-O-acetyl-β-D-glucuronideMethylEster, cas: , stock 41.9g, assay 96.9%, molecular formula: C₂₅H₂₆D₄N₂O₁₁, molecular weight: . |
| N-AcetylSerotonineO-SulfateEsterTriethylammoniumSalt, cas: , stock 37g, assay 96.3%, molecular formula: C₁₂H₁₄N₂O₅S .(C ₆H₁₅N), molecular weight: . |
| N-AcetylSitagliptin-d3, cas: 1795785-80-6, stock 35g, assay 95%, molecular formula: C₁₈H₁₃D₃F₆N₅O₂, molecular weight: . |
| N-AcetylSulfadiazine, cas: 127-74-2, stock 43.7g, assay 96.6%, molecular formula: C₁₂H₁₂N₄O₃S, molecular weight: . |
| N-AcetylSulfadiazine-13C6, cas: 1217089-17-2, stock 27.1g, assay 96.9%, molecular formula: C₆¹³C₆H₁₂N₄O₃S, molecular weight: . |
| N-AcetylSulfadiazine-d4(Major), cas: 1219149-66-2, stock 26.3g, assay 97.2%, molecular formula: C₁₂H₈D₄N₄O₃S, molecular weight: . |
| N-AcetylSulfamethoxazole-13C6, cas: , stock 17g, assay 96.8%, molecular formula: C₆¹³C₆H₁₃N₃O₄S, molecular weight: . |
| N-AcetylSulfamethoxazole-d4(major), cas: 1215530-54-3, stock 38.4g, assay 98%, molecular formula: C₁₂H₉D₄N₃O₄S, molecular weight: . |
| N-AcetylSulfapyridine, cas: 19077-98-6, stock 46.7g, assay 97.8%, molecular formula: C₁₃H₁₃N₃O₃S, molecular weight: . |
| N-AcetylSulfapyridine-d4, cas: , stock 34.5g, assay 96.9%, molecular formula: C₁₃H₉D₄N₃O₃S, molecular weight: . |
| N-AcetylSulfapyridine-d4(Major), cas: 1189732-52-2, stock 24.9g, assay 96.9%, molecular formula: C₁₃H₉D₄N₃O₃S, molecular weight: . |
| N-AcetylTizanidine-d4, cas: 1276602-33-5, stock 14.1g, assay 96.5%, molecular formula: C₁₁H₆D₄ClN₅OS, molecular weight: . |
| N-acetylvasopressin, cas: N/A, stock 13.5g, assay 97.9%, molecular formula: C7H11NO2, molecular weight: 141.17. |
| N-AcetylVortioxetine, cas: 1801352-86-2, stock 38g, assay 97.5%, molecular formula: C20H24N2OS, molecular weight: 340.49. |
| N-AcetylVortioxetine, cas: N/A, stock 17.3g, assay 95.8%, molecular formula: C23H26N4O11, molecular weight: 534.48. |
| N-AcetylZonisamide, cas: 68936-43-6, stock 22.9g, assay 97.3%, molecular formula: C₁₀H₁₀N₂O₄S, molecular weight: . |
| N-Acetyl-2,6-difluoro-D-phenylalanine, cas: 266360-56-9, stock 19.4g, assay 96.1%, molecular formula: C₁₁H₁₁NO₃F₂, molecular weight: . |
| N-Acetyl(D3)-S-(2-carboxypropyl)-L-cysteineDisodiumSalt(MixtureofDiastereomers), cas: , stock 20.4g, assay 96.1%, molecular formula: C₉H₁₀D₃NNa₂O₅S, molecular weight: . |
| N-Acetyl-1-(2’-Amino-2,4’-dichlorophenyl)ethan-1-one, cas: 68095-20-5, stock 23.7g, assay 95.6%, molecular formula: C₁₀H₉Cl₂NO₂, molecular weight: . |
| N-Acetyl-1,3-propanediamine, cas: 4078-13-1, stock 43.5g, assay 96.6%, molecular formula: C₅H₁₂N₂O, molecular weight: . |
| N-Acetyl-1,3-propanediamine-d6, cas: , stock 44.9g, assay 97.8%, molecular formula: C₅H₆D₆N₂O, molecular weight: . |
| N-Acetyl-2-(4-fluorophenyl)-DL-beta-alanine, cas: 332052-58-1, stock 37.9g, assay 97.6%, molecular formula: C₁₁H₁₂NO₃F, molecular weight: . |
| N-Acetyl-2’-deoxyguanosine3’,5’-Diacetate, cas: 02/05/4318, stock 31.5g, assay 98.6%, molecular formula: C₁₆H₁₉N₅O₇, molecular weight: . |
| N-Acetyl-2-amino-5-phenylpyridine, cas: 96721-83-4, stock 30.1g, assay 97.3%, molecular formula: C₁₃H₁₂N₂O, molecular weight: . |
| N-Acetyl-2-fluoro-DL-phenylalanine, cas: 66574-84-3, stock 19.9g, assay 98.9%, molecular formula: C₁₁H₁₂FNO₃, molecular weight: . |
| N-Acetyl-2-methylalanine, cas: 5362-00-5, stock 13.1g, assay 98.7%, molecular formula: C₆H₁₁NO₃, molecular weight: . |
| N-Acetyl-2-naphthylamine, cas: 581-97-5, stock 32.3g, assay 98.5%, molecular formula: C₁₂H₁₁NO, molecular weight: . |
| N-Acetyl-2-O-benzyl-α-D-neuraminicAcid-d3, cas: , stock 33.9g, assay 97.9%, molecular formula: C₁₈H₂₂D₃NO₉, molecular weight: . |
| N-Acetyl-3-(2,5-difluorophenyl)-L-alanine, cas: 1017294-09-5, stock 30.1g, assay 98.9%, molecular formula: C₁₁H₁₁NO₃F₂, molecular weight: . |
| N-Acetyl-3-(2-naphthalenyl)-D-alanyl-4-chloro-D-phenylalanyl-3-(3-pyridinyl)-D-alanine, cas: 129225-22-5, stock 37g, assay 99%, molecular formula: C₃₂H₃₁ClN₄O₅, molecular weight: . |
| N-Acetyl-3,3’,5’-triiodo-L-thyronine-13C6, cas: , stock 46.4g, assay 97.6%, molecular formula: C₁₁¹³C₆H₁₄I₃NO₅, molecular weight: . |
| N-Acetyl-3,3’,5’-triiodo-L-thyronine-d3, cas: , stock 17.1g, assay 96.1%, molecular formula: C₁₇H₁₁D₃I₃NO₅, molecular weight: . |
| N-Acetyl-3,3’,5-triiodo-L-thyronine-13C6, cas: , stock 15.8g, assay 96.3%, molecular formula: C₁₁¹³C₆H₁₄I₃NO₅, molecular weight: . |
| N-Acetyl-3,3’,5-triiodo-L-thyronine-d3, cas: , stock 29g, assay 96.9%, molecular formula: C₁₇H₁₁D₃I₃NO₅, molecular weight: . |
| N-Acetyl-3,5-diiodo-L-tyrosine, cas: 1027-28-7, stock 12.2g, assay 98.7%, molecular formula: C₁₁H₁₁I₂NO₄, molecular weight: . |
| N-Acetyl-3,5-dinitro-L-tyrosine, cas: 20767-00-4, stock 35g, assay 95.5%, molecular formula: C₁₁H₁₁N₃O₈, molecular weight: . |
| N-Acetyl-3-[(3-amino-3-oxopropyl)sulfinyl]-L-alanine, cas: 861959-88-8, stock 37.6g, assay 98.3%, molecular formula: C₈H₁₄N₂O₅S, molecular weight: . |
| N-Acetyl-3-[(3-amino-3-oxopropyl)sulfinyl]-L-alanineSodiumSalt, cas: , stock 44.4g, assay 98.1%, molecular formula: C₈H₁₃N₂NaO₅S, molecular weight: . |
| N-Acetyl-3-[(3-amino-3-oxopropyl)sulfinyl]-L-alanineSodiumSalt-d3, cas: , stock 46.5g, assay 96.3%, molecular formula: C₈H₁₀D₃N₂NaO₅S, molecular weight: . |
| N-Acetyl-3-[(3-amino-3-oxopropyl)sulfinyl]-L-alanine-13C3, cas: , stock 30.7g, assay 97.5%, molecular formula: C₅¹³C₃H₁₄N₂O₅S, molecular weight: . |
| N-Acetyl-3-[(3-amino-3-oxopropyl)sulfinyl]-L-alanine-d3, cas: , stock 49.2g, assay 97.5%, molecular formula: C₈H₁₁D₃N₂O₅S, molecular weight: . |
| N-Acetyl-3-acetoxyindole, cas: 16800-67-2, stock 48g, assay 96.1%, molecular formula: C₁₂H₁₁NO₃, molecular weight: . |
| N-Acetyl-3-hydroxyindole, cas: 33025-60-4, stock 36.5g, assay 97.2%, molecular formula: C₁₀H₉NO₂, molecular weight: . |
| N-Acetyl-3-iodo-4-(4-methoxyphenoxy)-L-phenylalanineAmide, cas: 59302-20-4, stock 15.4g, assay 96.8%, molecular formula: C₁₈H₁₉IN₂O₄, molecular weight: . |
| N-Acetyl-3-iodo-L-tyrosineAmide, cas: 59302-19-1, stock 19.8g, assay 95.9%, molecular formula: C₁₁H₁₃IN₂O₃, molecular weight: . |
| N-Acetyl-3-iodo-L-tyrosineMonohydrate, cas: 23277-49-8, stock 49.7g, assay 98.9%, molecular formula: C₁₁H₁₄INO₅, molecular weight: . |
| N-Acetyl-3-nitro-2,6-dimethylaniline, cas: 06/12/5416, stock 46.6g, assay 97.8%, molecular formula: C₁₀H₁₂N₂O₃, molecular weight: . |
| N-Acetyl-4,5-dehydro-DL-leucine, cas: 87325-65-3, stock 34.8g, assay 95.3%, molecular formula: C₈H₁₃NO₃, molecular weight: . |
| N-Acetyl-4’-tetrahydropyranylglycine, cas: 1219171-26-2, stock 45g, assay 98.4%, molecular formula: C₉H₁₅NO₄, molecular weight: . |
| N-Acetyl-4-aminobiphenyl, cas: 4075-79-0, stock 22.5g, assay 98.9%, molecular formula: C₁₄H₁₃NO, molecular weight: . |
| N-Acetyl-4-aminobiphenyl-d5, cas: 1217046-73-5, stock 19.2g, assay 97.4%, molecular formula: C₁₄H₈D₅NO, molecular weight: . |
| N-Acetyl-4-aminosalicylicAcid-d3, cas: , stock 40.7g, assay 97.1%, molecular formula: C₉H₆D₃NO₄, molecular weight: . |
| N-Acetyl-4-benzoquinoneImine, cas: 50700-49-7, stock 25.6g, assay 98.5%, molecular formula: C₈H₇NO₂, molecular weight: . |
| N-Acetyl-4-benzoquinoneImine-D3, cas: , stock 16.3g, assay 96.6%, molecular formula: C₈H₄D₃NO₂, molecular weight: . |
| N-Acetyl-4-fluoro-DL-phenylalanine, cas: 17481-06-0, stock 11.8g, assay 96.6%, molecular formula: C₁₁H₁₂NO₃F, molecular weight: . |
| N-Acetyl-5-hydroxytryptamine, cas: 1210-83-9, stock 30.1g, assay 95.8%, molecular formula: C₁₂H₁₄N₂O₂, molecular weight: . |
| N-Acetyl-5-methyl-dl-tryptophan, cas: 71953-90-7, stock 49g, assay 96.8%, molecular formula: C₁₄H₁₆N₂O₃, molecular weight: . |
| N-Acetyl-6-(2-9((4-methoxybenzyl)oxy)propoxy)]-2’-deoxyguanosine-d33’,5’-Diacetate, cas: , stock 33.2g, assay 95.1%, molecular formula: C₂₇H₃₀D₃N₅O₉, molecular weight: . |
| N-Acetyl-6-chloro-D-tryptophan, cas: 56777-76-5, stock 14.6g, assay 96.9%, molecular formula: C₁₃H₁₃ClN₂O₃, molecular weight: . |
| N-Acetyl-9-O-(N-acetyl-β-neuraminosyl)-neuraminicAcid, cas: 114608-45-6, stock 22.1g, assay 98.2%, molecular formula: C₂₂H₃₆N₂O₁₇, molecular weight: . |
| N-Acetyl-alfa-D-Glucosamine-1-Phosphate, cas: 28446-21-1, stock 21.5g, assay 97%, molecular formula: C8H16NO9P , molecular weight: 301.19. |
| N-Acetyl-alfa-D-Glucosamine-1-Phosphate, cas: N/A, stock 47g, assay 97.1%, molecular formula: C25H29ClO8, molecular weight: 492.95. |
| N-Acetyl-alfa-D-Glucosamine-1-Phosphate-d3, cas: N/A, stock 19.2g, assay 96.5%, molecular formula: C32H37N5O6, molecular weight: 587.68. |
| N-AcetylaminomethylphosphoricAcid, cas: 57637-97-5, stock 41.9g, assay 96.5%, molecular formula: C₃H₈NO₄P, molecular weight: . |
| N-AcetylaminomethylphosphoricAcid-d3(Major), cas: , stock 23.5g, assay 97.6%, molecular formula: C₃H₅D₃NO₄P, molecular weight: . |
| N-AcetylanthranilicAcid, cas: 89-52-1, stock 15.6g, assay 98.4%, molecular formula: C₉H₉NO₃, molecular weight: . |
| N-Acetyl-cys(1)-calcitoninSalmonTrifluoroaceticAcidSalt, cas: , stock 44.7g, assay 96.1%, molecular formula: C₁₄₇H₂₄₃N₄₄O₄₉S₂ • x(C ₂HF₃O₂), molecular weight: . |
| N-AcetylcysteineAmide, cas: 38520-57-9, stock 38.6g, assay 97.4%, molecular formula: C₅H₁₀N₂O₂S, molecular weight: . |
| N-Acetyl-D,L-AsparticAcid2,3,3-D3, cas: 89829-69-6, stock 37.3g, assay 95.6%, molecular formula: C₆H₆D₃NO₅, molecular weight: . |
| N-Acetyl-D,L-homotryptophan, cas: 205813-00-9, stock 47.8g, assay 98%, molecular formula: C₁₄H₁₆N₂O₃, molecular weight: . |
| N-Acetyl-D,L-homotryptophanEthylEster, cas: 110504-55-7, stock 40g, assay 95.2%, molecular formula: C₁₆H₂₀N₂O₃, molecular weight: . |
| N-Acetyl-D-[1-13C]mannosamine, cas: , stock 10.1g, assay 96.9%, molecular formula: C₇¹³CH₁₅NO₆, molecular weight: . |
| N-Acetyl-D-[1-13C15N]glucosamine, cas: 478529-40-7, stock 19.2g, assay 97.7%, molecular formula: C₇¹³CH₁₅¹⁵NO₆, molecular weight: . |
| N-Acetyl-D-[15N]glucosamine, cas: 478518-85-3, stock 15.5g, assay 97%, molecular formula: C₈H₁₅¹⁵NO₆, molecular weight: . |
| N-Acetyl-D-[15N]mannosamine, cas: 72-87-7, stock 47.1g, assay 96%, molecular formula: C₈H₁₅¹⁵NO₆, molecular weight: . |
| N-Acetyl-D-[2-13C]glucosamine, cas: 478529-39-4, stock 29.3g, assay 95.6%, molecular formula: C₇¹³C₇H₁₅NO₆, molecular weight: . |
| N-Acetyl-D-[2-13C]mannosamine, cas: , stock 43.5g, assay 98.2%, molecular formula: C₇¹³CH₁₅NO₆, molecular weight: . |
| N-Acetyl-d3Adamantamine, cas: 1217704-63-6, stock 35.7g, assay 98.3%, molecular formula: C₁₂H₁₆D₃NO, molecular weight: . |
| N-Acetyl-d3-5-hydroxytryptamine, cas: , stock 15.7g, assay 96.9%, molecular formula: C₁₂H₁₁D₃N₂O₂, molecular weight: . |
| N-Acetyl-d3-DL-alanine-3,3,3-d3, cas: , stock 32.1g, assay 96.5%, molecular formula: C₅H₃D₆NO₃, molecular weight: . |
| N-Acetyl-d3-S-(3-hydroxypropyl)cysteine,DicyclohexylammoniumSalt, cas: , stock 24.6g, assay 95.7%, molecular formula: C₂₀H₃₅D₃N₂O₄S, molecular weight: . |
| N-Acetyl-D-alanineMethylEster, cas: 19914-36-4, stock 30.9g, assay 95.1%, molecular formula: C₆H₁₁NO₃, molecular weight: . |
| N-Acetyl-D-alanine-2,3,3,3-d4, cas: , stock 45g, assay 96.1%, molecular formula: C₅H₅D₄NO₃, molecular weight: . |
| N-Acetyl-D-alanine-2,3,3,3-d4, cas: , stock 13.3g, assay 96.7%, molecular formula: C₅H₅D₄NO₃, molecular weight: . |
| N-Acetyl-dehydro-Eletriptan, cas: 188113-71-5, stock 16.5g, assay 97.2%, molecular formula: C₂₄H₂₆N₂O₃S, molecular weight: . |
| N-Acetyl-D-galactosamine, cas: 1811-31-0, stock 16.3g, assay 98.2%, molecular formula: C₈H₁₅NO₆, molecular weight: . |
| N-Acetyl-D-galactosamine-13C, cas: 478518-53-5, stock 28.1g, assay 95.2%, molecular formula: C₇¹³CH₁₅NO₆, molecular weight: . |
| N-Acetyl-D-glucosamine, cas: 7512-17-6, stock 47.7g, assay 98.9%, molecular formula: C₈H₁₅NO₆, molecular weight: . |
| N-Acetyl-D-Glucosamine3,4-Diacetate, cas: , stock 12.3g, assay 98.3%, molecular formula: C₁₂H₁₉NO₈, molecular weight: . |
| N-Acetyl-D-Glucosamine3,6-Diacetate, cas: 221069-48-3, stock 34.9g, assay 96.8%, molecular formula: C₁₂H₁₉NO₈, molecular weight: . |
| N-Acetyl-D-Glucosamine4,6-Diacetate, cas: , stock 12.3g, assay 98.9%, molecular formula: C₁₂H₁₉NO₈, molecular weight: . |
| N-Acetyl-D-Glucosamine6-Acetate, cas: 131832-93-4, stock 38.5g, assay 95.2%, molecular formula: C₁₀H₁₇NO₇, molecular weight: . |
| N-Acetyl-D-glucosamine6-SulfateSodiumSalt, cas: 108321-79-5, stock 10.1g, assay 97.2%, molecular formula: C₈H₁₄NNaO₉S, molecular weight: . |
| N-Acetyl-D-glucosamine-13C, cas: 253679-94-6, stock 31.1g, assay 96.9%, molecular formula: C₇¹³CH₁₅NO₆, molecular weight: . |
| N-Acetyl-D-glucosamine-13C6, cas: , stock 13.2g, assay 97.6%, molecular formula: C₂¹³C₆H₁₅NO₆, molecular weight: . |
| N-Acetyl-D-glucosamine-13C615N, cas: 478529-41-8, stock 12.6g, assay 97.3%, molecular formula: C₂¹³C₆H₁₅¹⁵NO⁶, molecular weight: . |
| N-Acetyl-D-glucosamine-6-phosphateDisodiumSalt, cas: 102029-88-9, stock 37.4g, assay 98.5%, molecular formula: C₈H₁₄NNa₂O₉P, molecular weight: . |
| N-Acetyl-D-glucosamine-d3, cas: 77369-11-0, stock 13.5g, assay 96.8%, molecular formula: C₈H₁₂D₃NO₆, molecular weight: . |
| N-Acetyl-D-glutamicAcid, cas: 19146-55-5, stock 30.8g, assay 97.4%, molecular formula: C₇H₁₁NO₅, molecular weight: . |
| N-Acetyl-D-glutamic-2,3,3,4,4-d5Acid, cas: 14341-87-8, stock 42.6g, assay 98.5%, molecular formula: C₇H₆D₅NO₅, molecular weight: . |
| N-Acetyl-D-Glutamine, cas: 161579-61-9, stock 40.4g, assay 97.1%, molecular formula: C7H12N2O4, molecular weight: 188.18. |
| N-Acetyl-D-histidine, cas: 75983-68-5, stock 17.9g, assay 98%, molecular formula: C₈H₁₁N₃O₃, molecular weight: . |
| N-Acetyl-D-histidine-1-15N, cas: , stock 35g, assay 95.9%, molecular formula: C₈H₁₁N₂¹⁵NO₃, molecular weight: . |
| N-Acetyl-D-histidine-3-15N, cas: , stock 37.2g, assay 95.4%, molecular formula: C₈H₁₁N₂¹⁵NO₃, molecular weight: . |
| N-Acetyldiethanolamine, cas: 7435-67-8, stock 25.4g, assay 95.1%, molecular formula: C₆H₁₃NO₃, molecular weight: . |
| N-Acetyl-DL-alanine, cas: 1115-69-1, stock 14.6g, assay 97.4%, molecular formula: C₅H₉NO₃, molecular weight: . |
| N-Acetyl-DL-alanine-3,3,3-d3, cas: , stock 33g, assay 96.6%, molecular formula: C₅H₆D₃NO₃, molecular weight: . |
| N-Acetyl-DL-alanine-d7, cas: , stock 23.5g, assay 96.9%, molecular formula: C₅H₂D₇NO₃, molecular weight: . |
| N-Acetyl-DL-asparticAcid, cas: 2545-40-6, stock 41.4g, assay 97.9%, molecular formula: C₆H₉NO₅, molecular weight: . |
| N-Acetyl-D-leucine, cas: 19764-30-8, stock 23.3g, assay 95.4%, molecular formula: C₈H₁₅NO₃, molecular weight: . |
| N-Acetyl-DL-norleucine, cas: 7682-16-8, stock 24.2g, assay 95.6%, molecular formula: C₈H₁₅NO₃, molecular weight: . |
| N-Acetyl-DL-norvaline, cas: 7682-15-7, stock 12.4g, assay 95.7%, molecular formula: C₇H₁₃NO₃, molecular weight: . |
| N-Acetyl-DL-phenylalanine, cas: 2901-75-9, stock 21.8g, assay 98.3%, molecular formula: C₁₁H₁₃NO₃, molecular weight: . |
| N-Acetyl-DL-Valine, cas: 3067-19-4, stock 47.6g, assay 97.8%, molecular formula: C₇H₁₃NO₃, molecular weight: . |
| N-Acetyl-D-mannosamine-d3, cas: 376645-66-8, stock 28.8g, assay 95.4%, molecular formula: C₈H₁₂D₃NO₆, molecular weight: . |
| N-Acetyl-D-methionine, cas: 1509-92-8, stock 32.6g, assay 98.1%, molecular formula: C₇H₁₃NO₃S, molecular weight: . |
| N-Acetyl-D-penicillamine, cas: 15537-71-0, stock 17.4g, assay 98.7%, molecular formula: C₇H₁₃NO₃S, molecular weight: . |
| N-Acetyl-D-phenylalanine, cas: 10172-89-1, stock 11g, assay 96.9%, molecular formula: C₁₁H₁₃NO₃, molecular weight: . |
| N-acetyl-D-serine, cas: 152612-69-6, stock 46.7g, assay 95.8%, molecular formula: C5H9NO4, molecular weight: 147.13. |
| N-Acetyl-D-tryptophan, cas: 05/01/2280, stock 26.5g, assay 95%, molecular formula: C₁₃H₁₄N₂O₃, molecular weight: . |
| N-Acetyl-D-Valine, cas: 17916-88-0, stock 35.6g, assay 98.6%, molecular formula: C₇H₁₃NO₃, molecular weight: . |
| N-AcetylethyleneUrea-d4, cas: 1189701-94-7, stock 37.4g, assay 95.2%, molecular formula: C₅H₄D₄N₂O₂, molecular weight: . |
| N-Acetylglucosamine4-sulfate, cas: N/A, stock 17g, assay 95.1%, molecular formula: C11H15N5O5, molecular weight: 297.27. |
| N-Acetylglycinamide, cas: 2620-63-5, stock 10.5g, assay 98.3%, molecular formula: C₄H₈N₂O₂, molecular weight: . |
| N-Acetylglycine, cas: 543-24-8, stock 28.3g, assay 95.9%, molecular formula: C₄H₇NO₃, molecular weight: . |
| N-AcetylglycineN-Methylamide-d8, cas: 1219802-57-9, stock 18.4g, assay 95.5%, molecular formula: C₅H₂D₈N₂O₂, molecular weight: . |
| N-Acetylglycine-13C2,15N, cas: 1202222-42-1, stock 29.2g, assay 96.6%, molecular formula: C₂¹³C₂H₇¹⁵NO₃, molecular weight: . |
| N-Acetylglycine-d5, cas: 1219805-82-9, stock 18.3g, assay 96.5%, molecular formula: C₄H₂D₅NO₃, molecular weight: . |
| N-Acetylglycyl-D-glutamicacid, cas: 135701-69-8, stock 29.9g, assay 95.4%, molecular formula: C₉H₁₄N₂O₆, molecular weight: . |
| N-Acetylisoleucine, cas: 3077-46-1, stock 46.2g, assay 96.6%, molecular formula: C₈H₁₅NO₃, molecular weight: . |
| N-Acetyl-L-(-)-leucine, cas: 1188-21-2, stock 23.8g, assay 98.3%, molecular formula: C₈H₁₅NO₃, molecular weight: . |
| N-Acetyllactosamine, cas: 32181-59-2, stock 40.5g, assay 95.5%, molecular formula: C₁₄H₂₅NO₁₁, molecular weight: . |
| N-Acetyllactosamine6,6’-Disulfate-d3DisodiumSalt,90%, cas: , stock 18.7g, assay 95.2%, molecular formula: C₁₄H₂₀D₃NNa₂O₁₇S₂, molecular weight: . |
| N-Acetyllactosamine6,6'-DisulfateDisodiumSalt-13C6, cas: 321897-68-1, stock 36.2g, assay 96.3%, molecular formula: 13C6 C8H23NNa2O17S2, molecular weight: 593.38. |
| N-Acetyllactosamine6-SulfateSodiumSalt,90%, cas: 145447-78-5, stock 20.4g, assay 95.8%, molecular formula: C₁₄H₂₄NNaO₁₄S, molecular weight: . |
| N-Acetyllactosamine6-Sulfate-d3SodiumSalt, cas: , stock 26.7g, assay 98.4%, molecular formula: C₁₄H₂₁D₃NNaO₁₄S, molecular weight: . |
| N-Acetyl-L-alanine, cas: 97-69-8, stock 12.8g, assay 97%, molecular formula: C₅H₉NO₃, molecular weight: . |
| N-Acetyl-L-alanine-2,3,3,3-d4, cas: , stock 38.6g, assay 96.5%, molecular formula: C₅H₅D₄NO₃, molecular weight: . |
| N-Acetyl-L-alanine-3,3,3-d3, cas: , stock 40.4g, assay 97.3%, molecular formula: C₅H₆D₃NO₃, molecular weight: . |
| N-Acetyl-L-asparticAcid, cas: 997-55-7, stock 27g, assay 97.5%, molecular formula: C₆H₉NO₅, molecular weight: . |
| N-Acetyl-L-asparticAcid-d3, cas: 284665-15-2, stock 43.2g, assay 95.2%, molecular formula: C₆H₆D₃NO₅, molecular weight: . |
| N-Acetyl-L-carnosine, cas: 56353-15-2, stock 24.6g, assay 98.3%, molecular formula: C₁₁H₁₆N₄O₄, molecular weight: . |
| N-Acetyl-L-cysteinemethylester, cas: 7652-46-2, stock 23.4g, assay 97.8%, molecular formula: C₆H₁₁NO₃S, molecular weight: . |
| N-Acetyl-L-cystine, cas: 25779-79-7, stock 44.6g, assay 97.8%, molecular formula: C₈H₁₄N₂O₅S₂, molecular weight: . |
| N-Acetyl-L-fucosamine, cas: , stock 43.6g, assay 98.7%, molecular formula: C₈H₁₅NO₅, molecular weight: . |
| N-Acetyl-L-glutamicAcid, cas: 1188-37-0, stock 17.7g, assay 97.5%, molecular formula: C₇H₁₁NO₅, molecular weight: . |
| N-Acetyl-L-glutamic-2,3,3,4,4-d5Acid, cas: , stock 36.4g, assay 97.9%, molecular formula: C₇H₆D₅NO₅, molecular weight: . |
| N-Acetyl-L-histidine, cas: 39145-52-3, stock 24.3g, assay 98%, molecular formula: C₈H₁₁N₃O₃ • H ₂O, molecular weight: . |
| N-Acetyl-L-histidine, cas: 01/02/2497, stock 12.8g, assay 96.7%, molecular formula: C₈H₁₁N₃O₃, molecular weight: . |
| N-Acetyl-L-histidineMethylEster, cas: 36097-48-0, stock 30.7g, assay 95.1%, molecular formula: C₉H₁₃N₃O₃, molecular weight: . |
| N-Acetyl-L-histidineMethylamide, cas: 09/11/6367, stock 18.2g, assay 95.3%, molecular formula: C₉H₁₄N₄O₂, molecular weight: . |
| N-Acetyl-L-isoglutamine, cas: 25460-87-1, stock 38g, assay 95.2%, molecular formula: C₇H₁₂N₂O₄, molecular weight: . |
| N-Acetyl-L-leucine-N-methylamide-d16, cas: 1276197-56-8, stock 14.1g, assay 99%, molecular formula: C₉H₂D₁₆N₂O₂, molecular weight: . |
| N-Acetyl-L-leucyl-L-α-glutamyl-L-threonyl-N-[2-oxo-4-(trifluoromethyl)-2H-1-benzopyran-7-yl]-L-α-asparagine, cas: 210345-02-1, stock 44.6g, assay 95.9%, molecular formula: C₃₁H₃₈F₃N₅O₁₂, molecular weight: . |
| N-Acetyl-L-phenylalanine, cas: 2018-61-3, stock 10.9g, assay 98%, molecular formula: C₁₁H₁₃NO₃, molecular weight: . |
| N-Acetyl-L-Tryptophan, cas: 1218-34-4, stock 26.6g, assay 97.9%, molecular formula: C₁₃H₁₄N₂O₃, molecular weight: . |
| N-Acetyl-L-tryptophanEthylEster, cas: 2382-80-1, stock 30.4g, assay 98.1%, molecular formula: C₁₅H₁₈N₂O₃, molecular weight: . |
| N-Acetyl-L-tryptophyl-L-α-glutamyl-L-histidyl-N-[2-oxo-4-(trifluoromethyl)-2H-1-benzopyran-7-yl]-L-α-asparagine, cas: 210344-99-3, stock 23.7g, assay 97%, molecular formula: C₃₈H₃₇F₃N₈O₁₁, molecular weight: . |
| N-Acetyl-L-tyrosine, cas: 537-55-3, stock 11.5g, assay 97.8%, molecular formula: C₁₁H₁₃NO₄, molecular weight: . |
| N-Acetyl-L-tyrosineAmide, cas: 1948-71-6, stock 12.8g, assay 98.8%, molecular formula: C₁₁H₁₄N₂O₃, molecular weight: . |
| N-Acetyl-L-tyrosineEthylEster, cas: 36546-50-6, stock 42.9g, assay 95.7%, molecular formula: C₁₃H₁₇NO₄ • H ₂O, molecular weight: . |
| N-Acetyl-L-valine, cas: 96-81-1, stock 13.7g, assay 98.3%, molecular formula: C₇H₁₃NO₃, molecular weight: . |
| N-Acetyl-Lys-OctreotideTrifluoroacetate, cas: N/A, stock 10.8g, assay 96.5%, molecular formula: C20H23N7O6 . Ca, molecular weight: 457.45 40.08. |
| N-Acetyl-N-(2,2-dimethoxyethyl)-2’-hydroxybenzylamine, cas: 1346604-58-7, stock 29.6g, assay 98.8%, molecular formula: C₁₃H₁₉NO₄, molecular weight: . |
| N-Acetyl-N,O-bis(tert-butoxycarbonyl)Serotonin, cas: 1329474-59-0, stock 37.7g, assay 98.4%, molecular formula: C₂₂H₃₀N₂O₆, molecular weight: . |
| N-Acetyl-N’-phenylurea, cas: 102-03-4, stock 33.9g, assay 96.4%, molecular formula: C₉H₁₀N₂O₂, molecular weight: . |
| N-Acetyl-N-21-(biotinylamino)-4,7,10,13,16,19-hexaoxaheneicosanoyl-3,5-diaminophenol-α-glucoside, cas: , stock 29.3g, assay 95.3%, molecular formula: C₃₉H₆₃N₅O₁₆S, molecular weight: . |
| N-Acetyl-N-9H-fluoren-2-yl-hydroxylamine-O-sulfonicAcidPotassiumSalt, cas: 74925-71-6, stock 19.4g, assay 96%, molecular formula: C₁₅H₁₂KNO₅S, molecular weight: . |
| N-AcetylneuraminicAcid, cas: 131-48-6, stock 29.3g, assay 98.7%, molecular formula: C11H19NO9, molecular weight: 309.27. |
| N-AcetylneuraminicAcidDimerDisodiumSalt, cas: 149331-75-9, stock 43.9g, assay 98.2%, molecular formula: C₂₂H₃₄N₂Na₂O₁₇, molecular weight: . |
| N-AcetylneuraminicAcid-d3, cas: 1312777-24-4, stock 28.1g, assay 97.8%, molecular formula: C11H16D3NO9, molecular weight: 312.29. |
| N-Acetyl-N-methyl-L-alanine, cas: 33099-03-5, stock 18.2g, assay 98.5%, molecular formula: C₆H₁₁NO₃, molecular weight: . |
| N-acetyl-N-methyl-β-Alanine, cas: 58706-66-4, stock 34g, assay 95.8%, molecular formula: C₆H₁₁NO₃, molecular weight: . |
| N-Acetyl-N-tert-butoxycarbonylSerotonin, cas: 1329837-64-0, stock 47.7g, assay 97.6%, molecular formula: C₁₇H₂₂N₂O₄, molecular weight: . |
| N-Acetyl-N-tert-butoxycarbonylSerotoninTri-O-acetyl-β-D-glucuronideMethylEster, cas: , stock 31.5g, assay 95.1%, molecular formula: C₃₀H₃₈N₂O₁₃, molecular weight: . |
| N-Acetyl-N-tert-butoxycarbonylSerotonin-d4, cas: , stock 20.5g, assay 97%, molecular formula: C₁₇H₁₈D₄N₂O₄, molecular weight: . |
| N-Acetyl-N-tert-butoxycarbonylSerotonin-d4Tri-O-acetyl-β-D-glucuronideMethylEster, cas: , stock 17.4g, assay 95.5%, molecular formula: C₃₀H₃₄D₄N₂O₁₃, molecular weight: . |
| N-Acetyl-N-tert-butoxycarbonyl-O-benzylSerotonin-d4, cas: , stock 14.1g, assay 98.5%, molecular formula: C₂₄H₂₄D₄N₂O₄, molecular weight: . |
| N-Acetyl-O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-Tyrosine2,5-Dioxo-1-pyrrolidinylEster, cas: 75937-15-4, stock 23g, assay 97.6%, molecular formula: C₂₁H₁₆I₄N₂O₇, molecular weight: . |
| N-Acetyl-O-phosphono-Tyr-GluDipentylamide, cas: 190078-50-3, stock 25g, assay 98.1%, molecular formula: C₂₆H₄₂N₃O₉P, molecular weight: . |
| N-Acetyl-O-phosphono-Tyr-Glu-Glu-Ile-Glu, cas: 159439-02-8, stock 19.6g, assay 97.2%, molecular formula: C₃₂H₄₆N₅O₁₇P, molecular weight: . |
| N-Acetyl-O-tert-butoxycarbonylSerotonin, cas: 1329624-51-2, stock 46.5g, assay 97.8%, molecular formula: C₁₇H₂₂N₂O₄, molecular weight: . |
| N-Acetyl-Phe-Octreotide, cas: N/A, stock 12.1g, assay 97.9%, molecular formula: C21H23N7O3S, molecular weight: 453.52. |
| N-Acetylpiperazine-d4, cas: 1398065-90-1, stock 15.9g, assay 98.5%, molecular formula: C₆H₈D₄N₂O, molecular weight: . |
| N-AcetylprocainamideHydrochloride, cas: 34118-92-8, stock 32.1g, assay 96.4%, molecular formula: C₁₅H₂₄ClN₃O₂, molecular weight: . |
| N-Acetylquinovosamine, cas: 40614-71-9, stock 37.5g, assay 95.9%, molecular formula: C₈H₁₅NO₅, molecular weight: . |
| N-Acetyl-S-(1,2-dichloroethenyl)-L-cysteine, cas: 2148-31-4, stock 42.2g, assay 97%, molecular formula: C₇H₉Cl₂NO₃S, molecular weight: . |
| N-Acetyl-S-(1,2-dichloroethenyl)-L-cysteine-13C,d3, cas: , stock 49g, assay 96.5%, molecular formula: C₆¹³CH₆D₃Cl₂NO₃S, molecular weight: . |
| N-Acetyl-S-(2-acetylaminoethyl)-L-cysteine, cas: 25515-72-4, stock 26.6g, assay 98.5%, molecular formula: C₉H₁₆N₂O₄S, molecular weight: . |
| N-Acetyl-S-(2-carbamoylethyl-d4)-L-cysteine, cas: , stock 21g, assay 95.1%, molecular formula: C₈H₁₀D₄N₂O₄S, molecular weight: . |
| N-Acetyl-S-(2-carboxyethyl)-L-cysteineBis(dicyclohexylamine)Salt, cas: 51868-61-2, stock 26g, assay 97.4%, molecular formula: C₃₂H₅₉N₃O₅S, molecular weight: . |
| N-Acetyl-S-(2-carboxyethyl)-L-cysteine-13C3Bis(dicyclohexylamine)Salt, cas: , stock 47.9g, assay 95.5%, molecular formula: C₂₉¹³C₃H₅₉N₃O₅S, molecular weight: . |
| N-Acetyl-S-(2-carboxypropyl)-L-cysteineBis(dicyclohexylammonium)Salt(MixtureofDiastereomers), cas: , stock 40.4g, assay 97.9%, molecular formula: C₉H₁₅NO₅S • 2( C₁₂H₂₃N), molecular weight: . |
| N-Acetyl-S-(2-carboxypropyl)-L-cysteineDisodiumSalt(MixtureofDiastereomers), cas: , stock 24.9g, assay 97.1%, molecular formula: C₉H₁₃NNa₂O₅S, molecular weight: . |
| N-Acetyl-S-(2-carboxypropyl)-L-cysteineEthylEster(MixtureofDiastereomers), cas: , stock 16.3g, assay 98.1%, molecular formula: C₁₁H₁₉NO₅S, molecular weight: . |
| N-Acetyl-S-(2-carboxypropyl)-L-cysteine-d3DicyclohexylammoniumSalt(MixtureofDiastereomers), cas: , stock 30.4g, assay 98.7%, molecular formula: C₂₁H₃₅D₃N₂O₅S, molecular weight: . |
| N-Acetyl-S-(2-cyanoethyl)-L-cysteineAmmoniumSalt, cas: 168208-30-8, stock 18.5g, assay 96.9%, molecular formula: C₈H₁₅N₃O₃S, molecular weight: . |
| N-Acetyl-S-(2-cyanoethyl)-L-cysteine-d3AmmoniumSalt, cas: , stock 38.6g, assay 99%, molecular formula: C₈H₁₂D₃N₃O₃S, molecular weight: . |
| N-Acetyl-S-(2-hydroxy-3-but-3-en-1-yl)-L-Cysteine+N-Acetyl-S-(1-hydroxybut-3-en-2-yl)-L-Cysteine(Approximately1:1Mixture), cas: , stock 16.4g, assay 96%, molecular formula: C₉H₁₅NO₄S, molecular weight: . |
| N-Acetyl-S-(2-hydroxy-3-but-3-en-1-yl)-L-Cysteine1,2,3-13C3,15N+N-Acetyl-S-(1-hydroxybut-3-en-2-yl)-L-Cysteine1,2,3-13C3,15N(Approximately1:1Mixture), cas: , stock 41.8g, assay 96.6%, molecular formula: C₆¹³C₃H₁₅¹⁵NO₄S, molecular weight: . |
| N-Acetyl-S-(2-hydroxy-3-propionamide)-L-cysteine, cas: 137698-08-9, stock 37g, assay 95.5%, molecular formula: C₈H₁₄N₂O₅S, molecular weight: . |
| N-Acetyl-S-(2-hydroxy-3-propionamide)-L-cysteineDicyclohexylammoniumSalt, cas: , stock 18.7g, assay 97.2%, molecular formula: C₂₀H₃₇N₃O₅S, molecular weight: . |
| N-Acetyl-S-(2-hydroxy-3-propionamide)-L-cysteine-d3DicyclohexylammoniumSalt, cas: , stock 43g, assay 97.4%, molecular formula: C₂₀H₃₄D₃N₃O₅S, molecular weight: . |
| N-Acetyl-S-(2-hydroxyethyl)-L-cysteineDicyclohexylammoniumSalt, cas: 1331896-18-4, stock 25.3g, assay 97%, molecular formula: C₁₉H₃₆N₂O₄S, molecular weight: . |
| N-Acetyl-S-(2-hydroxyethyl-d4)-L-cysteineDicyclohexylamineSalt, cas: 1331894-57-5, stock 33.9g, assay 95.3%, molecular formula: C₁₉H₃₂D₄N₂O₄S, molecular weight: . |
| N-Acetyl-S-(2-hydroxypropyl)cysteineDicyclohexylammoniumSalt, cas: 38130-86-8, stock 28.3g, assay 98%, molecular formula: C₂₀H₃₈N₂O₄S, molecular weight: . |
| N-Acetyl-S-(2-hydroxypropyl)cysteine-d3DicyclohexylammoniumSalt, cas: 1356934-59-2, stock 32.4g, assay 97.3%, molecular formula: C₂₀H₃₅D₃N₂O₄S, molecular weight: . |
| N-Acetyl-S-(2-hydroxypropyl)Cysteine-d6DicyclohexylammoniumSalt, cas: N/A, stock 40.2g, assay 96.7%, molecular formula: N/A, molecular weight: N/A. |
| N-Acetyl-S-(3-amino-2-hydroxy-3-oxopropyl)-L-cysteine-1,1-dimethylethylEster, cas: 1079950-08-5, stock 45.7g, assay 96.7%, molecular formula: C₁₂H₂₂N₂O₅S, molecular weight: . |
| N-Acetyl-S-(3-carboxy-2-propyl)-L-cysteineDisodiumSalt(MixtureofDiastereomers), cas: 1041285-62-4, stock 20.6g, assay 95.4%, molecular formula: C₉H₁₃NNa₂O₅S, molecular weight: . |
| N-Acetyl-S-(3-carboxy-2-propyl)-L-cysteine-d3DisodiumSalt, cas: 1356933-73-7, stock 48.9g, assay 95.7%, molecular formula: C₉H₁₀D₃NNa₂O₅S, molecular weight: . |
| N-Acetyl-S-(3-hydroxypropyl)cysteineDicyclohexylammoniumSalt, cas: , stock 36.1g, assay 96.7%, molecular formula: C₂₀H₃₈N₂O₄S, molecular weight: . |
| N-Acetyl-S-(3-hydroxypropyl-1,1,2,2,3,3-D6)cysteine,DicyclohexylammoniumSalt, cas: , stock 26.4g, assay 95.4%, molecular formula: C₂₀H₃₂D₆N₂O₄S, molecular weight: . |
| N-Acetyl-S-(3-hydroxypropyl-1-methyl)-L-cysteineDicyclohexylammoniumSalt(MixtureofDiastereomers), cas: 33164-70-4, stock 11.2g, assay 98%, molecular formula: C₂₁H₄₀N₂O₄S, molecular weight: . |
| N-Acetyl-S-(4-chloro-3-oxobutyl)-L-cysteine, cas: 1370697-78-1, stock 10.2g, assay 98.5%, molecular formula: C₉H₁₄ClNO₄S, molecular weight: . |
| N-Acetyl-S-(9,10-dihydro-10-hydroxy-9-phenanthrenyl)-L-cysteine, cas: 572-46-3, stock 24g, assay 98.9%, molecular formula: C₁₉H₁₉NO₄S, molecular weight: . |
| N-Acetyl-S-(9,10-dihydro-9-hydroxy-10-phenanthryl)-L-cysteine, cas: , stock 37.7g, assay 96.5%, molecular formula: C₁₈H₁₇NO₅S, molecular weight: . |
| N-Acetyl-S-(carbamoylethyl)-L-cysteine, cas: 81690-92-8, stock 21g, assay 95.4%, molecular formula: C₈H₁₄N₂O₄S, molecular weight: . |
| N-Acetyl-S-(carbamoylethyl)-L-cysteine-13C3, cas: , stock 27.6g, assay 95.7%, molecular formula: C₅¹³C₃H₁₄N₂O₄S, molecular weight: . |
| N-Acetyl-S-(carbamoylethyl)-L-cysteine-d3, cas: 1795786-57-0, stock 34.3g, assay 96.3%, molecular formula: C₈H₁₁D₃N₂O₄S, molecular weight: . |
| N-Acetyl-S-(methylphenyl-13C6)-L-cysteine, cas: , stock 28.4g, assay 98.2%, molecular formula: C₆¹³C₆H₁₅NO₃S, molecular weight: . |
| N-Acetyl-S-(propyl-d7)-L-cysteine, cas: 1331909-69-3, stock 14.1g, assay 95.7%, molecular formula: C₈H₈D₇NO₃S, molecular weight: . |
| N-Acetyl-S-(trichlorovinyl)-L-cysteine, cas: 111348-61-9, stock 19g, assay 95.9%, molecular formula: C₇H₈Cl₃NO₃S, molecular weight: . |
| N-Acetyl-S-(trichlorovinyl)-L-cysteine-d3, cas: 1346616-95-2, stock 32g, assay 96.4%, molecular formula: C₇H₅D₃Cl₃NO₃S, molecular weight: . |
| N-Acetyl-S-[2-amino-1-(hydroxymethyl)-2-oxoethyl]-L-cysteine-1,1-dimethylethylEster, cas: 1079950-10-9, stock 15.2g, assay 95.7%, molecular formula: C₁₂H₂₂N₂O₅S, molecular weight: . |
| N-Acetyl-S-[4-(2-pyridinyl)benzyl]-L-cysteine, cas: 1391068-09-9, stock 29.3g, assay 97%, molecular formula: C₁₇H₁₈N₂O₃S, molecular weight: . |
| N-Acetyl-S-3-Hydroxypropylcysteine-d6, cas: N/A, stock 17.1g, assay 95.9%, molecular formula: C19H22N6, molecular weight: 334.43. |
| N-Acetyl-S-allyl-L-cysteine, cas: 23127-41-5, stock 30g, assay 98.9%, molecular formula: C₈H₁₃NO₃S, molecular weight: . |
| N-Acetyl-SB-611855GlucuronideDisodiumSalt, cas: , stock 35.6g, assay 95.3%, molecular formula: C₂₁H₁₉NNa₂O₁₀, molecular weight: . |
| N-Acetyl-S-benzyl-2,3,4,5,6-d5-L-cysteine, cas: , stock 49g, assay 98.3%, molecular formula: C₁₂H₁₀D₅NO₃S, molecular weight: . |
| N-Acetyl-S-benzyl-d5-L-cysteine, cas: , stock 29.9g, assay 98.5%, molecular formula: C₁₂H₁₀D₅NO₃S, molecular weight: . |
| N-Acetyl-S-benzyl-L-cysteine, cas: 19542-77-9, stock 10.2g, assay 95.3%, molecular formula: C₁₂H₁₅NO₃S, molecular weight: . |
| N-Acetyl-S-ethyl-L-cysteine, cas: 31386-36-4, stock 19.9g, assay 95.9%, molecular formula: C₇H₁₃NO₃S, molecular weight: . |
| N-Acetyl-S-ethyl-L-cysteine-d5, cas: 1279033-91-8, stock 26g, assay 97%, molecular formula: C₇H₈D₅NO₃S, molecular weight: . |
| N-Acetyl-S-methyl-L-cysteine, cas: 16637-59-5, stock 11.8g, assay 95.5%, molecular formula: C₆H₁₁NO₃S, molecular weight: . |
| N-Acetyl-S-methyl-L-cysteine-d3, cas: 1279039-06-3, stock 28.5g, assay 95.7%, molecular formula: C₆H₈D₃NO₃S, molecular weight: . |
| N-Acetyl-S-phenyl-d5-DL-cysteine, cas: , stock 14.3g, assay 96.4%, molecular formula: C₁₁H₈D₅NO₃S, molecular weight: . |
| N-Acetyl-S-phenyl-DL-cysteine-3,3-d2, cas: , stock 17.2g, assay 98.6%, molecular formula: C₁₁H₁₁D₂NO₃S, molecular weight: . |
| N-Acetyl-S-propyl-L-cysteine, cas: 14402-54-1, stock 48.7g, assay 97.8%, molecular formula: C₈H₁₅NO₃S, molecular weight: . |
| N-Acetylsulfanilylchloride, cas: 121-60-8, stock 25.1g, assay 98.4%, molecular formula: C8H8ClNO3S, molecular weight: 233.67. |
| N-Acetylsulfathiazole(~90%), cas: 127-76-4, stock 18.8g, assay 97.2%, molecular formula: C₁₁H₁₁N₃O₃S₂, molecular weight: . |
| N-Acetylsulfathiazole-d4, cas: N/A, stock 38.9g, assay 96.7%, molecular formula: C5H2D5NO3, molecular weight: 134.15. |
| N-Acetylsulfathiazole-d4(Major), cas: 1020718-91-5, stock 15.2g, assay 97%, molecular formula: C₁₁H₇D₄N₃O₃S₂, molecular weight: . |
| N-Acetylthiourea, cas: 591-08-2, stock 13.2g, assay 98.1%, molecular formula: C₃H₆N₂OS, molecular weight: . |
| N-Acetyltryptamine, cas: 1016-47-3, stock 30.9g, assay 95.1%, molecular formula: C₁₂H₁₄N₂O, molecular weight: . |
| N-Acetyl-tryptophan, cas: 87-32-1, stock 24.8g, assay 96.3%, molecular formula: C₁₃H₁₄N₂O₃, molecular weight: . |
| N-Acetyl-Tyr-Val-Ala-Asp-7-amido-4-trifluoromethylcoumarin, cas: 219137-85-6, stock 30.9g, assay 95.3%, molecular formula: C₃₃H₃₆F₃N₅O₁₀, molecular weight: . |
| N-Acetyl-Tyr-Val-Ala-Asp-7-amido-4-trifluoromethylcoumarinTFASalt, cas: , stock 48.4g, assay 97%, molecular formula: C₃₃H₃₆F₃N₅O₁₀ • C₂HF₃O₂, molecular weight: . |
| N-Acetyl-α-cyano-p-benzoyl-D,L-phenylalanineEthylEster, cas: 104504-38-3, stock 14.4g, assay 98.5%, molecular formula: C₂₁H₂₀N₂O₄, molecular weight: . |
| N-Acetyl-β-alanine, cas: 3025-95-4, stock 20.7g, assay 98.3%, molecular formula: C₅H₉NO₃, molecular weight: . |
| N-Acetyl-β-alanineN-HydroxysuccinimideEster, cas: 154194-69-1, stock 19.2g, assay 96.9%, molecular formula: C₉H₁₂N₂O₅, molecular weight: . |
| N-Acetyl-β-alanine-d3, cas: , stock 16.9g, assay 95.6%, molecular formula: C₅H₆D₃NO₃, molecular weight: . |
| N-Acetyl-β-D-Glucosamine6-Acetate1,3,4-TribenzylEther, cas: 129729-33-5, stock 44.9g, assay 98.4%, molecular formula: C₃₁H₃₅NO₇, molecular weight: . |
| N-Acetyl-γ-carbethoxyHomotryptophanEthylEster, cas: 351421-21-1, stock 31.8g, assay 98.6%, molecular formula: C₁₉H₂₄N₂O₅, molecular weight: . |
| NAcM-OPT, cas: 2089293-61-6, stock 10.6g, assay 98.3%, molecular formula: C₂₃H₂₉Cl₂N₃O, molecular weight: . |
| N-Acryloyl-1-pyrenebutylamine, cas: 133399-57-2, stock 13.1g, assay 96.3%, molecular formula: C₂₃H₂₁NO, molecular weight: . |
| Nadifloxacin, cas: 124858-35-1, stock 42g, assay 96.2%, molecular formula: C₁₉H₂₁FN₂O₄, molecular weight: . |
| NadifloxacinImpurity1, cas: 87488-29-7, stock 23.9g, assay 97.5%, molecular formula: , molecular weight: . |
| NadifloxacinImpurity2, cas: 130539-72-9, stock 20.6g, assay 97.7%, molecular formula: , molecular weight: . |
| NadifloxacinImpurity3, cas: N/A, stock 20.3g, assay 96%, molecular formula: C31H39ClN2O10, molecular weight: 635.11. |
| NadifloxacinImpurity4, cas: N/A, stock 20.9g, assay 95.8%, molecular formula: C20H25ClN2, molecular weight: 328.88. |
| NadifloxacinImpurity6(S-NadifloxacinSulfateSodiumSalt), cas: , stock 32g, assay 98.9%, molecular formula: , molecular weight: . |
| NadifloxacinImpurity7, cas: 80076-47-7, stock 29.2g, assay 97.6%, molecular formula: , molecular weight: . |
| Nadifloxacin-d9, cas: , stock 48.5g, assay 97.6%, molecular formula: C₁₉H₁₂D₉FN₂O₄, molecular weight: . |
| Nadifloxacin-d9, cas: , stock 36.1g, assay 96.1%, molecular formula: , molecular weight: . |
| Nadolol, cas: 42200-33-9, stock 15.4g, assay 98%, molecular formula: C17H27NO4, molecular weight: 309.4. |
| Nadolol(MixtureofDiastereomers), cas: 220045-89-6, stock 26.8g, assay 97.1%, molecular formula: C17H27NO4, molecular weight: 309.41. |
| NadololD9, cas: 1432056-38-6, stock 26.4g, assay 96.9%, molecular formula: C17H18NO4D9, molecular weight: 318.46. |
| NadololD9, cas: 94513-92-5, stock 28.9g, assay 98%, molecular formula: C17H18D9NO4, molecular weight: 318.46. |
| NadololEPImpurityA, cas: N/A, stock 38.5g, assay 97.5%, molecular formula: C13H18O5, molecular weight: 254.29. |
| NadololEPImpurityA, cas: NA, stock 23g, assay 97.4%, molecular formula: C13H18O5, molecular weight: 254.3. |
| NadololEPImpurityA(MixtureofDiastereomers), cas: N/A, stock 35.6g, assay 95.1%, molecular formula: C19H18N2O, molecular weight: 290.37. |
| NadololEPImpurityB, cas: N/A, stock 28.3g, assay 98.7%, molecular formula: C14H20O5, molecular weight: 268.3. |
| NadololEPImpurityB, cas: NA, stock 45g, assay 96.1%, molecular formula: C14H20O5, molecular weight: 268.3. |
| NadololEPImpurityC, cas: N/A, stock 46.2g, assay 98.7%, molecular formula: C23H28O7, molecular weight: 416.46. |
| NadololEPImpurityC, cas: NA, stock 38.3g, assay 97.8%, molecular formula: C23H28O7, molecular weight: 416.5. |
| NadololEPImpurityC(MixtureofDiastereomers), cas: N/A, stock 10.3g, assay 97.1%, molecular formula: C14H12ClN3O4S2, molecular weight: 385.84. |
| NadololEPImpurityD, cas: 67247-26-1, stock 42g, assay 97.2%, molecular formula: C30H43NO8, molecular weight: 545.7. |
| NadololEPImpurityD, cas: N/A, stock 31.2g, assay 96.2%, molecular formula: C30H43NO8, molecular weight: 545.68. |
| NadololEPImpurityD(MixtureofDiastereomers), cas: N/A, stock 46.8g, assay 97.4%, molecular formula: C66H75Cl2N9O24. HCl, molecular weight: 1449.29 36.46. |
| NadololEPImpurityE, cas: 67247-33-0, stock 37.1g, assay 95.6%, molecular formula: C17H26INO4, molecular weight: 435.3. |
| NadololEPImpurityE, cas: N/A, stock 39g, assay 95.7%, molecular formula: C14H18O, molecular weight: 202.30. |
| NadololEPImpurityF, cas: 2116-22-5, stock 49.8g, assay 96.9%, molecular formula: C17H23NO2, molecular weight: 273.4. |
| NadololEPImpurityG, cas: 33841-03-1, stock 24.1g, assay 97.5%, molecular formula: C17H27NO2, molecular weight: 277.4. |
| NadololEpoxideImpurity, cas: 35697-15-5, stock 22.5g, assay 96.4%, molecular formula: C13H16O4, molecular weight: 236.26. |
| NadololImpurity1, cas: N/A, stock 10.5g, assay 97.3%, molecular formula: C30H23I5N2O8, molecular weight: 1174.04. |
| NadololImpurity1, cas: NA, stock 38.5g, assay 97.2%, molecular formula: C26H35NO8, molecular weight: 489.57. |
| NadololImpurity3, cas: 685850-87-7, stock 16.3g, assay 98.5%, molecular formula: C10H12O3, molecular weight: 180.20. |
| NadololImpurity4HCl, cas: N/A, stock 21.9g, assay 98.5%, molecular formula: C33H30N8O4, molecular weight: 602.66. |
| NadololImpurity5HCl, cas: N/A, stock 32.4g, assay 96.9%, molecular formula: C19H30N2O3, molecular weight: 334.46. |
| NadololImpurity6, cas: N/A, stock 26.6g, assay 95.5%, molecular formula: C11H24N4, molecular weight: 212.34. |
| NadololImpurity7HCl, cas: N/A, stock 26.3g, assay 95.3%, molecular formula: C20H32F2O5, molecular weight: 390.47. |
| NadololImpurity8, cas: N/A, stock 11.7g, assay 97.9%, molecular formula: C16H20O3, molecular weight: 260.33. |
| NadololImpurity9, cas: N/A, stock 16.6g, assay 95.8%, molecular formula: C9H12ClNO6S2, molecular weight: 329.78. |
| NadololImpurityB(MixtureofDiastereomers), cas: N/A, stock 16.4g, assay 96.8%, molecular formula: C24H31ClO7, molecular weight: 466.96. |
| Nadolol-d9, cas: 1246820-10-9, stock 43.4g, assay 98.7%, molecular formula: C₁₇H₁₈D₉NO₄, molecular weight: . |
| NadoxololHCl, cas: 35991-93-6, stock 33g, assay 96.1%, molecular formula: C14H16N2O3. HCl, molecular weight: 260.29 36.46. |
| NADP-13C10, cas: , stock 20.3g, assay 95.4%, molecular formula: C₁₁¹³C₁₀H₂₈N₇O₁₇P₃, molecular weight: . |
| NADPH(Tetracyclohexanamine), cas: 100929-71-3, stock 35.8g, assay 98.8%, molecular formula: C₂₁H₃₀N₇O₁₇P₃ • ₄C₆H₁₃N, molecular weight: . |
| NADPHImpurity1, cas: N/A, stock 19.1g, assay 95.3%, molecular formula: C17H14ClN3O3, molecular weight: 343.77. |
| NADPH-13C10, cas: , stock 25.9g, assay 95.5%, molecular formula: C₁₁¹³C₁₀H₃₀N₇O₁₇P₃, molecular weight: . |
| NadroparinSodium(HeparinSodium), cas: 2608411, stock 28.2g, assay 97.8%, molecular formula: , molecular weight: 8000-25000. |
| Nafadotride, cas: 149649-22-9, stock 14.7g, assay 98.9%, molecular formula: C₂₂H₂₇N₃O₂, molecular weight: . |
| NafamostatMesylate, cas: 82956-11-4, stock 35.1g, assay 95.8%, molecular formula: , molecular weight: . |
| Nafamostat-d4, cas: N/A, stock 49.7g, assay 96%, molecular formula: C13H13N3O, molecular weight: 227.27. |
| Nafarelin, cas: 76932-56-4, stock 10.9g, assay 98.3%, molecular formula: C66H83N17O13. [C2H4O2]n, molecular weight: 1322.50 (60.05]n. |
| NafarelinTrifluoroaceticAcidSalt, cas: , stock 15.2g, assay 95.5%, molecular formula: C₆₆H₈₃N₁₇O₁₃ • x(C ₂HF₃O₂), molecular weight: . |
| NafcillinImpurity1, cas: N/A, stock 36.5g, assay 98.5%, molecular formula: C18H24O5, molecular weight: 320.39. |
| NafcillinImpurity2, cas: N/A, stock 46.5g, assay 95.6%, molecular formula: C25H19I6NO6, molecular weight: 1190.85. |
| NafcillinImpurity3, cas: N/A, stock 48.9g, assay 96.2%, molecular formula: C20H26O3, molecular weight: 314.43. |
| NafcillinImpurity4, cas: 983-86-8, stock 47.2g, assay 98.7%, molecular formula: C20H20N2O5S, molecular weight: 400.46. |
| NafcillinImpurity5, cas: N/A, stock 12.8g, assay 97.9%, molecular formula: C15H18O4, molecular weight: 262.31. |
| NafcillinImpurity6, cas: N/A, stock 13.5g, assay 98.4%, molecular formula: C26H40O6, molecular weight: 448.60. |
| NafcillinImpurity7, cas: 57628-08-7, stock 12.3g, assay 97.1%, molecular formula: C22H24N2O5S, molecular weight: 428.51. |
| NafcillinPenilloicAcid(MixtureofDiastereomers), cas: 940306-31-0, stock 47.4g, assay 96.5%, molecular formula: C₂₁H₂₄N₂O₆S, molecular weight: . |
| NafcillinPenilloicAcidMethylEster, cas: , stock 30.3g, assay 96.8%, molecular formula: C₂₂H₂₆N₂O₆S, molecular weight: . |
| NafcillinSodiumSalt, cas: 985-16-0, stock 17.9g, assay 97.7%, molecular formula: C₂₁H₂₁N₂NaO₅S, molecular weight: . |
| NafcillinSulfoxide, cas: 41061-20-5, stock 37.8g, assay 96.3%, molecular formula: C₂₁H₂₂N₂O₆S, molecular weight: . |
| Nafcillin-d5SodiumSalt, cas: 1356354-25-0, stock 47.9g, assay 97.4%, molecular formula: C₂₁H₁₆D₅N₂NaO₅S, molecular weight: . |
| Nafion, cas: 31175-20-9, stock 39.3g, assay 96.2%, molecular formula: C₅H₂F₁₀O₅S • (C ₂F₄)m • (C ₂F₃)n, molecular weight: . |
| NafoxidineHydrochloride, cas: 1847-63-8, stock 33.6g, assay 97.2%, molecular formula: C₂₉H₃₂ClNO₂, molecular weight: . |
| Nafoxidine-d5Hydrochloride, cas: 1794766-71-4, stock 15.8g, assay 98.4%, molecular formula: C₂₉H₂₇D₅BrNO₂, molecular weight: . |
| Nafronyl, cas: 31329-57-4, stock 25.6g, assay 95.2%, molecular formula: C₂₄H₃₃NO₃, molecular weight: . |
| NafronylOxalate, cas: 474972, stock 10.1g, assay 96.6%, molecular formula: C24H33NO3. C2H2O4, molecular weight: 383.54 90.04. |
| Nafronyl-d4, cas: 1215649-28-7, stock 23.1g, assay 96%, molecular formula: C₂₄H₂₉D₄NO₃, molecular weight: . |
| Naftalofos, cas: 1491-41-4, stock 34.3g, assay 98.5%, molecular formula: C₁₆H₁₆NO₆P, molecular weight: . |
| Naftazonebeta-DGlucoronide, cas: N/A, stock 27.2g, assay 96.5%, molecular formula: C26H40O5, molecular weight: 432.61. |
| Naftazone-d6beta-DGlucoronide, cas: N/A, stock 14.8g, assay 98.3%, molecular formula: C22H32O3, molecular weight: 344.50. |
| NaftidrofurylEPImpurityA, cas: N/A, stock 37.8g, assay 95.4%, molecular formula: C9H9NO5, molecular weight: 211.18. |
| NaftidrofurylHydrogenOxalate, cas: 3200-06-4, stock 23.2g, assay 98.2%, molecular formula: C22H29NO6, molecular weight: 403.47. |
| NaftidrofurylImpurity1, cas: N/A, stock 36.7g, assay 98%, molecular formula: C20H22N2O7. HCl, molecular weight: 402.41 36.46. |
| NaftifineHydrochloride, cas: 65473-14-5, stock 19.6g, assay 97.3%, molecular formula: C₂₁H₂₂ClN, molecular weight: . |
| NaftifineImpurity1, cas: N/A, stock 17g, assay 95.2%, molecular formula: C20H23ClN2O, molecular weight: 342.87. |
| NaftifineImpurity10HCl, cas: N/A, stock 30.9g, assay 95.2%, molecular formula: C13H22N6O7, molecular weight: 374.35. |
| NaftifineImpurity11, cas: N/A, stock 32.9g, assay 95.4%, molecular formula: C22H25ClN2O2, molecular weight: 384.91. |
| NaftifineImpurity2HCl, cas: N/A, stock 41.6g, assay 97.7%, molecular formula: C38H46N4O2S3, molecular weight: 686.99. |
| NaftifineImpurity3, cas: 98977-93-6, stock 29.3g, assay 96.8%, molecular formula: C21H21NO, molecular weight: 303.41. |
| NaftifineImpurity4, cas: 98977-94-7, stock 43.6g, assay 95.5%, molecular formula: C21H23NO, molecular weight: 305.42. |
| NaftifineImpurity6, cas: 16413-71-1, stock 23.2g, assay 96.7%, molecular formula: C13H15N, molecular weight: 185.27. |
| NaftifineImpurity7, cas: N/A, stock 29.7g, assay 98.1%, molecular formula: C22H23BrN2O2, molecular weight: 427.34. |
| NaftifineImpurity8, cas: 98978-29-1, stock 25.7g, assay 95.7%, molecular formula: C21H21NO, molecular weight: 303.41. |
| NaftifineImpurity9, cas: 98978-36-0, stock 49.2g, assay 97.1%, molecular formula: C21H23NO, molecular weight: 305.42. |
| NaftifineN-Oxide(90%), cas: , stock 17.6g, assay 98.9%, molecular formula: C₂₁H₂₁NO, molecular weight: . |
| Naftifine-d3Hydrochloride, cas: 1246833-81-7, stock 14.2g, assay 96.5%, molecular formula: C₂₁H₁₉D₃ClN, molecular weight: . |
| Naftifine-d5, cas: N/A, stock 39.7g, assay 96.5%, molecular formula: C22H21ClN2O2, molecular weight: 380.87. |
| Naftopidil, cas: 57149-07-2, stock 48g, assay 95.6%, molecular formula: C₂₄H₂₈N₂O₃, molecular weight: . |
| NaftopidilDihydrochloride, cas: 57149-08-3, stock 36.3g, assay 95%, molecular formula: C₂₄H₃₀Cl₂N₂O₃, molecular weight: . |
| NaftopidilHydrochloride, cas: 1164469-60-6, stock 17.3g, assay 96%, molecular formula: C₂₄H₂₈N₂O₃ • HCl, molecular weight: . |
| NaftopidilImpurity2, cas: N/A, stock 38.4g, assay 97.2%, molecular formula: C16H12I4NO4. Na, molecular weight: 789.90 22.99. |
| NaftopidilImpurity3, cas: N/A, stock 31.2g, assay 95.5%, molecular formula: C23H30FN5O3, molecular weight: 443.52. |
| NaftopidilImpurity4, cas: N/A, stock 18g, assay 97.7%, molecular formula: C15H20O3, molecular weight: 248.32. |
| NaftopidilImpurity5, cas: N/A, stock 13.3g, assay 97.7%, molecular formula: C25H38O5, molecular weight: 418.57. |
| Naftopidil-d3, cas: , stock 30.6g, assay 96.4%, molecular formula: C₂₄H₂₅D₃N₂O₃, molecular weight: . |
| Naftoxate, cas: 28820-28-2, stock 43.4g, assay 97%, molecular formula: C₁₉H₁₄N₂OS₂, molecular weight: . |
| Nahlsgen, cas: 926281-37-0, stock 17.6g, assay 97.7%, molecular formula: C₁₃H₁₈NO₇P, molecular weight: . |
| NalbuphineImpurity6, cas: 20410-98-4, stock 19.4g, assay 97.6%, molecular formula: , molecular weight: . |
| Naldemedine, cas: 916072-89-4, stock 11.9g, assay 98.8%, molecular formula: C32H34N4O6, molecular weight: 570.65. |
| Naldemedined5, cas: , stock 49.2g, assay 96.2%, molecular formula: , molecular weight: . |
| Naldemedined6, cas: , stock 36.2g, assay 98.5%, molecular formula: , molecular weight: . |
| Naled, cas: 300-76-5, stock 27.7g, assay 97.1%, molecular formula: C₄H₇Br₂Cl₂O₄P, molecular weight: . |
| Naled-d6, cas: 1216605-57-0, stock 35.6g, assay 96.6%, molecular formula: C₄HD₆Br₂Cl₂O₄P, molecular weight: . |
| NalfurafineHCl, cas: 152658-17-8, stock 13.1g, assay 98.5%, molecular formula: , molecular weight: . |
| NalfurafineImpurity7, cas: 539-47-9, stock 44g, assay 95.9%, molecular formula: , molecular weight: . |
| NalidixicAcid, cas: 389-08-2, stock 20.2g, assay 95%, molecular formula: C12H12N2O3, molecular weight: 232.24. |
| N-Alloc-L-valyl-L-alanine, cas: 330970-70-2, stock 26.6g, assay 97.5%, molecular formula: C₁₂H₂₀N₂O₅, molecular weight: . |
| N-AllylGlycineHydrochloride, cas: 3182-78-3, stock 39.8g, assay 98.1%, molecular formula: C₅H₉NO₂ • HCl, molecular weight: . |
| N-Allyl-2-hydroxybenzamide, cas: 118-62-7, stock 28.2g, assay 98.1%, molecular formula: C₁₀H₁₁NO₂, molecular weight: . |
| N-Allyl-3-chloro-5-(trifluoromethyl)pyridin-2-amine, cas: 338761-50-5, stock 42.1g, assay 98.5%, molecular formula: C₉ H₁₁ Cl N ₂, molecular weight: . |
| N-Allylbenzylamine, cas: 4383-22-6, stock 47.6g, assay 96.7%, molecular formula: C₁₀H₁₃N, molecular weight: . |
| N-Allyldibutylamine, cas: 53826-28-1, stock 47.6g, assay 95.9%, molecular formula: C₁₁H₂₃N, molecular weight: . |
| N-Allyl-N’-(2-cyanophenyl)urea, cas: 122372-27-4, stock 46.2g, assay 98.9%, molecular formula: C₁₁H₁₁N₃O, molecular weight: . |
| N-Allyl-N-cyclopentylamine, cas: 55611-39-7, stock 33.9g, assay 95.1%, molecular formula: C₈H₁₅N, molecular weight: . |
| N-Allyloxycarbonyl8-EthoxyMoxifloxacinEthylEster, cas: 1329840-03-0, stock 42.5g, assay 97.1%, molecular formula: C₂₈H₃₄FN₃O₆, molecular weight: . |
| N-AllyloxycarbonylMoxifloxacin, cas: 1391053-44-3, stock 29.7g, assay 98.6%, molecular formula: C₂₅H₂₈FN₃O₆, molecular weight: . |
| N-AllyloxycarbonylMoxifloxacin-d4, cas: , stock 15.9g, assay 98.8%, molecular formula: C₂₅H₂₄D₄FN₃O₆, molecular weight: . |
| N-Allyloxycarbonyl-4-piperidone, cas: 306296-67-3, stock 46.5g, assay 97.9%, molecular formula: C₉H₁₃NO₃, molecular weight: . |
| N-Allyloxycarbonyl-β-lactosamine, cas: 209977-55-9, stock 20.9g, assay 98.7%, molecular formula: C₁₆H₂₇NO₁₂, molecular weight: . |
| N-Allyloxyphthalimide, cas: 39020-79-6, stock 13.2g, assay 97.4%, molecular formula: C₁₁H₉NO₃, molecular weight: . |
| N-Allylphenothiazine, cas: 20962-92-9, stock 35.2g, assay 96.1%, molecular formula: C₁₅H₁₃NS, molecular weight: . |
| N-Allyl-p-toluenesulfonamide, cas: 50487-71-3, stock 26.4g, assay 97.8%, molecular formula: C₁₀H₁₃NO₂S, molecular weight: . |
| N-Allylthiourea, cas: 109-57-9, stock 29.2g, assay 96.9%, molecular formula: C₄H₈N₂S, molecular weight: . |
| Nalmefene, cas: 55096-26-9, stock 34.1g, assay 95.6%, molecular formula: C₂₁H₂₅NO₃, molecular weight: . |
| Nalmefene3-O-GlucuronideSodiumSalt, cas: N/A, stock 30.4g, assay 98.3%, molecular formula: C14H12N4O3, molecular weight: 284.28. |
| Nalmefene3-O-sulfate, cas: N/A, stock 21.6g, assay 95.1%, molecular formula: C21H27N3O6, molecular weight: 417.46. |
| NalmefeneHCl, cas: 58895-64-0, stock 39.2g, assay 96.6%, molecular formula: C21H25NO3. HCl, molecular weight: 339.44 36.46. |
| NalmefeneImpurity1, cas: 144265-45-2, stock 42.9g, assay 98.9%, molecular formula: C22H27NO3, molecular weight: 353.46. |
| NalmefeneImpurity11, cas: 91598-83-3, stock 32.9g, assay 96.9%, molecular formula: , molecular weight: . |
| NalmefeneImpurity12(MixtureofDiastereomers), cas: N/A, stock 41.7g, assay 97.6%, molecular formula: C48H61N3O16, molecular weight: 936.02. |
| NalmefeneImpurity2, cas: 176220-84-1, stock 42.6g, assay 95.5%, molecular formula: , molecular weight: . |
| NalmefeneImpurity2, cas: N/A, stock 30g, assay 98.4%, molecular formula: C23H29ClO6, molecular weight: 436.94. |
| NalmefeneImpurity3, cas: 42971-33-5, stock 26.2g, assay 98.1%, molecular formula: , molecular weight: . |
| NalmefeneImpurity3, cas: 738552-29-9, stock 44.2g, assay 98.2%, molecular formula: C21H25NO3, molecular weight: 339.44. |
| NalmefeneImpurity4, cas: N/A, stock 47.7g, assay 98.3%, molecular formula: C9H10ClNO4S2, molecular weight: 295.75. |
| NalmefeneImpurity5(MixtureofIsomers), cas: N/A, stock 47.3g, assay 96.9%, molecular formula: C15H18O3, molecular weight: 246.31. |
| NalmefeneImpurity6(MixtureofDiastereomers), cas: N/A, stock 38.3g, assay 96.2%, molecular formula: C29H34N2O4, molecular weight: 474.60. |
| NalmefeneImpurity7, cas: N/A, stock 44.3g, assay 98.9%, molecular formula: C9H9I2NO3, molecular weight: 432.99. |
| NalmefeneImpurity8, cas: N/A, stock 42.5g, assay 95.1%, molecular formula: C19H23BrN2O3. HCl, molecular weight: 407.31 36.46. |
| NalmefeneImpurity9, cas: 1058708-33-0, stock 22.1g, assay 95.2%, molecular formula: C21H25NO2, molecular weight: 323.44. |
| Nalmefene-d3, cas: , stock 30.2g, assay 98.2%, molecular formula: C₂₁H₂₂D₃NO₃, molecular weight: . |
| Nalmefene-d4, cas: N/A, stock 32.8g, assay 97.7%, molecular formula: C22H24N2O2. HCl, molecular weight: 348.45 36.46. |
| Naloxegol-d5Oxalate, cas: 1354744-91-4, stock 20.8g, assay 97%, molecular formula: C34H48NO11D5. C2H2O4, molecular weight: 656.83 90.04. |
| Naloxegol-d7Oxalate, cas: 854601-70-0, stock 27.5g, assay 97.2%, molecular formula: C34H46D7NO11, molecular weight: 658.84. |
| NaloxonazineDihydrochloride, cas: 880759-65-9, stock 19.8g, assay 95.8%, molecular formula: C₃₈H₄₂N₄O₆ • 2(HCl), molecular weight: . |
| Naloxone, cas: 465-65-6, stock 21.2g, assay 97.4%, molecular formula: C₁₉H₂₁NO₄, molecular weight: . |
| NaloxoneEPImpurityF, cas: 2139253-69-1, stock 41.2g, assay 95.5%, molecular formula: C19H21NO5, molecular weight: 343.37. |
| NaloxoneHydrochloride, cas: 357-08-4, stock 25.7g, assay 95.6%, molecular formula: C₁₉H₂₂ClNO₄, molecular weight: . |
| Naloxonehydrochloridedihydrate, cas: 51481-60-8, stock 38.1g, assay 95.7%, molecular formula: C19H21NO4 . HCl . H4O2, molecular weight: 327.4 . 36.46 . 36.04. |
| NaloxoneImpurity4, cas: N/A, stock 42.9g, assay 99%, molecular formula: C32H32N2O8, molecular weight: 572.61. |
| Naloxone HydrochlorideEPImpurityA, cas: 33522-95-1, stock 17.5g, assay 96.7%, molecular formula: C16H17NO4, molecular weight: 287.32. |
| Naloxone HydrochlorideEPImpurityB, cas: 1352085-46-1, stock 23.6g, assay 96%, molecular formula: C22H25NO4, molecular weight: 367.45. |
| Naloxone HydrochlorideEPImpurityC, cas: 2139253-68-0, stock 39.7g, assay 98.7%, molecular formula: C19H21NO5, molecular weight: 343.38. |
| Naloxone HydrochlorideEPImpurityD, cas: 26451-92-3, stock 28g, assay 95.4%, molecular formula: C19H19NO4, molecular weight: C19H19NO4. |
| Naloxone HydrochlorideEPImpurityE, cas: 211738-08-8, stock 33.9g, assay 95.2%, molecular formula: C38H40N2O8, molecular weight: 652.74. |
| Naloxone HydrochlorideEPImpurityF, cas: N/A, stock 15.1g, assay 98.5%, molecular formula: C19H21NO5, molecular weight: 343.38. |
| Naloxone HydrochlorideEPImpurityG, cas: 70866-64-7, stock 24.3g, assay 98.4%, molecular formula: C20H23NO4, molecular weight: 341.41. |
| Naloxone-d5, cas: 1261079-38-2, stock 10.9g, assay 97.1%, molecular formula: C₁₉H₁₆D₅NO₄, molecular weight: . |
| Naloxone-d5HCl, cas: 1426174-78-8, stock 28.5g, assay 97.7%, molecular formula: C19H16D5NO4. HCl, molecular weight: 332.41 36.46. |
| N-alpha-(2,4,6-Triisopropylbenzenesulfonyl)-O-(tert-butyldiphenylsilyl)-pros-methyl-L-histidinol, cas: 787554-04-5, stock 40.4g, assay 95.9%, molecular formula: C₃₈H₅₃N₃O₃SSi, molecular weight: . |
| N-alpha-(5-Fluoro-2,4-dinitrophenyl)-D-leucinamide, cas: 178065-30-0, stock 23g, assay 96.3%, molecular formula: C12H15FN4O5, molecular weight: 314.27. |
| N-alpha-Benzyloxycarbonyl-3-(Boc-amino)-D-alanine, cas: 62234-36-0, stock 31.9g, assay 96.7%, molecular formula: C₁₆H₂₂N₂O₆, molecular weight: . |
| N-Alpha-benzyloxycarbonyl-n-alpha-methyl-l-phenylalanineDicyclohexylamine, cas: 03/08/2899, stock 25.4g, assay 97.7%, molecular formula: C₃₀H₄₂N₂O₄, molecular weight: . |
| N-alpha-CBZ-L-Arginine7-Amido-4-methylcoumarinHydrochloride, cas: 70375-22-3, stock 12.7g, assay 97.3%, molecular formula: C₂₄H₂₇N₅O₅•HCl, molecular weight: . |
| N-Alpha-methyl-l-alaninehydrochloride, cas: 65672-32-4, stock 13.7g, assay 98.6%, molecular formula: C₄H₁₀ClNO₂, molecular weight: . |
| N-alpha-Phthalyl-L-glutamine, cas: 3343-29-1, stock 49.8g, assay 96.9%, molecular formula: C₁₃H₁₂N₂O₅, molecular weight: . |
| Naltrexone, cas: 16590-41-3, stock 37.2g, assay 98.3%, molecular formula: C₂₀H₂₃NO₄, molecular weight: . |
| NaltrexoneHydrochloride, cas: 16676-29-2, stock 38.4g, assay 98.6%, molecular formula: C₂₀H₂₄ClNO₄, molecular weight: . |
| NaltrexoneHydrochlorideImpurityG, cas: N/A, stock 32.4g, assay 95.4%, molecular formula: C20H23NO5, molecular weight: 357.4. |
| NaltrexoneImpurity1, cas: 767615-69-0, stock 26.9g, assay 98.5%, molecular formula: , molecular weight: . |
| NaltrexoneImpurity12, cas: 96445-13-5, stock 35.9g, assay 96.6%, molecular formula: , molecular weight: . |
| NaltrexoneImpurity2, cas: 503090-99-1, stock 22.9g, assay 98.8%, molecular formula: , molecular weight: . |
| NaltrexoneImpurity3, cas: 96445-14-6, stock 40.1g, assay 95.9%, molecular formula: , molecular weight: . |
| NaltrexoneImpurity4, cas: 16617-07-5, stock 33.4g, assay 95.5%, molecular formula: , molecular weight: . |
| NaltrexoneImpurity7, cas: 131670-05-8, stock 10.6g, assay 98.4%, molecular formula: , molecular weight: . |
| Naltrexone-d3, cas: 1261080-26-5, stock 20.7g, assay 96%, molecular formula: C₂₀H₂₀D₃NO₄, molecular weight: . |
| Naltrexone-d4, cas: 2070009-29-7, stock 18.3g, assay 98.8%, molecular formula: C20H19D4NO4, molecular weight: 345.43. |
| Naltrexone-O-ethylCarbonate, cas: 836602-51-8, stock 35.2g, assay 98.2%, molecular formula: C₂₃H₂₇NO₆, molecular weight: . |
| Naltriben, cas: 111555-58-9, stock 44.3g, assay 98.8%, molecular formula: C₂₆H₂₅NO₄, molecular weight: . |
| NaltribenMesylate, cas: 122517-78-6, stock 49.9g, assay 96.3%, molecular formula: C₂₆H₂₅NO₄ • CH ₄O₃S, molecular weight: . |
| NaltrindoleHydrochloride, cas: 111469-81-9, stock 30.4g, assay 98.1%, molecular formula: C₂₆H₂₆N₂O₃ • (HCl), molecular weight: . |
| Namino-{3-[(R)-1-(3-(4-Amino-3-(4-phenoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl]-propionyl}Ibrutinib, cas: N/A, stock 44g, assay 98.2%, molecular formula: C50H48N12O4, molecular weight: 881.01. |
| N-Amino-11-azaartemisinin, cas: 1086409-78-0, stock 10.5g, assay 98.5%, molecular formula: C₁₅H₂₄N₂O₄, molecular weight: . |
| N-Amino-1H-imidazole-1-carboximidamide, cas: 1016162-38-1, stock 39.8g, assay 96.5%, molecular formula: C₄H₇N₅, molecular weight: . |
| N-amino-4-bromobenzene-1-carboximidamidehydrochloride, cas: 1461714-12-4, stock 43.1g, assay 96.7%, molecular formula: C₇H₈N₃Br.HCl, molecular weight: . |
| N-AminoacylLinagliptin, cas: N/A, stock 34.3g, assay 98.3%, molecular formula: C16H3Cl3I6N2O4, molecular weight: 1154.99. |
| N-AminoacylLinagliptin, cas: N/A, stock 47.1g, assay 97%, molecular formula: C26H29N9O3 , molecular weight: 515.58. |
| Namino-BenzoylAlogliptin, cas: , stock 23.1g, assay 98.2%, molecular formula: C₂₅H₂₅N₅O₃, molecular weight: . |
| N-AminocarbonylFelbamate, cas: 1797130-34-7, stock 21.8g, assay 96.4%, molecular formula: C12H15N3O5, molecular weight: 281.3. |
| N-AminocaronylFelbamate(Allophanate), cas: N/A；, stock 28.8g, assay 95.3%, molecular formula: C12H15N3O5, molecular weight: 281.27. |
| N-Amino-D-proline, cas: 10139-05-6, stock 38.2g, assay 97.3%, molecular formula: C₅H₁₀N₂O₂, molecular weight: . |
| N-Aminoethyl-Aza-2,2,4-Trimethylsilacyclopentane, cas: 18246-33-8, stock 29.6g, assay 95.6%, molecular formula: C8H20N2Si, molecular weight: 172.35. |
| N-Aminohexamethylenimine, cas: 5906-35-4, stock 25.9g, assay 95.3%, molecular formula: C₆H₁₄N₂, molecular weight: . |
| Namino-Methyl-4-dimethylallyl-L-tryptophan, cas: 75917-16-7, stock 33.4g, assay 95.9%, molecular formula: C₁₇H₂₂N₂O₂, molecular weight: . |
| Namodenoson-13C-d3, cas: N/A, stock 46.4g, assay 97.3%, molecular formula: C12H9N5O, molecular weight: 239.24. |
| Namodenoson-d6, cas: N/A, stock 43.6g, assay 96.4%, molecular formula: C18H32N2O2S4, molecular weight: 436.71. |
| Nampt-IN-1, cas: 1698878-14-6, stock 22.2g, assay 98.8%, molecular formula: C₂₀H₂₅N₃O₅S, molecular weight: . |
| NAN-190, cas: 115338-32-4, stock 33.2g, assay 96.6%, molecular formula: C₂₃H₂₇N₃O₃ • HBr, molecular weight: . |
| NandroloneDecanoateforPeakIdentifica, cas: 360-70-3, stock 28.9g, assay 98.2%, molecular formula: C28H44O3, molecular weight: 428.65. |
| NandrolonePhenypropionate, cas: 62-90-8, stock 43.3g, assay 96.3%, molecular formula: C27H34O3, molecular weight: 406.56. |
| NAP, cas: 211439-12-2, stock 12.8g, assay 95.5%, molecular formula: C₃₆H₆₀N₁₀O₁₂, molecular weight: . |
| NAP226-90-d6(RivastigmineEPImpurityA-d6), cas: N/A, stock 46.7g, assay 96.7%, molecular formula: C19H38N6O10, molecular weight: 510.55. |
| Napabucasin, cas: 83280-65-3, stock 39.6g, assay 97.6%, molecular formula: C₁₄H₈O₄, molecular weight: . |
| Naphazoline, cas: 835-31-4, stock 34.6g, assay 95.8%, molecular formula: , molecular weight: . |
| Naphazoline, cas: 835-31-4550-99-2, stock 11.7g, assay 95.2%, molecular formula: C14H14N2, molecular weight: 210.28. |
| NaphazolineEPImpurityD, cas: 22126-67-6, stock 12.8g, assay 98.7%, molecular formula: , molecular weight: . |
| NaphazolineHCl, cas: 550-99-2835-31-4, stock 39.6g, assay 96.2%, molecular formula: C14H14N2. HCl, molecular weight: 210.28 36.46. |
| NaphazolineHydrochloride, cas: 550-99-2, stock 28g, assay 97.7%, molecular formula: C₁₄H₁₄N₂ • HCl, molecular weight: . |
| NaphazolineImpurity1, cas: 17518-47-7, stock 49.4g, assay 96.8%, molecular formula: C12H11NS, molecular weight: 201.29. |
| NaphazolineImpurity2, cas: 1019-21-2, stock 21.6g, assay 95.5%, molecular formula: C14H12N2, molecular weight: 208.26. |
| NaphazolineImpurity2DiHCl, cas: N/A, stock 36.6g, assay 95.7%, molecular formula: C9H7Br2NO4, molecular weight: 352.97. |
| NaphazolineImpurity3DiHCl, cas: 1639405-29-082562-02-5, stock 12.6g, assay 96%, molecular formula: C5H14N4S. 2 HCl, molecular weight: 162.26 2 36.46. |
| NaphazolineImpurity3（NaphazolineEPImpurityC）, cas: 132-75-2, stock 31g, assay 97.1%, molecular formula: , molecular weight: . |
| NaphazolineImpurity4HCl, cas: 161983-06-8748744-82-3, stock 17.5g, assay 97.3%, molecular formula: C15H17NO. HCl, molecular weight: 227.31 36.46. |
| NaphazolineImpurity5(Ethylenediamine), cas: 107-15-3, stock 21.5g, assay 98.2%, molecular formula: C2H8N2, molecular weight: 60.10. |
| NaphazolineNitrate, cas: 5144-52-5, stock 30.2g, assay 95.6%, molecular formula: C₁₄H₁₅N₃O₃, molecular weight: . |
| Naphazoline-d4HCl, cas: N/A, stock 22.7g, assay 96.9%, molecular formula: C14H24O8, molecular weight: 320.34. |
| Naphthacene, cas: 92-24-0, stock 25.3g, assay 97.1%, molecular formula: C₁₈H₁₂, molecular weight: . |
| Naphthalen-1-yl-(1H-Pyrrol-3-yl)methanone, cas: 162934-76-1, stock 35.7g, assay 97.5%, molecular formula: C15H11NO, molecular weight: 221.26. |
| Naphthalen-1-ylhydrazineHydrochloride, cas: 2243-56-3, stock 22.5g, assay 98.6%, molecular formula: C₁₀H₁₀N₂ • (HCl), molecular weight: . |
| Naphthalen-1-YlmethanamineHydrochloride, cas: 39110-74-2, stock 30g, assay 98.3%, molecular formula: C₁₁H₁₁N • HCl, molecular weight: . |
| Naphthalen-2-ylChloromethanethioate, cas: 10506-37-3, stock 25.7g, assay 95.1%, molecular formula: C₁₁H₇ClOS, molecular weight: . |
| Naphthalen-2-ylmethanamineHydrochloride, cas: 2241-98-7, stock 37.1g, assay 98.7%, molecular formula: C₁₁H₁₁N • HCl, molecular weight: . |
| Naphthalen-2-ylmethyl(5-Chlorobenzo[c][1,2,5]thiadiazol-4-yl)carbamimidothioate, cas: , stock 40.9g, assay 96.8%, molecular formula: C₁₈H₁₃ClN₄S₂, molecular weight: . |
| Naphthalen-2-ylmethylThiophene-2-carbimidothioateHydrobromide, cas: 210765-55-2, stock 10g, assay 96.5%, molecular formula: C₁₆H₁₄BrNS₂, molecular weight: . |
| Naphthalene, cas: 91-20-3, stock 25g, assay 95.7%, molecular formula: C₁₀H₈, molecular weight: . |
| NaphthaleneRelatedCompound1, cas: 856291-50-4, stock 12.1g, assay 96.5%, molecular formula: C12H11N, molecular weight: 169.23. |
| Naphthalene-1,3,5-trisulphonicAcid, cas: 6654-64-4, stock 43.6g, assay 97.7%, molecular formula: C₁₀H₈O₉S₃, molecular weight: . |
| Naphthalene-1,4,5,8-tetracarboxylicAcid, cas: 128-97-2, stock 39.7g, assay 96.1%, molecular formula: C₁₄H₈O₈, molecular weight: . |
| Naphthalene-1,4-diboronicAcid, cas: 22871-75-6, stock 17.9g, assay 95.6%, molecular formula: C₁₀H₁₀B₂O₄, molecular weight: . |
| Naphthalene-1,8-diol, cas: 569-42-6, stock 46.8g, assay 96.3%, molecular formula: C₁₀H₈O₂, molecular weight: . |
| Naphthalene-13C10, cas: 219526-41-7, stock 35.5g, assay 96.2%, molecular formula: ¹³C₁₀H₈, molecular weight: . |
| Naphthalene-13C6, cas: 287399-34-2, stock 43.7g, assay 97.8%, molecular formula: C₄¹³C₆H₈, molecular weight: . |
| Naphthalene-1-boronicAcidPinacolEster, cas: 68716-52-9, stock 46.6g, assay 96.9%, molecular formula: C₁₆H₁₉BO₂, molecular weight: . |
| Naphthalene-1-carbothioamide, cas: 20300-10-1, stock 38.2g, assay 96.6%, molecular formula: C₁₁H₉NS, molecular weight: . |
| Naphthalene-1-CarboxamidineHydrochloride, cas: 61416-82-8, stock 21.1g, assay 97.7%, molecular formula: C₁₁H₁₀N₂ • HCl, molecular weight: . |
| Naphthalene-1-sulfonicAcid, cas: 85-47-2, stock 15.6g, assay 97.5%, molecular formula: C₁₀H₈O₃S, molecular weight: . |
| Naphthalene-2,3-dicarboxaldehyde, cas: 7149-49-7, stock 39.1g, assay 97%, molecular formula: C₁₂H₈O₂, molecular weight: . |
| Naphthalene-2-carboxamide, cas: 2243-82-5, stock 46.8g, assay 95.4%, molecular formula: C₁₁H₉NO, molecular weight: . |
| Naphthalene-2-Sulfonamide, cas: 1576-47-2, stock 44.9g, assay 97.9%, molecular formula: C₁₀H₉NO₂S, molecular weight: . |
| Naphthalene-2-sulfonicAcid, cas: 120-18-3, stock 25g, assay 98.5%, molecular formula: C₁₀H₈SO₃, molecular weight: . |
| Naphthalene-2-sulfonicacidhydrate, cas: 6036-00-6, stock 24.3g, assay 97.5%, molecular formula: C₁₀H₈O₃S • H ₂O, molecular weight: . |
| Naphthalene-2-sulfonohydrazide, cas: 10151-46-9, stock 44.9g, assay 95.4%, molecular formula: C₁₀H₁₀N₂O₂S, molecular weight: . |
| Naphthalene-d8, cas: 1146-65-2, stock 23.8g, assay 96.6%, molecular formula: C₁₀D₈, molecular weight: . |
| Naphtho[2,3-a]pyrene, cas: 196-42-9, stock 44.8g, assay 95.4%, molecular formula: C₂₄H₁₄, molecular weight: . |
| NaphthofluoresceinDi-(β-D-galactopyranoside), cas: 133551-98-1, stock 33.1g, assay 95.2%, molecular formula: C₄₀H₃₆O₁₅, molecular weight: . |
| NaphtholASNonanoate, cas: 10523-82-7, stock 42.7g, assay 96%, molecular formula: C₂₆H₂₉NO₃, molecular weight: . |
| NaphtholASphosphate, cas: 13989-98-5, stock 30.4g, assay 97.5%, molecular formula: C₁₇H₁₄NO₅P, molecular weight: . |
| NaphtholAS-BIPhosphateDisodiumSalt, cas: 530-79-0, stock 10.6g, assay 95.9%, molecular formula: C₁₈H₁₃BrNNa₂O₆P, molecular weight: . |
| NaphtholAS-BISulphatePotassiumSalt, cas: 1680-70-2, stock 19.8g, assay 96.6%, molecular formula: C₁₈H₁₃BrKNO₆S, molecular weight: . |
| NaphtholAS-BIβ-D-glucuronide, cas: 37-87-6, stock 15.8g, assay 95.5%, molecular formula: C₂₄H₂₂BrNO₉, molecular weight: . |
| NaphtholAS-CLPhosphate, cas: 18228-16-5, stock 46.3g, assay 98.2%, molecular formula: C₁₈H₁₅ClNO₆P, molecular weight: . |
| NaphtholAS-DChloroacetate, cas: 35245-26-2, stock 42.4g, assay 98.9%, molecular formula: C₂₀H₁₆NO₃Cl, molecular weight: . |
| NaphtholAS-EAcetate, cas: 84100-15-2, stock 30.2g, assay 95.6%, molecular formula: C₁₉H₁₄ClNO₃, molecular weight: . |
| NaphtholAS-EPhosphate, cas: 18228-17-6, stock 13g, assay 96.2%, molecular formula: C₁₇H₁₃ClNO₅P, molecular weight: . |
| NaphtholAS-GRPhosphateDisodiumSalt, cas: 100929-51-9, stock 25.3g, assay 95.5%, molecular formula: C₂₂H₁₈NO₅P • 2Na, molecular weight: . |
| NaphtholAS-MXAcetate, cas: 4569-00-0, stock 23.7g, assay 97%, molecular formula: C₂₁H₁₉NO₃, molecular weight: . |
| NaphtholAS-MXPhosphate, cas: 1596-56-1, stock 31.1g, assay 98.4%, molecular formula: C₁₉H₁₈NO₅P, molecular weight: . |
| NaphtholAS-MXPhosphateDisodiumSalt, cas: 96189-12-7, stock 37.3g, assay 95.6%, molecular formula: C₁₉H₁₆NNa₂O₅P, molecular weight: . |
| NaphtholAS-OLAcetate, cas: 7128-79-2, stock 31.2g, assay 95.9%, molecular formula: C₂₀H₁₇NO₄, molecular weight: . |
| NaphtholAS-TRPhosphate, cas: 2616-72-0, stock 24.9g, assay 97.8%, molecular formula: C₁₈H₁₅ClNO₅P, molecular weight: . |
| NaphtholGreenB, cas: 19381-50-1, stock 13.1g, assay 99%, molecular formula: C₃₀H₁₅FeN₃Na₃O₁₅S₃, molecular weight: . |
| NaphtholYellowSHydrate, cas: 846-70-8, stock 49.6g, assay 97.5%, molecular formula: C₁₀H₄N₂Na₂O₈S • xH ₂O, molecular weight: . |
| Naphthol-AS-CA, cas: 137-52-0, stock 25.2g, assay 98.9%, molecular formula: C₁₈H₁₄NO₃Cl, molecular weight: . |
| NaphtolAS, cas: 92-77-3, stock 19.7g, assay 95.2%, molecular formula: C₁₇H₁₃NO₂, molecular weight: . |
| Napropamid, cas: 15299-99-7, stock 43.3g, assay 98.3%, molecular formula: C₁₇H₂₁NO₂, molecular weight: . |
| Napropamid-13C6, cas: , stock 29.2g, assay 95.5%, molecular formula: C₁₁¹³C₆H₂₁NO₂, molecular weight: . |
| Naproxen, cas: 22204-53-1, stock 38.3g, assay 96.1%, molecular formula: C14H14O3, molecular weight: 230.26. |
| NaproxenEPImpurityA, cas: 52079-10-4, stock 36.2g, assay 98.8%, molecular formula: C13H12O3, molecular weight: 216.23. |
| NaproxenEPImpurityB, cas: 89617-86-7, stock 12.1g, assay 95.1%, molecular formula: C14H13ClO3, molecular weight: 264.7. |
| NaproxenEPImpurityC, cas: 84236-26-0, stock 22.1g, assay 98.5%, molecular formula: C14H13BrO3, molecular weight: 309.16. |
| NaproxenEPImpurityD, cas: 116883-62-6, stock 18.7g, assay 96.3%, molecular formula: C14H13IO3, molecular weight: 356.16. |
| NaproxenEPImpurityE, cas: 26159-35-3, stock 16.8g, assay 98.5%, molecular formula: C15H16O3, molecular weight: 244.29. |
| NaproxenEPImpurityF, cas: 31220-35-6, stock 21.3g, assay 97%, molecular formula: C16H18O3, molecular weight: 258.31. |
| NaproxenEPImpurityH, cas: 5111-66-0, stock 34.4g, assay 98.8%, molecular formula: C11H10O2 , molecular weight: 174.2. |
| NaproxenEPImpurityI, cas: 23981-47-7, stock 22.6g, assay 98.7%, molecular formula: C13H12O3, molecular weight: 216.24. |
| NaproxenEPImpurityJ, cas: 21388-17-0, stock 31.8g, assay 95.5%, molecular formula: C13H14O, molecular weight: 186.25. |
| NaproxenEPImpurityK, cas: 77301-42-9, stock 24.9g, assay 95.2%, molecular formula: C13H14O2, molecular weight: 202.25. |
| NaproxenEPImpurityL, cas: 3900-45-6, stock 37.9g, assay 96%, molecular formula: C13H12O2, molecular weight: 200.23. |
| NaproxenEPImpurityM, cas: 93-04-9, stock 13.3g, assay 95.5%, molecular formula: C11H10O, molecular weight: 158.2. |
| NaproxenEPImpurityM, cas: 34068, stock 27.2g, assay 97.9%, molecular formula: C11H10O, molecular weight: 158.20. |
| NaproxenEPImpurityN, cas: 5111-65-9, stock 38.3g, assay 97.6%, molecular formula: C11H9BrO, molecular weight: 237.09. |
| NaproxenEPImpurityO, cas: 2471-70-7, stock 15g, assay 97.3%, molecular formula: C12H10O3, molecular weight: 202.21. |
| NaproxenImpurity1, cas: 10441-46-0, stock 35.7g, assay 97.1%, molecular formula: C12H10O3, molecular weight: 202.21. |
| NaproxenImpurity1, cas: 1148126-56-0, stock 12.4g, assay 98.9%, molecular formula: C12H10O4, molecular weight: 218.21. |
| NaproxenImpurity1, cas: N/A, stock 17g, assay 97%, molecular formula: C19H26N4O2, molecular weight: 342.44. |
| NaproxenImpurity1SodiumSalt, cas: N/A, stock 48.8g, assay 98%, molecular formula: C21H19ClFNO4S, molecular weight: 435.91. |
| NaproxenImpurity10, cas: 80336-62-5, stock 29.1g, assay 98.4%, molecular formula: C14H12Br2O2, molecular weight: 372.06. |
| NaproxenImpurity10, cas: N/A, stock 44.2g, assay 97.6%, molecular formula: C16H19O3. Na, molecular weight: 259.33 22.99. |
| NaproxenImpurity11, cas: 116883-61-5, stock 11.6g, assay 98.6%, molecular formula: C14H13IO3, molecular weight: 356.16. |
| NaproxenImpurity11, cas: N/A, stock 43.2g, assay 97.8%, molecular formula: C19H24O4, molecular weight: 316.4. |
| NaproxenImpurity12, cas: 2700-47-2, stock 47.8g, assay 98.6%, molecular formula: C14H14O2, molecular weight: 214.26. |
| NaproxenImpurity13, cas: N/A, stock 21.9g, assay 98.9%, molecular formula: C20H17BrN6O2, molecular weight: 453.30. |
| NaproxenImpurity14, cas: 2241295-67-8, stock 16.4g, assay 95.1%, molecular formula: C19H23BrO3, molecular weight: 379.29. |
| NaproxenImpurity16, cas: N/A, stock 22.2g, assay 99%, molecular formula: C15H18O5, molecular weight: 278.30. |
| NaproxenImpurity2, cas: 60756-73-2, stock 37.6g, assay 97.9%, molecular formula: C13H12O3, molecular weight: 216.23. |
| NaproxenImpurity2, cas: N/A, stock 48.5g, assay 97.5%, molecular formula: C47H60O14, molecular weight: 848.98. |
| NaproxenImpurity3, cas: 27602-75-1, stock 45.8g, assay 95.2%, molecular formula: C14H14O2, molecular weight: 214.26. |
| NaproxenImpurity4, cas: 27602-76-2, stock 47.9g, assay 95.2%, molecular formula: C14H15NO2, molecular weight: 229.28. |
| NaproxenImpurity4, cas: N/A, stock 43.1g, assay 96.7%, molecular formula: C14H13IO3, molecular weight: 356.16. |
| NaproxenImpurity5, cas: 17696-64-9, stock 30.4g, assay 98.5%, molecular formula: C6H11ClO2, molecular weight: 150.60. |
| NaproxenImpurity5, cas: 37961-57-2, stock 29.5g, assay 98.6%, molecular formula: C16H18O3, molecular weight: 258.31. |
| NaproxenImpurity6, cas: N/A, stock 27.2g, assay 96.4%, molecular formula: C20H25O3P, molecular weight: 344.39. |
| NaproxenImpurity6, cas: N/A, stock 34.1g, assay 96.9%, molecular formula: C18H22O4, molecular weight: 302.36. |
| NaproxenImpurity7, cas: 156543-20-3, stock 10.9g, assay 97.5%, molecular formula: C12H19NO2, molecular weight: 209.28. |
| NaproxenImpurity7(MixtureofRegio-andStereoisomers), cas: N/A, stock 10.3g, assay 97.8%, molecular formula: C29H13I8NO6, molecular weight: 1486.66. |
| NaproxenImpurity8, cas: N/A, stock 11.6g, assay 98%, molecular formula: C28H29NO3, molecular weight: 427.54. |
| NaproxenImpurity8, cas: N/A, stock 14.8g, assay 96.6%, molecular formula: C14H15NO2, molecular weight: 229.27. |
| NaproxenImpurity9, cas: N/A, stock 23.7g, assay 97.3%, molecular formula: C30H23I5N2O8, molecular weight: 1174.04. |
| NaproxenNitrileImpurity, cas: 67886-70-8, stock 17.2g, assay 98.7%, molecular formula: C12H9NO, molecular weight: 183.21. |
| NaproxenRacemate, cas: 23981-80-8, stock 14.4g, assay 96.6%, molecular formula: C14H14O3, molecular weight: 230.26. |
| NaproxenUSPRCG, cas: 23979-41-1, stock 22.2g, assay 98.3%, molecular formula: C14H14O3, molecular weight: 230.26. |
| Naproxen-d3, cas: N/A, stock 35.8g, assay 98.2%, molecular formula: C14H11D3O3, molecular weight: 233.28. |
| Naquotinib, cas: 1448232-80-1, stock 34.9g, assay 95.2%, molecular formula: C₃₀H₄₂N₈O₃, molecular weight: . |
| N-Arachidonoyl-(L)-alanine(NA-Ala), cas: 401941-73-9, stock 16.4g, assay 95.3%, molecular formula: C₂₃H₃₇NO₃, molecular weight: . |
| N-Arachidonoyl-GABA(NA-GABA), cas: 128201-89-8, stock 10.9g, assay 96.6%, molecular formula: C₂₄H₃₉NO₃, molecular weight: . |
| N-Arachidonoyltaurine, cas: 119959-65-8, stock 10.9g, assay 98.3%, molecular formula: C₂₂H₃₇NO₄S, molecular weight: . |
| N-Arachidonoyltaurine-d4, cas: , stock 47.1g, assay 98.7%, molecular formula: C₂₂H₃₃D₄NO₄S, molecular weight: . |
| Narasin, cas: 55134-13-9, stock 23.9g, assay 95.6%, molecular formula: C₄₃H₇₂O₁₁, molecular weight: . |
| NarasinSodium, cas: 58331-17-2, stock 11.5g, assay 96.5%, molecular formula: C₄₃H₇₁NaO₁₁, molecular weight: . |
| Naratriptan, cas: 121679-13-8, stock 29.9g, assay 96.7%, molecular formula: C17H25N3O2S , molecular weight: 335.47. |
| Naratriptan2-CarboxylicAcid, cas: 874583-40-1, stock 28.9g, assay 98.5%, molecular formula: C₁₈H₂₅N₃O₄S, molecular weight: . |
| NaratriptanD3, cas: 1190043-69-6, stock 47.2g, assay 95.3%, molecular formula: C17H22D3N3O2S, molecular weight: 338.48. |
| NaratriptanHydrochloride, cas: 143388-64-1, stock 47g, assay 98.7%, molecular formula: C₁₇H₂₆ClN₃O₂S, molecular weight: . |
| NaratriptanImpurity1, cas: 121679-20-7 , stock 25.9g, assay 98.7%, molecular formula: C17H23N3O2S, molecular weight: 333.45. |
| NaratriptanImpurity2, cas: 1638617-36-3, stock 19.5g, assay 97%, molecular formula: C17H20ClN3O2S, molecular weight: 365.88. |
| NaratriptanImpurity2Iodide, cas: N/A, stock 33.9g, assay 98.1%, molecular formula: C37H48N4O5, molecular weight: 628.81. |
| NaratriptanImpurity2Iodide, cas: N/A, stock 16.1g, assay 95.4%, molecular formula: C17H20N3O2S. I, molecular weight: 330.43 126.90. |
| NaratriptanImpurity3, cas: 17403-07-5, stock 20.4g, assay 96.7%, molecular formula: C14H18N2 , molecular weight: 214.31. |
| NaratriptanImpurity4, cas: N/A, stock 40.7g, assay 98.8%, molecular formula: C18H28N3O2S : Cl, molecular weight: 350.5 : 35.5. |
| NaratriptanImpurity5, cas: N/A, stock 17.1g, assay 95.4%, molecular formula: C18H28ClN3O2S, molecular weight: 385.95. |
| NaratriptanImpurity6, cas: N/A, stock 17.4g, assay 98.7%, molecular formula: C20H27N4O4S2 : Cl, molecular weight: 451.6 : 35.5. |
| NaratriptanImpurityC, cas: 1346604-16-7, stock 11.6g, assay 96.9%, molecular formula: C31H41N5O2S , molecular weight: 547.77. |
| NaratriptanImpurityE, cas: 1346746-73-3, stock 45.3g, assay 98.5%, molecular formula: C20H32N4O4S2 , molecular weight: 456.63. |
| NaratriptanImpurityF, cas: 2144776-33-8, stock 17.9g, assay 98%, molecular formula: C20H27N4O4S2Cl, molecular weight: 451.6 : 35.5. |
| NaratriptanImpurityF, cas: N/A, stock 45.4g, assay 98.7%, molecular formula: C30H34O5, molecular weight: 474.60. |
| NaratriptanImpurityF, cas: , stock 19.5g, assay 96.7%, molecular formula: C₂₀H₂₇ClN₄O₄S₂, molecular weight: . |
| NaratriptanImpurityFIodide, cas: 2144776-32-7, stock 33.5g, assay 97.2%, molecular formula: C20H27N4O4S2 : I, molecular weight: 451.6 : 126.9. |
| NaratriptanN-Methiodide, cas: , stock 10.7g, assay 98.9%, molecular formula: C₁₈H₂₈IN₃O₂S, molecular weight: . |
| NaratriptanN-Methiodide-13CD3, cas: 220495-95-4, stock 33.2g, assay 98%, molecular formula: C₁₇¹³CH₂₅D₃IN₃O₂S, molecular weight: . |
| NaratriptanN-Nitroso, cas: 1216880-64-6 , stock 42.2g, assay 96.3%, molecular formula: C17H24N4O3S , molecular weight: 364.47. |
| NaratriptanN-Nitroso, cas: N/A, stock 16.7g, assay 95.8%, molecular formula: C25H34F2O5, molecular weight: 452.54. |
| NaratriptanN-oxide, cas: 1159977-52-2, stock 41.6g, assay 98.9%, molecular formula: C17H25N3O3S, molecular weight: 351.47. |
| NaratriptanN-oxide, cas: N/A, stock 11.9g, assay 95.1%, molecular formula: C15H11I4NO5, molecular weight: 792.88. |
| Naratriptanrelatedcompound-D, cas: N/A, stock 34g, assay 95.9%, molecular formula: C17H20N3O2S . Cl, molecular weight: 330.43 . 35.5. |
| Naratriptanrelatedcompound-G, cas: N/A, stock 18.8g, assay 98%, molecular formula: C20H32N4O4S2, molecular weight: 456.6. |
| Naratriptanrelatedcompound-H, cas: 2074613-76-4 , stock 41.8g, assay 98.6%, molecular formula: C16H22N2, molecular weight: 242.37. |
| Naratriptan-d3Hydrochloride, cas: 1190021-64-7, stock 19.3g, assay 98.2%, molecular formula: C₁₇H₂₃D₃ClN₃O₂S, molecular weight: . |
| Narcissoside, cas: 604-80-8, stock 27.6g, assay 98.6%, molecular formula: C₂₈H₃₂O₁₆, molecular weight: . |
| Narcissoside-d3, cas: , stock 23.9g, assay 96.2%, molecular formula: C₂₈H₂₉D₃O₁₆, molecular weight: . |
| Narcotolinogendiol, cas: 5876-41-5, stock 21.3g, assay 96.3%, molecular formula: C₂₁H₂₅NO₇, molecular weight: . |
| Naringenin4’-O-beta-D-Glucuronide(MixtureofDiastereomers), cas: 158196-35-1, stock 27.6g, assay 97.5%, molecular formula: C21H20O11, molecular weight: 448.38. |
| Naringenin4’-O-β-D-GlucuronideSodiumSalt(MixtureofDiastereomers), cas: , stock 47.8g, assay 98.8%, molecular formula: C₂₁H₁₉NaO₁₁, molecular weight: . |
| Naringenin4’-O-β-D-Glucuronide(MixtureofDiastereomers), cas: 1237479-04-7, stock 15g, assay 95.3%, molecular formula: C₂₁H₂₀O₁₁, molecular weight: . |
| Naringenin5-β-D-Glucoside, cas: 23711-00-4, stock 37.8g, assay 97%, molecular formula: C₂₁H₂₂O₁₀, molecular weight: . |
| Naringenin7-O-beta-D-Glucuronide(MixtureofDiastereomers), cas: 158196-34-0, stock 39g, assay 98.7%, molecular formula: C21H20O11, molecular weight: 448.38. |
| Naringenin7-O-β-D-GlucuronideMethylEster, cas: 1985597-72-5, stock 22.3g, assay 98.8%, molecular formula: C₂₂H₂₂O₁₁, molecular weight: . |
| Naringenin7-O-β-D-GlucuronideSodiumSalt(MixtureofDiastereomers), cas: , stock 44.5g, assay 97.7%, molecular formula: C₂₁H₁₉NaO₁₁, molecular weight: . |
| NaringinHydrate, cas: 132203-74-8, stock 23g, assay 96.4%, molecular formula: C₂₇H₃₂O₁₄•xH₂O, molecular weight: . |
| Naringoside, cas: 10236-47-2, stock 20.7g, assay 95.9%, molecular formula: C₂₇H₃₂O₁₄, molecular weight: . |
| Narwedine, cas: 510-77-0, stock 34.3g, assay 97.3%, molecular formula: C17H19NO3, molecular weight: 285.34. |
| NAS-181, cas: 1217474-40-2, stock 45.5g, assay 95.9%, molecular formula: C₁₉H₂₆N₂O₄ • 2(CH ₄O₃S), molecular weight: . |
| NAS-181, cas: 205242-62-2, stock 16g, assay 95.8%, molecular formula: C₁₉H₂₆N₂O₄ •CH₄O₃S, molecular weight: . |
| N-Aspartyl-L-glutamicAcidDibenzylEsterTrifluoroaceticAcidSalt, cas: , stock 38.4g, assay 98.5%, molecular formula: C₂₅H₂₇F₃N₂O₉, molecular weight: . |
| N-Aspartyl-L-glutamicAcidDimethylEsterTrifluoroaceticAcidSalt, cas: , stock 35.6g, assay 95.3%, molecular formula: C₁₁H₁₈N₂O₇ • C₂HF₃O₂, molecular weight: . |
| Natamycin, cas: 7681-93-8, stock 16.7g, assay 97.9%, molecular formula: C33H47NO13, molecular weight: 665.73. |
| Nateglinide, cas: 105816-04-4, stock 46.7g, assay 95.8%, molecular formula: C₁₉H₂₇NO₃, molecular weight: . |
| NateglinideImpurity7, cas: 958230-63-2, stock 19.8g, assay 98.3%, molecular formula: C20H29NO3, molecular weight: 331.45. |
| NateglinideAcylGlucuronide, cas: N/A, stock 16.2g, assay 98.1%, molecular formula: C21H22N6O9S, molecular weight: 534.50. |
| NateglinideAcyl-β-D-glucuronide, cas: 183996-85-2, stock 13.1g, assay 95.9%, molecular formula: C₂₅H₃₅NO₉, molecular weight: . |
| NateglinideAcyl-β-D-glucuronideBenzylEster, cas: , stock 14.5g, assay 96.3%, molecular formula: C₃₂H₄₁NO₉, molecular weight: . |
| NateglinideD5, cas: 1227666-13-8, stock 20.9g, assay 96.1%, molecular formula: C19H22D5NO3, molecular weight: 322.46. |
| NateglinideEPImpurityE(NateglinideEthylAnalog), cas: N/A, stock 10.3g, assay 98.5%, molecular formula: C18H16N2O10. 2 Na, molecular weight: 420.33 2 22.99. |
| NateglinideEPImpurityF, cas: 944746-48-9, stock 35.4g, assay 97.9%, molecular formula: C28H36N2O4, molecular weight: 464.6. |
| NateglinideEPImpurityG, cas: 187728-85-4, stock 21.6g, assay 98.8%, molecular formula: C21H31NO3, molecular weight: 345.5. |
| NateglinideMethylEster, cas: 105746-47-2, stock 28.1g, assay 98.2%, molecular formula: C20H29NO3, molecular weight: 331.46. |
| Nateglinide-d5EthylEster, cas: 1356929-50-4, stock 23.3g, assay 96.1%, molecular formula: C₂₁H₂₆D₅NO₃, molecular weight: . |
| N-Azidoacetylglucosamine,Acetylated, cas: 98924-81-3, stock 27.8g, assay 97%, molecular formula: C₁₆H₂₂N₄O₁₀, molecular weight: . |
| NBDFGIN-1-27Analog, cas: 336111-14-9, stock 32g, assay 98.3%, molecular formula: C₂₈H₂₈N₆O₄, molecular weight: . |
| Nbd-Nystatin, cas: 96475-98-8, stock 18.5g, assay 95.3%, molecular formula: C60H89N5O21, molecular weight: 1216.4. |
| N-Benzo[1,2-d:3,4-d’]bisthiazol-2-yl-2-naphthalenecarboxamide, cas: 1428729-56-9, stock 47.2g, assay 98.7%, molecular formula: C₁₉H₁₁N₃OS₂, molecular weight: . |
| N-BenzoylFlorfenicolAmine, cas: 1322626-20-9, stock 35.7g, assay 96.6%, molecular formula: C₁₇H₁₈FNO₄S, molecular weight: . |
| N-Benzoyl-5’-(di-p-methoxytrityl)cytidine, cas: 81246-76-6, stock 31.2g, assay 95%, molecular formula: C37H35N3O8, molecular weight: 649.70. |
| N-Benzoyl-5’-O-[bis(4-methoxyphenyl)phenylmethyl]-2’-O-(2-methoxyethyl)-adenosine, cas: 251647-48-0, stock 15.5g, assay 95.6%, molecular formula: C₄₁H₄₁N₅O₈, molecular weight: . |
| N-Benzoylcytidine, cas: 13089-48-0, stock 16.6g, assay 96.2%, molecular formula: C16H17N3O6, molecular weight: 347.33. |
| N-Benzoyl-D-arginine, cas: 61088-55-9, stock 29g, assay 98.1%, molecular formula: C₁₃H₁₈N₄O₃, molecular weight: . |
| N-Benzoyldeoxycytidine, cas: 4836-13-9, stock 26.9g, assay 98.5%, molecular formula: C₁₆H₁₇N₃O₅, molecular weight: . |
| N-Benzoyl-D-glucosamine, cas: 655-42-5, stock 36.9g, assay 95.5%, molecular formula: C₁₃H₁₇NO₆, molecular weight: . |
| N-Benzoyl-DL-alanine, cas: 1205-02-3, stock 14.9g, assay 98.3%, molecular formula: C₁₀H₁₁NO₃, molecular weight: . |
| N-Benzoyl-DL-alaninemethylester, cas: 38767-73-6, stock 32g, assay 95.5%, molecular formula: C₁₁H₁₃NO₃, molecular weight: . |
| N-Benzoyl-DL-phenylalanine2-NaphthylEster, cas: 15873-25-3, stock 10.4g, assay 95.6%, molecular formula: C₂₆H₂₁NO₃, molecular weight: . |
| N-Benzoyl-DL-tyrosyl-N’,N’-dipropylamide, cas: 57227-09-5, stock 33.6g, assay 96%, molecular formula: C₂₂H₂₈N₂O₃, molecular weight: . |
| N-Benzoylimidazole, cas: 10364-94-0, stock 46.5g, assay 95.3%, molecular formula: C₁₀H₈N₂O, molecular weight: . |
| N-Benzoyl-L-leucine-beta-naphthylamide, cas: 94441-89-1, stock 31.7g, assay 98.4%, molecular formula: C₂₃H₂₄N₂O₂, molecular weight: . |
| N-Benzoyl-L-phenylalanine, cas: 2566-22-5, stock 49.8g, assay 99%, molecular formula: C₁₆H₁₅NO₃, molecular weight: . |
| N-Benzoyl-L-tyrosine, cas: 2566-23-6, stock 24.5g, assay 95.3%, molecular formula: C₁₆H₁₅NO₄, molecular weight: . |
| N-Benzoyl-L-tyrosineethylester, cas: 3483-82-7, stock 13.5g, assay 96.3%, molecular formula: C₁₈H₁₉NO₄, molecular weight: . |
| N-Benzoyl-L-tyrosinehydrazide, cas: 101435-43-2, stock 49.8g, assay 97.8%, molecular formula: C₁₆H₁₇N₃O₃, molecular weight: . |
| N-Benzoyl-N-(2-phenylethyl)benzamide, cas: 74449-34-6, stock 43.4g, assay 97.3%, molecular formula: C₂₂H₁₉NO₂, molecular weight: . |
| N-Benzoyl-N-[2-(phenyl)ethyl]-N-carbamicAcidR-QuinuclidinolEsterSuccinicAcidSalt, cas: 1798817-92-1, stock 18.2g, assay 98.7%, molecular formula: C₂₇H₃₂N₂O₇, molecular weight: . |
| N-Benzoyl-N’-[4-(trifluoromethyl)phenyl]thiourea, cas: 117174-71-7, stock 27.5g, assay 95.2%, molecular formula: C₁₅H₁₁F₃N₂OS, molecular weight: . |
| N-Benzoyl-N-methyl-L-tyrosine, cas: 1798902-86-9, stock 45.2g, assay 98.3%, molecular formula: C₁₇H₁₇NO₄, molecular weight: . |
| N-Benzoyl-O,α-dimethyl-DL-tyrosine, cas: 118024-43-4, stock 14.5g, assay 96.9%, molecular formula: C₁₈H₁₉NO₄, molecular weight: . |
| N-Benzoyl-O,α-dimethyl-D-tyrosineMethylEster, cas: 172168-14-8, stock 44.4g, assay 98.1%, molecular formula: C₁₉H₂₁NO₄, molecular weight: . |
| N-Benzoyl-O,α-dimethyl-D-tyrosyl-N-cyclohexyl-L-phenylalaninamide, cas: 172168-08-0, stock 28.3g, assay 98.1%, molecular formula: C₃₃H₃₉N₃O₄, molecular weight: . |
| N-BenzyN,N-DidesmethylTrimebutine, cas: 1246817-32-2, stock 11.5g, assay 97.8%, molecular formula: C₂₇H₃₁NO₅, molecular weight: . |
| N-BenzyN,N-DidesmethylTrimebutine-d5, cas: 1246820-31-4, stock 40.5g, assay 96.2%, molecular formula: C₂₇H₂₆D₅NO₅, molecular weight: . |
| N-Benzyl(-)-Nebivolol, cas: 1199945-26-0, stock 44.8g, assay 98.7%, molecular formula: C29H31F2NO4, molecular weight: 495.6. |
| N-Benzyl2-(benzylamino)-3-methoxypropionamide, cas: 1379592-20-7, stock 30.1g, assay 97.9%, molecular formula: C₁₈H₂₂N₂O₂, molecular weight: . |
| N-Benzyl2-bromo-5-fluorobenzamide, cas: 951884-18-7, stock 14.9g, assay 97.4%, molecular formula: C₁₄H₁₁BrFNO, molecular weight: . |
| N-Benzyl2-bromobenzamide, cas: 82082-50-6, stock 14.3g, assay 97.8%, molecular formula: C₁₄H₁₂BrNO, molecular weight: . |
| N-Benzyl3-borono-4-fluorobenzamide, cas: 874289-53-9, stock 22.9g, assay 95.6%, molecular formula: C₁₄H₁₃BFNO₃, molecular weight: . |
| N-Benzyl3-bromo-5-trifluoromethylbenzenesulfonamide, cas: 951885-22-6, stock 23g, assay 98.3%, molecular formula: C₁₄H₁₁BrF₃NO₂S, molecular weight: . |
| N-Benzyl3-bromobenzamide, cas: 161258-41-9, stock 45.1g, assay 96.4%, molecular formula: C₁₄H₁₂BrNO, molecular weight: . |
| N-Benzyl3-bromobenzenesulfonamide, cas: 625470-36-2, stock 15.6g, assay 96.4%, molecular formula: C₁₃H₁₂BrNO₂S, molecular weight: . |
| N-Benzyl4-Borono-2-fluorobenzamide, cas: 874289-19-7, stock 39.8g, assay 97.3%, molecular formula: C₁₄H₁₃BFNO₃, molecular weight: . |
| N-Benzyl4-bromo-3-methylbenzamide, cas: 1020252-76-9, stock 47.1g, assay 95.1%, molecular formula: C₁₅H₁₄BrNO, molecular weight: . |
| N-Benzyl4-bromobenzamide, cas: 80311-89-3, stock 39.5g, assay 96.1%, molecular formula: C₁₄H₁₂BrNO, molecular weight: . |
| N-Benzyl4-bromobenzenesulfonamide, cas: 3609-87-8, stock 18.1g, assay 97%, molecular formula: C₁₃H₁₂BrNO₂S, molecular weight: . |
| N-Benzyl4-HydroxyPropranololβ-D-Glucuronide, cas: , stock 36.5g, assay 95.8%, molecular formula: C₂₉H₃₅NO₉, molecular weight: . |
| N-Benzyl6,7,8,9-TetrahydroCarvedilol, cas: 1329616-22-9, stock 14g, assay 97.2%, molecular formula: C₃₁H₃₆N₂O₄, molecular weight: . |
| N-BenzylAlbuterol-d9, cas: , stock 36.1g, assay 98.4%, molecular formula: C₂₀H₁₈D₉NO₃, molecular weight: . |
| N-BenzylAziridine, cas: 1074-42-6, stock 44g, assay 98.4%, molecular formula: C9H11N, molecular weight: 133.19. |
| N-BenzylCarvedilol-d5, cas: 1329792-68-8, stock 34.1g, assay 97.2%, molecular formula: C₃₁H₂₇D₅N₂O₄, molecular weight: . |
| N-BenzylCiprofloxacinBenzylEster, cas: 1391052-64-4, stock 26.5g, assay 96.9%, molecular formula: C₃₁H₃₀FN₃O₃, molecular weight: . |
| N-BenzylEpinephrine-d3, cas: 1795027-87-0, stock 14.6g, assay 99%, molecular formula: C₁₆H₁₆D₃NO₃, molecular weight: . |
| N-Benzylformamide, cas: 6343-54-0, stock 49.6g, assay 98.2%, molecular formula: C8H9NO, molecular weight: 135.16. |
| N-BenzylGlycineHydrochloride, cas: 7689-50-1, stock 34.6g, assay 97.8%, molecular formula: C₉H₁₁NO₂ • HCl, molecular weight: . |
| N-Benzylhydroxymedetomidine, cas: 2250243-44-6, stock 17.1g, assay 97.3%, molecular formula: C20H22N2O, molecular weight: 306.41. |
| N-BenzylL-Isoleucinamide, cas: 129253-02-7, stock 40.2g, assay 96.8%, molecular formula: C₁₃H₂₀N₂O, molecular weight: . |
| N-Benzylmedetomidine, cas: 2250242-52-3, stock 27.3g, assay 96.8%, molecular formula: C20H22N2, molecular weight: 290.41. |
| N-BenzylMetaxalone, cas: N/A, stock 18.5g, assay 98.5%, molecular formula: C29H35F2N8O5S. Cl. 2 HCl, molecular weight: 645.71 35.45 2 36.46. |
| N-BenzylMetaxalone, cas: NA, stock 11.5g, assay 98.6%, molecular formula: C19H21NO3, molecular weight: 311.38. |
| N-BenzylMetaxalone, cas: , stock 36.7g, assay 95.1%, molecular formula: C₁₉H₂₁NO₃, molecular weight: . |
| N-BenzylMetaxalone-d7, cas: , stock 12.7g, assay 99%, molecular formula: C₁₉H₁₄D₇NO₃, molecular weight: . |
| N-BenzylN-DemethylTrimebutine, cas: 1329834-94-7, stock 12g, assay 97.7%, molecular formula: C₂₈H₃₃NO₅, molecular weight: . |
| N-BenzylN-DemethylTrimebutine-d5, cas: 1330189-05-3, stock 36.3g, assay 97.8%, molecular formula: C₂₈H₂₈D₅NO₅, molecular weight: . |
| N-BenzylSalbutamolAcetonide, cas: 1797114-57-8, stock 48.6g, assay 95.6%, molecular formula: C₂₃H₃₁NO₃, molecular weight: . |
| N-BenzylSalbutamolAcetonideMethylEther, cas: 1797879-98-1, stock 14.6g, assay 95.1%, molecular formula: C₂₄H₃₃NO₃, molecular weight: . |
| N-BenzylSalbutamonHydrochloride, cas: 24085-08-3, stock 17.8g, assay 98.6%, molecular formula: C₂₀H₂₆ClNO₃, molecular weight: . |
| N-BenzylSalbutamon-d9Hydrochloride, cas: 1330183-34-0, stock 42.1g, assay 98.9%, molecular formula: C₂₀H₁₇D₉ClNO₃, molecular weight: . |
| N-BenzylTamsulosinHCl, cas: N/A, stock 36.8g, assay 97.8%, molecular formula: C8H16N2O4S, molecular weight: 236.29. |
| N-Benzylvinylanalogmedetomidine, cas: 2250243-56-0, stock 16.7g, assay 95.9%, molecular formula: C20H20N2, molecular weight: 288.39. |
| N-Benzyl(2-pyrrolidinyl)methanamineDioxalate, cas: 1177350-75-2, stock 38.3g, assay 95.5%, molecular formula: C₁₂H₁₈N₂ • 2C ₂H₂O₄, molecular weight: . |
| N-Benzyl-1-(3-methyl-2-pyridinyl)methanamineDihydrochloride, cas: 1269198-98-2, stock 39g, assay 96.6%, molecular formula: C₁₄H₁₆N₂ • 2[HCl], molecular weight: . |
| N-Benzyl-1-(4-methoxy-3-methylphenyl)propan-2-amine, cas: , stock 23.4g, assay 95.5%, molecular formula: C₁₈H₂₃NO, molecular weight: . |
| N-Benzyl-1-(6-methyl-2-pyridinyl)methanamineHydrochloride, cas: 1185293-34-8, stock 45.2g, assay 98.5%, molecular formula: C₁₄H₁₆N₂ • HCl, molecular weight: . |
| N-Benzyl-1-(trimethylsilyl)methanamine, cas: 53215-95-5, stock 28.3g, assay 98.4%, molecular formula: C₁₁H₁₉NSi.HCl, molecular weight: . |
| N-Benzyl-1,3-thiazolidine-4-carboxamideHydrochloride, cas: 1078162-99-8, stock 33.7g, assay 97.4%, molecular formula: C₁₁H₁₄N₂OS • HCl, molecular weight: . |
| N-Benzyl-1-butanamine, cas: 2403-22-7, stock 27.1g, assay 97.1%, molecular formula: C₁₁H₁₇N, molecular weight: . |
| N-Benzyl-1-cyclohexylmethanamineHydrochloride, cas: 126541-72-8, stock 26.1g, assay 95.2%, molecular formula: C₁₄H₂₁N • HCl, molecular weight: . |
| N-Benzyl-1-cyclopropylmethanamine, cas: 116373-23-0, stock 16.5g, assay 98.6%, molecular formula: C₁₁H₁₅N, molecular weight: . |
